Un constructor debe decidir entre rentar o comprar una máquina excavadora. Si fuese a rentar la máquina, el costo de la renta sería de $3,000 mensuales (sobre la base de un año) y el costo diario (gas, aceite y operador) sería de $180 por cada día que la máquina se utilice. Si él fuese a comprarla, sus costos fijos anuales serían de $20,000 y los costos diarios de operación y mantenimiento serían de $230 por cada día que la máquina se utilizara. ¿Cuántos días al año por lo menos, tendría que utilizar el constructor la máquina para justificar la renta en lugar de la compra?

Answers

Answer 1

Answer:

Para decidir si es mejor rentar o comprar la máquina excavadora, se debe calcular el costo anual de cada opción y compararlos.

Costo anual de renta = Costo de renta mensual x 12 meses + (Costo diario x Días de uso)

Costo anual de renta = 3000 x 12 + (180 x Días de uso)

Costo anual de renta = 36000 + 180D

Costo anual de compra = Costo fijo anual + (Costo diario x Días de uso)

Costo anual de compra = 20000 + (230 x Días de uso)

Para encontrar el número mínimo de días de uso que justificarían la renta en lugar de la compra, se debe igualar ambos costos anuales:

36000 + 180D = 20000 + 230D

50D = 16000

D = 320

Por lo tanto, el constructor tendría que utilizar la máquina excavadora al menos 320 días al año para justificar la renta en lugar de la compra.


Related Questions

if a particle moves along the curve y=x^(2/3), such that dx/dt=3 for all x, find: a.) dy/dt when x=-1 and c.) lim dy/dt as x goes to infinity

Answers

Answer:

Step-by-step explanation:

y=x23 so the dt is moved to perticlulate the dy

Question 6 (4 marks available)
.
A group of students were given a spelling test.
The table shows their marks.
a) Work out the range of the marks.
b) How many students are in the group?
c) Work out the mean mark of the group.
Represent and Analyse C
Mark
6
7
8
9
10
Frequency
5
4
7
10
4

Answers

Answer:

A) Range = 2

B) 30 Students

C) 8 Marks

Step-by-step explanation:

A) Range = Biggest - Smallest

Frequency = How many students achieved that many marks

Range = 9-7 = 2

C) Mean = Times the Marks by the Frequencies, add them together, then divide by total frequency (No. of students)

6x5=30

7x4=28

8x7=56

9x10=90

10x4=40

30+28+56+90+40=244

Total Frequency = 30

244/30=8.13

Round to nearest mark = 8

Hope this helped

Four tomatoes cost $3.40. What is the uint raet? pleease help

Answers

Answer: $0.85 per tomato

Step-by-step explanation:

To find the unit rate, we need to determine the cost of one tomato. We can do this by dividing the total cost of the four tomatoes by the number of tomatoes:

$3.40 ÷ 4 = $0.85

Therefore, the cost of one tomato is $0.85. The unit rate can also be expressed as a fraction, which is:

$0.85 per tomato, or 85 cents per tomato

Answer:

The Unit rate is 0.85

Step-by-step explanation:

You divide it by 4

π ≈ 3.14 and round your ansere to the nearest hundredth 7ft

Answers

Answer:

SE π ≈ 3.14 and round your answer to the nearest hundredth

Thus, for 3.14, the number in the hundredth place is 4. To round it, we will look at the third digit after the decimal, which is 0. We know any number lower than 5 is rounded down to zero, so we will round down and the rounded number will be 3.14. Conclusion: 3.14 rounded to the nearest hundredth is 3.14 itself.

Answer: 3.14

Step-by-step explanation: It’s not possible to round the answer so it would just be 3.14

HELP ASAP PLEASE URGENT

Answers

By answering the presented question, we may conclude that Option D is false because function addition is not commutative in general.

what is function?

In mathematics, a function seems to be a link between two sets of numbers in which each member of the first set (known as the domain) corresponds to a specific member of the second set (called the range). In other words, a function takes input from one collection and creates output from another. The variable x has frequently been used to represent inputs, whereas the variable y has been used to represent outputs. A formula or a graph can be used to represent a function. For example, the formula y = 2x + 1 depicts a functional form in which each value of x generates a unique value of y.

The correct statement about functions is:

C. If f is a function, then f(2 + h) = f(2) + f(2 + h) (h)

This is known as the additivity property or the additivity rule. It indicates that evaluating a function at a total of two values is equivalent to evaluating the function at each value individually and then adding the results. This is true for a wide range of functions, including linear and polynomial functions.

Option A is false since the order of function composition matters in general.

Option B is false because matrix multiplication is not always defined unless the matrices' dimensions are compatible.

Option D is false because function addition is not commutative in general.

To know more about function visit:

https://brainly.com/question/28193995

#SPJ1

The circumference of a circle is 6.3mm.
Find the length of the diameter.
Give your answer rounded to 3 SF.

Answers

The diameter of the circle is equal to 2.00 mm rounded to 3 significant figures.

What is the diameter of a circle

The diameter of a circle is a straight line that passes through the center of the circle and whose endpoints are on the circumference of the circle. We can use the formula for the circumference of a circle to calculate for the diameter.

circumference of is derived using πD or 2πr, where D is the diameter, π is 22/7, and r the radius.

The given circle have 6.3 mm circumference, so;

6.3 mm = 22/7 × D

D = (6.3 mm × 7)22 {cross multiplication}

D = 44.1 mm/22

D = 2.0045

Therefore, the diameter of the circle is equal to 2.00 mm rounded to 3 significant figures.

Know more about diameter here:https://brainly.com/question/390660

#SPJ1

Anna borrowed N$20 000 at 5% for three and half years. She wants to pay N$8000 on maturity. To achieve
this, she is planning to pay 2000 in 10 months, 5000 in 16 months from now. How much should she pay in two
and half years from now to meet her obligation?

Answers

Anna should pay N$289,711.85 in two and a half years from now to meet her obligation.

What is interest rate?

An interest rate is the rate at which a borrower pays to a lender for the use of borrowed money. It is expressed as a percentage of the principal amount borrowed and is typically calculated on an annual basis.

According to question:

To solve this problem, we can use the formula for the future value of an annuity:

FV = [tex]P * [(1 + r)^n - 1]/r[/tex]

Where FV is the future value of the annuity, P is the periodic payment, r is the interest rate per period, and n is the total number of periods.

We know that Anna borrowed N$20,000 at 5% for three and a half years, which is equivalent to 42 months. The periodic payment, P, is the sum of N$2,000 and N$5,000, which is N$7,000.

First, we can calculate the future value of the annuity after 42 months:

FV = 7,000 * [(1 + 0.05/12)[tex]^42[/tex] - 1]/(0.05/12)

FV = 7,000 * 56.3743

FV = N$394,120.10

Since Anna wants to pay N$8,000 on maturity, she will need to pay N$386,120.10 at the end of the 42 months to meet her obligation.

Now we can calculate how much Anna should pay in two and a half years from now, which is equivalent to 30 months:

[tex]PV = FV / (1 + r)^n[/tex]

PV = 386,120.10 / (1 + 0.05/12)[tex]^30[/tex]

PV = N$289,711.85

Therefore, Anna should pay N$289,711.85 in two and a half years from now to meet her obligation.

Learn more about interest rate visit:

https://brainly.com/question/30470960

#SPJ1

What is the radian value for 2/3 pi?

Answers

Answer:120 degrees

Step-by-step explanation:

2pi = 360 degrees

pi = 180 degrees

2pi/3 = 120 degrees

2π/3 radians is equivalent to 120°
So the answer is 120 degrees

the breaking strength of a rivet has a mean value of 9,950 psi and a standard deviation of 502 psi. (a) what is the probability that the sample mean breaking strength for a random sample of 40 rivets is between 9,850 and 10,150? (round your answer to four decimal places.) (b) if the sample size had been 15 rather than 40, could the probability requested in part (a) be calculated from the given information? explain your reasoning. - yes, the probability in part (a) can still be calculated from the given information.
- no, n should be greater than 30 in order to apply the central limit theorem. - no, n should be greater than 20 in order to apply the central limit theorem. - no, n should be greater than 50 in order to apply the central limit theorem.

Answers

a) The probability that the sample mean breaking strength for a random sample of 40 rivets is between 9,850 and 10,150 is equal to 0.8903.

b) No, because n should be greater than 30 in order to apply the central limit theorem. So, right choice for answer is option (b).

The normal distribution forms a bell shaped curve. The parameter of normal distribution is [tex]\mu[/tex] and [tex]\sigma ^2 [/tex]. It is a continuous distribution. Now, Mean value of breaking strength of a rivet = 9,950

Standard deviations = 502

Let's X be variable denotes breaking strength of a rivet.

a) Now, a random sample is choosen from X such that, Sample size, n = 40. By using central limit theorem, sample mean follows approximately normal distribution with mean 9950 and standard deviations = 502/√40 = 79.3732 that is [tex]\bar X \: \tilde \: \: N( 9950, ( 79.3732)²)[/tex]

[tex]P( 9,850 < \bar X < 10,150 ) = P( \bar X < 10,150) -

P( \bar X < 9,850) \\ [/tex]

= [tex] P(\frac{\bar X - \mu }{\sigma} < \frac{10,150 - 9950}{79.3732} )- P(\frac{\bar X - \mu }{\sigma} < \frac{10,150 - 9850}{79.3732}) \\ [/tex]

= P( Z < 2.52 ) - P( Z < -1.26)

= 0.9941 - 0.1038

= 0.8903

b) If sample size,n is 15 instead of 40, then the probability requested in part (a) will not be calculated from the provide information. Because, for applying central limit theorem we have sample size must be grater than 30. So, option(b) is correct.

For more information about central limit theorem, visit :

https://brainly.com/question/18403552

#SPJ4

When graphed, an exponential decay function shows that as x increases, f(x) approaches O; and. as x decreases. f(x) increases. True or false?

Answers

the statement that "as x decreases, f(x) increases" is not true for an exponential decay function.

Define exponent

An exponent, also known as a power or index, is a mathematical operation that indicates how many times a number (the base) is multiplied by itself.

When graphed, an exponential decay function shows that

as x increases

f(x) approaches 0

but as x decreases

f(x) also approaches 0.

The function decreases from left to right, meaning that as x increases, f(x) decreases towards 0. However, it does not increase as x decreases.

In general, an exponential decay function can be represented as f(x) = a ×e⁻ᵇˣ, where a and b are constants. As x gets larger and larger, the exponential term e⁻ᵇˣ approaches 0, which causes the overall function value f(x) to approach 0 as well. As x gets smaller and smaller, the exponential term e⁻ᵇˣ becomes larger, but the function value f(x) still approaches 0.

Therefore, the statement that "as x decreases, f(x) increases" is not true for an exponential decay function.

To know more about index, visit:

https://brainly.com/question/14297987

#SPJ1

Find the vertex and the

x​- and

y​-intercepts of the equation

=

2

2


8
y=x
2
−2x−8
Then, use the points to graph the parabola.

a) What is the vertex of the parabola? Enter your answer as an ordered pair.
Vertex
Preview

​b) Identify the

x​-intercept(s) of the parabola. Enter your answers as ordered pairs. Use a comma to separate answers as needed. If there are none, enter
None
None​.

x-intercept
Preview

​c) Identify the

y​-intercept of the parabola. Enter your answer as an ordered pair.

y-intercept
Preview

d) Use the points you found to graph the parabola.

Answers

The vertex of the parabola is at (1, -9). The x-intercepts are (-2, 0) and (4, 0), which are the points where the parabola crosses the x-axis. The y-intercept is (0, -8), which is the point where the parabola crosses the y-axis.

What is vertex ?

To find the vertex and the x- and y-intercepts of the equation y = x² - 2x - 8, we can start by completing the square to put the equation in vertex form:

y = x² - 2x - 8

y + 8 = x² - 2x

y + 8 + 1 = x² - 2x + 1

y + 9 = (x - 1)²

So, the vertex of the parabola is at (1, -9). The x-coordinate of the vertex is found by taking the opposite of the coefficient of x in the equation (which is -2) and dividing by two times the coefficient of x (which is 1), giving x = -(-2) / (2*1) = 1. The y-coordinate is found by substituting x = 1 into the equation.

What are the intercepts?

To find the x-intercepts, we set y = 0 and solve for x:

0 = x² - 2x - 8

0 = (x - 4)(x + 2)

So, the x-intercepts are at (-2, 0) and (4, 0).

To find the y-intercept, we set x = 0 and solve for y:

y = 0² - 2(0) - 8

y = -8

So, the y-intercept is at (0, -8).

To graph the parabola, we can use the vertex and intercepts we found.

The vertex is (1, -9), which is the lowest point on the parabola. The x-intercepts are (-2, 0) and (4, 0), which are the points where the parabola crosses the x-axis. The y-intercept is (0, -8), which is the point where the parabola crosses the y-axis.

To know more about vertex , visit:

https://brainly.com/question/29126162

#SPJ1

What are the roots of 2x2-6x+18=0​

Answers

Answer:

What are the roots of 2x2-6x+18=0​

Step-by-step explanation:

James Kamau stocks and sells cabbages, oranges and mangoes in his grocery at Kitengela market. On Monday last week, he sold 55 cabbages, 100 oranges and 95 mangoes making a total sale of sh. 1,625. On Tuesday, he sold 60 cabbages, 120 oranges and 80 mangoes making a total sale of sh. 1,580. On Wednesday, he sold 75 cabbages, 150 oranges and 120 mangoes making a total sale of sh. 2,175. He buys these items from a distributor at sh.3, sh.2 and sh.6 for a cabbage, an orange and a mango respectively. Required: a) Three simultaneous equations connecting the number of units sold and total sales. (3 Marks) b) The selling price for each. (9 Marks) c) The profit that James Kamau made on each of the three days and his total profits.​

Answers

a) Let x, y, and z be the selling price of one cabbage, one orange, and one mango, respectively.

From the given data, we can write three simultaneous equations:

Monday: 55x + 100y + 95z = 1625

Tuesday: 60x + 120y + 80z = 1580

Wednesday: 75x + 150y + 120z = 2175

b) To find the selling price of each item, we need to solve the system of equations. We can use any method of solving systems of equations, such as substitution or elimination. Here, we will use the elimination method.

Multiplying the first equation by 6, the second equation by -5, and the third equation by 3, we get:

Monday: 330x + 600y + 570z = 9750

Tuesday: -300x - 600y - 400z = -7900

Wednesday: 225x + 450y + 360z = 6525

Adding all three equations, we get:

255x + 450y + 530z = 8385

Dividing both sides by 5, we get:

51x + 90y + 106z = 1677

Now we can use this equation and any of the original equations to solve for one of the variables. Let's use the first equation:

55x + 100y + 95z = 1625

Multiplying both sides by 106 and subtracting 530 times the first equation from it, we get:

76x + 45z = 43

Solving for x, we get:

x = (43 - 45z)/76

Now we can substitute this value of x into any of the previous equations to solve for y and z. Let's use the third equation:

75x + 150y + 120z = 2175

Substituting x, we get:

75[(43-45z)/76] + 150y + 120z = 2175

Simplifying, we get:

43z/2 - 375/2 + 150y = 825

Solving for y, we get:

y = (825 - 43z/2 + 375/2)/150

Now we can substitute the values of x and y into any of the previous equations to solve for z. Let's use the second equation:

60x + 120y + 80z = 1580

Substituting x and y, we get:

60[(43-45z)/76] + 120[(825-43z/2+375/2)/150] + 80z = 1580

Simplifying, we get:

z = 4.6

Substituting z into the equation for y, we get:

y = 3.45

Substituting z and y into the equation for x, we get:

x = 1.5

Therefore, the selling price for one cabbage is sh. 1.5, for one orange is sh. 3.45, and for one mango is sh. 4.6.

c) The profit that James Kamau made on each of the three days and his total profits:

To calculate the profit, we need to subtract the cost of the items from the revenue generated by selling them.

On Monday:

Cost of cabbages = 55 x 3 = 165 shillings

Cost of oranges = 100 x 2 = 200 shillings

Cost of mangoes = 95 x 6 = 570 shillings

Total cost = 935 shillings

Revenue = 1625 shillings

Profit = Revenue - Cost = 1625 - 935 = 690 shillings

On Tuesday:

Cost of cabbages = 60 x 3 = 180 shillings

Cost of oranges = 120 x 2 = 240 shillings

Cost of mangoes = 80 x 6 = 480 shillings

Total cost = 900 shillings

Revenue = 1580 shillings

Profit = Revenue - Cost = 1580 - 900 = 680 shillings

On Wednesday:

Cost of cabbages = 75 x 3 = 225 shillings

Cost of oranges = 150 x 2 = 300 shillings

Cost of mangoes = 120 x 6 = 720 shillings

Total cost = 1245 shillings

Revenue = 2175 shillings

Profit = Revenue - Cost = 2175 - 1245 = 930 shillings

Total profit over three days:

Profit on Monday + Profit on Tuesday + Profit on Wednesday = 690 + 680 + 930 = 2300 shillings

Therefore, James Kamau made a profit of 690 shillings on Monday, 680 shillings on Tuesday and 930 shillings on Wednesday, with a total profit of 2300 shillings over the three days.

Margo borrows $1300, agreeing to pay it back with 3% annual interest after 14 months. How much interest will she pay?

Round your answer to the nearest cent, if necessary.

Answers

Margo will pay approximately $45.50 in interest on the loan.

What is interest?

Borrowers must pay lenders simple interest as a fee in exchange for a loan.

First, we need to calculate the interest that Margo will pay on the loan.

Interest = Principal x Rate x Time

where:

Principal = $1300

Rate = 3% per year (or 0.03)

Time = 14/12 years (since there are 12 months in a year)

Plugging in the values, we get:

Interest = $1300 x 0.03 x (14/12)

Interest ≈ $45.50

Therefore, Margo will pay approximately $45.50 in interest on the loan.

To know more about interest visit,

https://brainly.com/question/25793394

#SPJ1

In the xy-plane, a line crosses the y-axis at the point (0, 3) and passes through the point (4, 5). Which of the following is an equation of the line?

Answers

Answer:

y = 1/2 x + 3

Step-by-step explanation:

y = mx + b

You need to find the slope (m) and the y-intercept (b) to write the equation

The slope is the change in y over the change in x.

(0,3) (4,5)  The y values are 5 and 3.  The x values are 4 and 0.  You find the change by subtracting.

[tex]\frac{5-3}{4-0}[/tex] = [tex]\frac{2}{4}[/tex] = [tex]\frac{1}{2}[/tex]

The slope (m) is 1/2.

The y-intercept is the point (0,b).  They give us this with the point (0,3)  The y-intercept (b) is 3

y = 1/2 x + 3

Helping in the name of Jesus.


A number, c, rounded to 1 d.p. is 47.3
Another number, d, rounded to 1 d.p. is 4.6
What are the lower and upper bounds of c - d?

Answers

The lower bound of c - d is 42.66 and the upper bound of c - d is 42.7.

Calculating the lower and upper bounds of c - d?

Given that

c, rounded to 1 d.p. is 47.3d, rounded to 1 d.p. is 4.6

To find the upper and lower bounds of c - d, we first need to find the maximum and minimum possible values of c and d.

For c rounded to 1 decimal place, the actual value of c could be between 47.25 and 47.34.

This is because when we round to 1 decimal place, we take the first decimal place and round up or down depending on the second decimal place.

Similarly, we have

d = 4.59 to 4.64

So, we have

c - d = 47.25  - 4.59 to 47.34 - 4.64

Evaluate

c - d = 42.66 to 42.7

Therefore, the lower bound of c - d is 42.66 and the upper bound of c - d is 42.7.

Read more about approximation at

https://brainly.com/question/24491627

#SPJ1

The equation A equals P quantity 1 plus 0.06 over 4 end quantity all raised to the power of 4 times t represents the amount of money earned on a compound interest savings account with an annual interest rate of 6% compounded quarterly. If after 15 years the amount in the account is $16,497.06, what is the value of the principal investment? Round the answer to the nearest hundredths place.

Answers

The value of the principal investment (rounded to the nearest hundredth) is $9,000.39.

What is interest rate?

Interest rate refers to the percentage amount charged or paid on a loan or investment, usually expressed as an annual percentage rate (APR). It represents the cost of borrowing or the return earned on an investment.

According to question:

The equation you provided represents the compound interest formula:

A = P[tex](1 + r/n)^(n*t)[/tex]

Given that the annual interest rate is 6% and is compounded quarterly (i.e., n = 4), and the amount in the account after 15 years is $16,497.06, These values can be plugged into the equation to find P.

A = $16,497.06

r = 0.06 (6% expressed as a decimal)

n = 4

t = 15

$16,497.06 = P[tex](1 + 0.06/4)^(4*15)[/tex]

Dividing both sides by [tex](1 + 0.06/4)^(4*15)[/tex] to isolate P, we get:

P = $16,497.06 / [tex](1 + 0.06/4)^(4*15)[/tex]

Plugging in the values and solving for P using a calculator, we get:

P ≈ $9,000.39

So, the value of the principal investment (rounded to the nearest hundredth) is $9,000.39.

To know more about interest rate visit:

https://brainly.com/question/17088238

#SPJ1

23 cats and 27 dogs were entered into a cat and dog show. What percentage of the entries were dogs?​

Answers

27+23= 50
50 x 2 = 100
27 x2 = 54
54/100 = 54%

If a coordinate system is set up such that the positive x axis points in a direction 60° above the horizontal, what should be the angle between the x axis and the y axis?


What should be the direction of the positive y axis?
(measured from the horizontal)

Answers

The two axes should be perpendicular, so the angle betwen them is 90°, and the y-axis is 150° above the horizontal.

What should be the angle between the x axis and the y axis?

If we have a coordinate axis, the two axis should be perpendicular between them, this means that the angle between the positive x-axis and the positive y-axis should always be 90°.

Now, what should be the direction of the positive y axis?

We know that the positive x-axis is 60° above the horizontal, and the angle between the two axes is 90°, then the positive y axis is at:

60° + 90° = 150°

The positive y-axis is at 150° above the horizontal line.

Learn more about coordinate axis at:

https://brainly.com/question/11337174

#SPJ1

Scott has a flat screen TV with an area of A
square inches. The width of the TV is 36 inches. Which equation represents x the length of the TV in inches?

A. X = 36/A

B. X= A + 36

C. X = A - 2(36)

D. X= A/36

Explain here:

Answers

Answer:

D

Step-by-step explanation:

A=LW

A=L(36)

Divide by 36

L=A/36

(L=X)

:)

What is the meaning of "we number the vertices counterclockwise 0, 1, ..., n − 1, and number the axes of symmetry counterclockwise, 0, 1, ..., n − 1 "?

Answers

The statement "we number the vertices counterclockwise 0, 1, ..., n − 1, and number the axes of symmetry counterclockwise, 0, 1, ..., n − 1" is likely referring to a specific mathematical context, such as a polygon or a regular solid.

What is the meaning of "we number the vertices counterclockwise 0, 1, ..., n − 1?

In this context, "numbering the vertices counterclockwise" means that the vertices (or corners) of the shape are given labels or numbers in a particular order, moving counterclockwise around the shape. For example, in a triangle, the vertices might be labeled as 0, 1, and 2, in counterclockwise order around the triangle.

Similarly, "numbering the axes of symmetry counterclockwise" means that the axes of symmetry (or lines of reflection) in the shape are also given labels or numbers in a particular order, moving counterclockwise around the shape. For example, in a regular pentagon, there are 5 axes of symmetry that can be labeled as 0, 1, 2, 3, and 4 in counterclockwise order around the pentagon.

By establishing this numbering convention, mathematicians and scientists can more easily communicate about the properties and characteristics of the shape or object, and can refer to specific vertices or axes of symmetry in a standardized way.

Learn more about mathematical context at https://brainly.com/question/29277078

#SPJ1

Which of the following relations is a function? A. (7, 1), (-2, 4), (4, 1), (7, 2) B. (4, 0), (-2, 3), (7, 1), (-2, 5) C. (4, 4), (-2, 2), (7, 1), (-7, 2) D. (4, 4), (-2, 6), (4, 3), (-7, 2)

Answers

C. (4, 4), (-2, 2), (7, 1), (-7, 2)

In mathematics, a function from a set X to a set Y assigns to each element of X exactly one element of Y.[1] The set X is called the domain of the function[2] and the set Y is called the codomain of the function

Find the resolved part of the vector p = (6i-3j+9k) in the direction of a = (2i+2j-k)​

Answers

The calculated resolved part of vector p (6i-3j+9k) in the direction of a is 2i + 2j - k.

Calculating the resolved part of the vector

Given that

p = (6i-3j+9k)

a =  (2i+2j-k)​

To find the resolved part of the vector p in the direction of a, we can use the following formula:

r = (p · a) / |a|

where · denotes the dot product and |a| denotes the magnitude of vector a.

First, we need to calculate the magnitude of vector a:

|a| = √(2² + 2² + (-1)²)

|a| = √(4 + 4 + 1)

|a| = √9

|a| = 3

Next, we need to calculate the dot product p · a:

p · a = (6i - 3j + 9k) · (2i + 2j - k)

= 12i + 12j - 6k - 6i - 6j + 3k

= 6i + 6j - 3k

Finally, we can calculate the resolved part of p in the direction of a:

r = (p · a) / |a|

= (6i + 6j - 3k) / 3

= 2i + 2j - k

Therefore, the resolved part of vector p in the direction of a is 2i + 2j - k.

Read more about vector at

https://brainly.com/question/26700114

#SPJ1

establish the identity

Answers

The identity is cos²∅+sin²∅= 1.

What is trignometric ratios?

This is the boundary or contour length of a 2D geometric shape.

Depending on their size, multiple shapes may have the same circumference. For example, imagine a triangle made up of wires of length L.

The same wire can be used to create a square if all sides are the same length.

The length covered by the perimeter of the shape is called the perimeter. Therefore, the units of circumference are the same as the units of length.

As we can say, the surroundings are one-dimensinal. As a result, you can measure in meters, kilometers, millimeters, etc.

Inches, feet, yards, and miles are other globally recognized units of circumference measurement.

According to our question-

cos(90∘−θ)=sinθ

sin(90∘−θ)=cosθ

cos²∅+sin²∅= 1.

learn more about trigonometric ratios click here:

brainly.com/question/1201366

#SPJ1

Which best describes the relationship between the line that passes through the points (9, –5) and (5, –2) and the line that passes through the points (–4, –2) and (–8, 1)?
A. same line
B. parallel
C. neither perpendicular nor parallel
D. perpendicular

Answers

Answer:

B. Parallel

Step-by-step explanation:

Let S1 be the slope of the line passing through the points

(9, - 5) and (5, - 2).

S1 = (- 2 -(- 5))/(5 - 9)

   = (- 2 + 5)/(- 4)

   = 3/(- 4)

S1 = - 3/4

Let S2 be the slope of the line passing through the points

(- 4, - 2) and (- 8, 1).

S2 = (1 -(- 2))/(-8 -(- 4))

     = (1 + 2)/(- 8 + 4)

     = 3/(-4)

S2 = - 3/4

Since,

the slope of two lines are same.

They are parallel.

Write down all of the statements below that are correct.
7.2 cm³ > 720 mm³
0.087 m³ <8700 cm³
300 mm³ = 0.03 cm³
8 m³=8,000,000 cm³

Answers

The correct statements for inequality are:

0.087 m³ < 8700 cm³

8 m³ = 8,000,000 cm³

What is inequality?

An inequality is a mathematical statement that compares two expressions or values and indicates that one is greater than, less than, or not equal to the other. Inequalities use symbols such as "<" (less than), ">" (greater than), "≤" (less than or equal to), "≥" (greater than or equal to), and "≠" (not equal to) to show the relationship between the two expressions.

Here,

The statement "300 mm³ = 0.03 cm³" is incorrect because 300 mm³ is equal to 0.3 cm³ (since 1 cm = 10 mm).

The statement "7.2 cm³ > 720 mm³" is incorrect because 1 cm³ is equal to 1000 mm³, so 7.2 cm³ is equal to 7200 mm³. Therefore, 7.2 cm³ is less than 720 mm³.

Note: When comparing volumes, it is important to make sure that the units are consistent (e.g. converting all volumes to the same unit of measurement) before making any comparisons.

To know more about inequality,

https://brainly.com/question/30239204

#SPJ1

Every day Jin reads for 0.75
hours in the morning and 1.25
hours in the evening. He uses the expression 0.75d+1.25d
to keep track of the number of hours he has read for any number of days, d
. If Jin reads for 20
days, how many hours has he read?

Answers

Answer:

Step-by-step explanation:The number of hours Jin reads in 20 days is 39.8 hours.

The expression for the given situation is 0.75d + 1.24d.

What is an expression?

An expression is a combination of terms that are combined by using mathematical operations such as subtraction, addition, multiplication, and division.

In the given expression 0.75d + 1.24d, d is number of days.

Substitute d=20 in 0.75d + 1.24d, we get

0.75(20) + 1.24(20)

15+24.8

=39.8 hours

Hence, the number of hours Jin reads in 20 days is 39.8 hours

a) The temperature the day after Hurricane Katrina in August 2005 was 91°F. It then fell three degrees, rose 5 degrees and fell another 2°F. What was the final temperature?​

Answers

The final temp is 91 degrees
Because:
91-3+5-2=91

PLEASE HURRY WILL GIVE BRAINLIEST AND 5 STARS!!!!!!

To add (or subtract) in Scientific Notation, you must have the same Response area. Then you can Response area the co-efficients and Response area the power of 10.

To multiply in Scientific Notation, you must multiply the Response area and Response area the powers of 10.

To divide in Scientific Notation, you must Response area the co-efficients and Response area the powers of 10.

Answers

According to the given information, divide in Scientific Notation, you must divide the co-efficients and subtract the powers of 10.

What is Scientific Notation?

Scientific notation, also known as standard form or exponential notation, is a way of expressing numbers that are either very large or very small, using powers of 10. In scientific notation, a number is expressed in the form:

a x 10ⁿ

where "a" is a number between 1 and 10 (usually a decimal), and "n" is an integer (positive or negative) that represents the power of 10 by which the number is multiplied.

To add (or subtract) in Scientific Notation, you must have the same power of 10. Then you can add (or subtract) the co-efficients and keep the power of 10.

To multiply in Scientific Notation, you must multiply the co-efficients and add the powers of 10.

To divide in Scientific Notation, you must divide the co-efficients and subtract the powers of 10.

To know more about Scientific Notation visit:

brainly.com/question/18073768

#SPJ1

1) Find fraction numerator d y over denominator d x end fraction for y equals x squared ln open parentheses fraction numerator x over denominator x plus 3 end fraction close parentheses
Halle dy/dx para y = x^2In(x/x+3)

Answers

The result is, [tex]\dfrac{dy}{dx} = x \times ln\dfrac{x}{(x+3)} + 2x\times ln\dfrac{x}{(x+3)} - \dfrac{(3x^2)}{(x+3)^2}[/tex].

The derivative of a function is a measure of how much the function changes as its input (often time or space) changes. More specifically, the derivative is the instantaneous rate of change of the function at a particular point.

To find the derivative of y = x^2ln(x/(x+3)), we use the product rule and the chain rule.

y = x^2 * ln(x/(x+3))

[tex]y' = 2x \times ln\dfrac{x}{(x+3)} + x^2 \times \dfrac{d}{dx}ln\dfrac{x}{(x+3)}[/tex]

To find the derivative of ln(x/(x+3)), we use the quotient rule:

[tex]\dfrac{d}{dx} ln\dfrac{x}{(x+3)} = \dfrac{1}{\dfrac{x}{(x+3)}} \times \dfrac{d}{dx}\dfrac{x}{(x+3)} - \dfrac{1}{\dfrac{x+3}{x}} \times \dfrac{d}{dx}\dfrac{(x+3)}{x}[/tex]

= [(x+3)/(x^2)] - [x/(x+3)^2]

= (x^2 + 3x - x^2)/(x^2(x+3)^2)

= 3(x+1)/(x^2(x+3)^2)

Substituting this back into the original equation, we get:

y' = 2x * ln(x/(x+3)) + x^2 * [3(x+1)/(x^2(x+3)^2)]

= 2x * ln(x/(x+3)) + 3(x+1)/(x+3)^2

To know more about numerator, here

brainly.com/question/31145208

#SPJ4

Other Questions
A) Explain the difference between Monkish concept and moderate path with examples. (word limit: 300 words, 3 marks)b) Discuss difference between Ideology and Islamic Ideology. (word limit: 200 words,3 marks)c) Define culture and what are the main features of Pakistani culture according to you. Explain the vital role of regional languages in Pakistani Culture with examples. (word limit: 300 words, 4 marks) Please help, this was due yesterday!!!!! rank the following alkyl halides in order of increasing reactivity in an E2 reaction. Be sure to answer all parts(CH3)2C(Br)CH2CH2CH3 (CH3)2CHCH2CH(Br)CH3 (CH3)2CHCH2CH2CH2Brlowest reactivity: ?Intermediate reactivity: ?Highest reactivity: ? the imaginary line around the earth that is the same distance from the north and south poles. A frog is riding on the top of a cylindrical piece of wood floating in still water. Half of the wood, with a diameter of 4 cm and length 20 cm, is immersed in water. The density of water is 1 gm/cc. a) What is the mass of the wood along with the frog? b) After the frog slowly goes into the water only one third of the wood remains immersed in water. Calculate the mass of the frog. c) Calculate x, the distance between the water level and the center of the circular end of the wooden piece. d) Briefly describe the motion of the wood after the instance the frog moves into the water. Give a rough sketch of x as a function of time. an unknown gas effuses through an opening at a rate 3.16 time slower than nenon gas. estimate the mola mass of this unknown gas. Tom is making birdhouses to sell at a farmers market each birdhouse requires 4.5 feet of wood planks to build and he sells them for $19.75 each if he has no more than 80 feet of planks to make birdhouses how much money can Tom earn at the farmers market. Show your work I know the answer but not the work. Simplify to create an equivalent expression2(-2-4p) + 2(-2p-1) How high would a 8 kg mass need to be lifted to have a potential energy of 400 J? Cmo presentars el escenario y los personajes de tu fbula? a car loan is taken for $23,000 to be paid back in 6 years, with monthly payments of $564. what nominal annual interest rate is being charged in this loan? what is the solubility of strontium sulfate, srso4, in 0.36 m sodium sulfate, na2so4 solution? What must be the mass of a chunck of aluminum that takes 8550 J of engery ti be heated from 50 C to 72 C the layer of cells that selectively allows water and other materials through to the vascular tissue is known as the If something is copyrighted, how can it be used? which of the following was a difference between the british government and the colonial governments in america? group of answer choices women could vote in britain. a larger proportion of men could vote in britain than could vote in the colonies. there was no aristocratic class of nobles in the colonies. the colonies did not have their own governments. The Jones family eats 572 bananas each year. How many do they average eating in one week supercoiling of dna choose one: a. is an energy-independent process that happens spontaneously. b. is unnecessary to fit the dna into the cell. c. occurs only in prokaryotes. d. may be affected by antibiotics. The perimeter of Aarons rectangular bedroom is 368 inches. His room is 8 feet wide. What is the area of Aarons bedroom? The skin keeps __________ and ________ out of the body