When will heat transfer stop?

Answers

Answer 1

Answer:

Heat

Explanation:

Heat will always flow from the warmer object to the colder object. The heat transfer will stop when the two objects are at the same temperature and reach thermal equilibrium.

Hope this helps!

Answer 2

Answer:

when both object are the same temperature

Explanation:


Related Questions

is xenon a metal and is Beryllium a metal

Answers

Answer:

No and yes

Explanation:

Xenon is a noble gas and beryllium is a metal

Answer: no and yes i also agree

Xenon is a noble gas and Beryllium a metal

Explanation:

formal units are formed by?

Answers

Answer:

However, when formal units are used to measure length, the measurement can usually be read from a scale on a ruler or tape, which shows units of a particular size. Unit iteration involves knowledge of repeatedly placing identical tightly packing units so that there are no overlaps or gaps.

Explanation:

During free fall which object would have a greater acceleration, an object with a mass of 240 kg or an object with a mass of 10 kg? Explain your answer.

Answers

Answer:

Leroy Jeakins

Explanation:

Catus jack f me in the asss

when a substance melts the kinetic energy

A Decreases then increase

B Decrease

C Stays the same

D Increase

Answers

Answer:

C stays The same.

Is the answer.

Answer = C

the overall kinetic energy level between the two substances actually remains the same

What determines the appearance of the moon from earth?

Answers

It’s determined by the phases of the Moon, and the positions of the Moon. The Moon’s phase only really depends only on its position relatively Earth an the Sun.

To solve this we must be knowing each and every concept related to satellite. Therefore,  moon phases and moon placements have a role the appearance of the moon from earth.

What is satellite?

Any object that circles a planet in a curved route is considered a satellite. There are several man-made (manufactured) satellites, most of which are closer to Earth than the moon, which is Earth's original natural satellite.

We must revisit our buddy Newton in order to comprehend why satellites move in this manner. Gravity, according to Newton, is a force that unites all of the universe's objects. Moon phases and moon placements have a role in determining this. The only major factor affecting the Moon's phase is where it is in relation to Earth and the Sun.

Therefore,  moon phases and moon placements have a role the appearance of the moon from earth.

To learn more about satellite, here:

https://brainly.com/question/21034894

#SPJ2

The total amount of energy before and after a chemical reaction is the same. Therefore, energy is _____.
created

destroyed

converted

conserved

Answers

Answer:

Option (a) is the correct answer.

Explanation:

The law of conservation of energy states that energy can neither be created nor it can be destroyed. It can only be transformed from one form to another.

Therefore, the total amount of energy before and after a chemical reaction is the same. Thus, energy is conserved.

Therefore, we can conclude that option (a) is the correct answer.

Answer:

conserved

Explanation:

law of conservation of energy says that energy can neither be created or destroyed

Sodium metal reacts violently with water and chlorine is a toxic gas, yet we eat sodium chloride. Why is this possible? Select one: a. The properties of compounds are different from the properties of the elements that form the compounds.
b. The properties of compounds are identical to the properties of the elements that form the compounds, and we should not eat sodium chloride because it is toxic.
c. The physical properties of compounds are different from the physical properties of the elements that form the compounds, but the chemical properties of the elements and compound are the same.
d. The chemical properties of compounds are different from the chemical properties of the elements that form the compounds, but the physical properties of the elements and compound are the same.

Answers

Answer:

The properties of compounds are different from the properties of the elements that form the compounds.

Explanation:

When elements form compounds, their properties are significantly modified. The physical and chemical properties of compounds and that of the elements that compose them are significantly different.

The introduction of chemical bonds between different atoms in compounds make the compounds to differ from elements where the atoms are bonded to atoms of the same element.

Darwin told us that science:
saves lives

Answers

Answer:yup!!

Explanation:

Helpppppp!!!!! It’s due today
URGENT!!!!!

Answers

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

Does Rubidium (Rb) have high or low electronegativity?

Answers

Answer:

high

Explanation:

Is copper sulphate malleable?

Answers

Answer:

Yes, Copper (Cu) in its pure form is a reddish-brown metallic element with high ductility and malleability that is an excellent conductor of heat and electricity: atomic weight 63.54; atomic number 29; density 8.94 g/cm3; melting point 1083°C; and boiling point 2595°C.

Answer:

no ,its not malleable

Explanation:

copper II sulphate is a blue compound , which is brittle solid , crystalline .

copper metal is malleable and ductile

please answer willl give brainlist !!! Name the noble gases. What are the common properties between them?

Answers

Answer: Other characteristics of the noble gases are that they all conduct electricity, fluoresce, are odorless and colorless, and are used in many conditions when a stable element is needed to maintain a safe and constant environment. This chemical series contains helium, neon, argon, krypton, xenon, and radon.

An oxide named CrO. So the salt of chromium has the corresponding valence​

Answers

Answer:

this question doesnt make any sene

Explanation:

3. How many moles are in 1.49 x 1023 molecules of iodine?

Answers

Answer:

The answer is 0.25 moles

Explanation:

To find the number of moles in a substance given it's number of entities we use the formula

[tex]n = \frac{N}{L} \\ [/tex]

where n is the number of moles

N is the number of entities

L is the Avogadro's constant which is

6.02 × 10²³ entities

From the question we have

[tex]n = \frac{1.49 \times {10}^{23} }{6.02 \times {10}^{23} } = \frac{1.49}{6.02} \\ = 0.247508305...[/tex]

We have the final answer as

0.25 moles

Hope this helps you

John is performing an experiment in which a solution alternates between a clear color and a bluish-purple color at a regular time interval. He observes that the time interval between color changes is 30 seconds (s). Sally replicates the experiment with the same solution, but at a temperature that is 10 degrees Celsius (°C) higher. What is the most likely time interval between color changes at this higher temperature? *

Answers

Answer:

15 sec

Explanation:

Which compound is
ionic?

Answers

Answer:

chemistry

Explanation:

A student observes that a popcorn kernel has a hard coat. He places the kernel in a moist paper towel and observes it for several days. He notices that the coat splits and a small root emerges. He concludes that

Answers

Answer: Water inside the seed coat creating a pushing force, breaking the seed coat.

Explanation:

Seed germination can be defined as the process by which a new plant emerge out from a seed. The radicle is the first emerging part from a seed and it develops into a root and the plumule is the second emerging part and it develops into a shoot. The light, water, adequate temperature, and soil are the factors that are necessary for seed germination.

According to a given situation, the popcorn kernel will receive the moisture necessary for the germination process, the water will imbibe into the seed coat creating pressure inside the seed and which will cause the seed coat to break and the new plant parts or seedling will emerge out of the seed coat.

For an object to remain at rest which of the following statements must be true

Answers

Answer:

An object that is at rest will stay at rest unless a force acts upon it. An object that is in motion will not change its velocity unless a force acts upon it. This is known as uniform motion. An object continues to do whatever it happens to be doing unless a force is exerted upon it.

Explanation: NEWTONS laws of motion

Can someone help me please will give BRAINIEST
Complete the conversions for the following temperature measurements:
55.3C=_____K
255K=_____C
447K=_____C
-14C=_____K

Answers

55.3C= 328.45K
255K= -18.5C
447K= 174.85C
-14C= 259.15K

Answer:

55.3 = 328.45k

255 = 18.15°c

447 = 173.85°c

-14 = 14k

400 liters of a certain gas is collected at STP. What will the volume be at 273 C and 190 torr pressure?

Answers

Answer:

2.00 L of a gas is collected at 25.0°C and 745.0 mmHg. What is the volume at STP? STP is a common abbreviation for "standard temperature and pressure." You have to recognize that five values are given in the problem and the sixth is an x. Also ... 273 1. A gas has a volume of 800.0 mL at minus 23.00 °C and 300.0 torr.

Explanation:

What is 13.48cm+7.6cm rounded to the correct number of significant figures?

Answers

The lowest amount of significant figures has to be what the answer is...

7.6cm is 2 sig figs where 13.48 is 4, so the answer can only really be as precise as the smallest one (7.6)

7.6 + 13.48 = 21.08cm

Put it into 2 sig figs makes it
=21 cm (2s.f) <— don’t forget to write 2 sig figs next to it because otherwise it is a false answer

Which bond is a very strong dipole-dipole force?
A. A covalent bond
B. An ionic bond
C. A hydrogen bond
D. A metallic bond

Answers

Answer : C. A hydrogen bond

Explanation:

Answer:

A. covalent bond

Explanation:

dipole-dipole interaction results from difference in electronegativity , eg H-F where Fluorine has strong electronegativity but Hydrogen has less electronegativity. hence the bond has dipole moment towards F atom.

True or False;
aa is faster moving lava than pahoehoe?

Answers

Answer:

It is false :l

Explanation:

Pahoehoe is a smooth and continuous lava crust. Pahoehoe forms when the effusion rate is low and consequently the velocity of lava flow is slow. Pahoehoe lava flow is usually at least 10 times slower than typical aa lava flow.

:/


What is the molarity of a hydrochloric acid solution, when 30.0 mL is neutralized by 48.0 mL of 0.100 mol/L
calcium hydroxide?

Answers

The molarity of a hydrochloric acid solution : 0.32 M

Further explanation  

Titration is a procedure for determining the concentration of a solution by reacting with another solution which is known to be concentrated (usually a standard solution).

Titrations can be distinguished including acid-base titration, depositional titration, and redox titration. An acid-base titration is the principle of neutralization of acids and bases is used.  

Acid-base titration formula  

Ma. Va. na = Mb. Vb. nb  

Ma, Mb = acid base concentration  

Va, Vb = acid base volume  

na, nb = acid base valence  

1 ⇒HCl (valence=1, HCl ⇒H⁺+Cl⁻, one H⁺)

2⇒Ca(OH)₂(valence=2, Ca(OH)₂⇒Ca²⁺+2OH⁻, two OH⁻)

M₂=0.1 M

V₂=48 ml=0.048 L

V₁=30 ml=0.03 L

[tex]\tt M_1.V_1.n_1=M_2.V_2.n_2\\\\M_1\times 0.03\times 1=0.1\times 0.048\times 2\\\\M_1=0.32[/tex]

A sealed can of soda contain a pressure of 1.15 atm at 23°C. What is the new pressure at 79 °C? Report your answer to the hundredths place (two decimal places) You do NOT need units in your answer

Answers

Answer:

P₂ = 1.37

Explanation:

Given data:

Initial pressure = 1.15 atm

Initial temperature = 23°C (23+273= 296 K)

Final pressure = ?

Final temperature = 79°C (79+273=352 K)

Solution:

According to Gay-Lussac Law,

The pressure of given amount of a gas is directly proportional to its temperature at constant volume and number of moles.

Mathematical relationship:

P₁/T₁ = P₂/T₂

Now we will put the values in formula:

1.15 atm / 296 K = P₂/352 K

P₂ = 1.15 atm × 352 K / 296 K

P₂ = 404.8 atm. K /296 K

P₂ = 1.37 atm

How does nano frabic work

Answers

Answer:

Nano silver is woven into fabric to give it anti-bacterial properties.

Explanation:

Helps by fending off the bacteria that make those clothes smell after you sweat. Nano-titanium dioxide adds sun protection to clothing just as it does in sunscreen. The use of nanoparticles to achieve fresh-smelling clothes and UV protection may not be safe.

Help please !
A
B
C
D

Answers

Answer:

the answer is letter B. the entropy

Answer:B (the entropy of the gas will increase, and it will spread out to fill both containers) is the correct answer

In a solution, what term is given to the liquid?

Answers

Answer: solvent

solvent is  A solvent is usually a liquid

Answer: Solvent

Explanation: Everything that dissolves in water and the things which dissolve are called solutes and the liquid in which they dissolve in is called a solvent to form a solution.

Which formula equation shows a reversible reaction? 2 Upper N a + Upper F Subscript 2 Baseline right arrow 2 Upper N a Upper F. Upper C a Upper C Upper O Subscript 3 Baseline right arrow Upper C a Upper O + Upper C Upper O Subscript 2. Upper N Upper H Subscript 4 Baseline Upper C l (s) double-pointed arrow Upper N Upper H Subscript 3 Baseline (g) + Upper H Upper C l (g). 2 Upper H Subscript 2 Baseline Upper O Subscript 2 Baseline (a q) right arrow with n above it 2 Upper H Subscript 2 Baseline Upper O (l) + Upper O Subscript 2 Baseline (g).

Answers

Answer:

NH₄Cl    ⇄      NH₃   +    HCl

Explanation:

The formula equation shows a reversible reaction is:

NH₄Cl(s) ⇄ NH₃(g) + HCl(g)

Classification of reactions according to their reversibilityReversible reactions: They occur in both senses, as denoted by a double arrow.Irreversible reactions: They occur in one sense, as denoted by a single arrow.

Let's consider which formula equation shows a reversible reaction.

2 Na + F₂ ⇒ 2 NaF

The single arrow indicates that this is an irreversible reaction.

CaCO₃ ⇒ CaO + CO₂

The single arrow indicates that this is an irreversible reaction.

NH₄Cl(s) ⇄ NH₃(g) + HCl(g)

The double arrow indicates that this is a reversible reaction.

2 H₂O₂(aq) ⇒ 2 H₂O(l) + O₂(g)

The single arrow indicates that this is an irreversible reaction.

The formula equation shows a reversible reaction is:

NH₄Cl(s) ⇄ NH₃(g) + HCl(g)

Learn more about reversible reactions here: https://brainly.com/question/11114490

If a neutral compound is composed of carbon and hydrogen and you know that it has exactly 2 carbons connected by a double bond, how many hydrogens will the compound have?

Answers

Answer: 4 hydrogens

Explanation:

This is what the structure will look like C=C. Remember that it's important that all structures have a complete octet. As it looks right now each carbon is sharing 4 valence electrons so each needs 2 more bonds to hydrogen complete its octet.

Answer: 4 hydrogens

Explanation:

Other Questions
To which subjects of a real number does the number -22 belong will give branlistThe sum of two numbers is 107, the difference is 51. Find the numbers. Customer groups represent different segments if: ___________.a. Their needs require different products/services or different prices. b. Other elements of the canvas need to change in order to reach them. c. They can be categorized into different groups. d. Distinctions only matter if tailoring parts of the business to reach some customers makes it more difficult to reach other customers. What is the Awnser to this? How many moles of CO are produced when 1.8 moles C reacts?Express your answer using two significat figures.5C(s) + 2SO2(g) => CS2(l) +4CO(g) Kim decides to give her old toys to her younger cousins. She gives her cousin Sarah 2/3. Then, she gives her cousin Ryan 2/5 of the remaining toys. She has 6 toys left. How many toys did Kim have to begin write important of ICT in personal life? Create a proportion using the form = to represent the following word problem.What is 60% of 20? The most important part of mitosis is to correctly divide theCell membraneCytoplasmDNAOrganelles Who does Veterans Day honor?On what day is Veterans Day celebrated?What ended on the 11th day of the 11th month in 1918?What do people do at 11 a.m on Veterans Day?People think of the sacrifice that was made by all of the soldiers who had died in the war. What does sacrifice mean?What are some things you have sacrificed to help other people? Some things people sacrifice are time, money, clothing, food or shelter. what is empty space that is free of matter A buffer solution is made that is 0.347 M in H2C2O4 and 0.347 M KHC2O4. 1. If Ka for H2C2O4 is 5.90E^-2, what is the pH of the buffer solution?b. Write the net ionic equation for the reaction that occurs when 0.070 mol KOH is added to 1.00 L of the buffer solution. 9 A book publishing company selected 30 out of 50 books submitted for publishing.What decimal is equivalent to the fraction of books selected for publishing? 8 divided by 32.16?I need help with this, please answer as fast as possible!! How can you can tell if a fat is saturated?A. If it is solid at room temperature and doesnt melt when heated.B. If it is liquid at room temperature and evaporates when heated. C. If it is solid at room temperature but melts when heated. D. If it is liquid at room temperature. 13-715x=130xshow work plzz A potter's wheel is a uniform disk of mass of 10.0 kg and radius 20.0 cm. A 2.0-kg lump of clay, roughly cylindrical with radius 3.0 cm, is placed at the center of the wheel. The wheel initially rotates at 30.0 rev/min. The clay then flattens into a disk of radius 8.0 cm. What is the final angular speed of the wheel?a. 29.6 rev/min b. 29.2 rev/min c. 30.8 rev/min d. 30.4 rev/min e. 30.0 rev/min PLS HELP!! Every minute lasted an hour as I sat next to my patient and watched him struggle for air."Rain Forest Doctor"What is the meaning of the hyperbole? Time moved slowly because they were worried and in a hurry.Time moved quickly because the helicopter was fast.It took them over an hour to get to the hospital.It took them only a couple of minutes to reach the hospital. Inside a car that was at 273 K, a bottle with a pressure at 100,000 pascals warms up to 350 K. If the volume of the bottle remains constant, what is the pressure, in pascals, inside the hot water bottle! Pleaser answer correctly !!!!!!!!!!!!!!!!!!! *use mathematical language* Will mark brainliest !!!!!!!!!!!!!!