Someone knows how to solve this? It was found that 0.0005 mol of Ca (OH) 2 dissolved in 100 cm3 of solution is 80% dissociated. Calculate the pH of this solution.

Answers

Answer 1

Answer:

pH = 11.9

Explanation:

First, we determine the number of OH⁻ moles dissolved:

80% of Ca(OH)₂ is dissolved:

0.0005 mol * 80/100 = 4x10⁻⁴ mol Ca(OH)₂

There are two OH⁻ moles per Ca(OH)₂ mol:

4x10⁻⁴ * 2 = 8x10⁻⁴ mol OH⁻

Now we can calculate the molar concentration of OH⁻ (moles/L):

100 cm³ = 100 mL100 mL ⇒ 100/1000 = 0.1 L[OH⁻] =  8x10⁻⁴ mol / 0.1 L = 8x10⁻³ M

Then we calculate the pOH of the solution:

pOH = -log[OH⁻] = -log(8x10⁻³ M) = 2.10

Finally, we can calculate the pH of the solution using the equation

pH + pOH = 14pH = 14 - pOH = 14 -2.10pH = 11.9


Related Questions

In a solution, what term is given to the liquid?

Answers

Answer: solvent

solvent is  A solvent is usually a liquid

Answer: Solvent

Explanation: Everything that dissolves in water and the things which dissolve are called solutes and the liquid in which they dissolve in is called a solvent to form a solution.

What happens when A mixture of ammonia and oxygen is passed over platinum gauze heated to 800°C .​

Answers

Answer:

The mixture forms nitrogen oxide and water upon reaction. However, 800 degree Celsius falls at higher limit of the process condition. It being an exothermic reaction, the reaction rate will be on the lower side than average.

Can someone help me please will give BRAINIEST
Complete the conversions for the following temperature measurements:
55.3C=_____K
255K=_____C
447K=_____C
-14C=_____K

Answers

55.3C= 328.45K
255K= -18.5C
447K= 174.85C
-14C= 259.15K

Answer:

55.3 = 328.45k

255 = 18.15°c

447 = 173.85°c

-14 = 14k

An oxide named CrO. So the salt of chromium has the corresponding valence​

Answers

Answer:

this question doesnt make any sene

Explanation:

A sealed can of soda contain a pressure of 1.15 atm at 23°C. What is the new pressure at 79 °C? Report your answer to the hundredths place (two decimal places) You do NOT need units in your answer

Answers

Answer:

P₂ = 1.37

Explanation:

Given data:

Initial pressure = 1.15 atm

Initial temperature = 23°C (23+273= 296 K)

Final pressure = ?

Final temperature = 79°C (79+273=352 K)

Solution:

According to Gay-Lussac Law,

The pressure of given amount of a gas is directly proportional to its temperature at constant volume and number of moles.

Mathematical relationship:

P₁/T₁ = P₂/T₂

Now we will put the values in formula:

1.15 atm / 296 K = P₂/352 K

P₂ = 1.15 atm × 352 K / 296 K

P₂ = 404.8 atm. K /296 K

P₂ = 1.37 atm

Which formula equation shows a reversible reaction? 2 Upper N a + Upper F Subscript 2 Baseline right arrow 2 Upper N a Upper F. Upper C a Upper C Upper O Subscript 3 Baseline right arrow Upper C a Upper O + Upper C Upper O Subscript 2. Upper N Upper H Subscript 4 Baseline Upper C l (s) double-pointed arrow Upper N Upper H Subscript 3 Baseline (g) + Upper H Upper C l (g). 2 Upper H Subscript 2 Baseline Upper O Subscript 2 Baseline (a q) right arrow with n above it 2 Upper H Subscript 2 Baseline Upper O (l) + Upper O Subscript 2 Baseline (g).

Answers

Answer:

NH₄Cl    ⇄      NH₃   +    HCl

Explanation:

The formula equation shows a reversible reaction is:

NH₄Cl(s) ⇄ NH₃(g) + HCl(g)

Classification of reactions according to their reversibilityReversible reactions: They occur in both senses, as denoted by a double arrow.Irreversible reactions: They occur in one sense, as denoted by a single arrow.

Let's consider which formula equation shows a reversible reaction.

2 Na + F₂ ⇒ 2 NaF

The single arrow indicates that this is an irreversible reaction.

CaCO₃ ⇒ CaO + CO₂

The single arrow indicates that this is an irreversible reaction.

NH₄Cl(s) ⇄ NH₃(g) + HCl(g)

The double arrow indicates that this is a reversible reaction.

2 H₂O₂(aq) ⇒ 2 H₂O(l) + O₂(g)

The single arrow indicates that this is an irreversible reaction.

The formula equation shows a reversible reaction is:

NH₄Cl(s) ⇄ NH₃(g) + HCl(g)

Learn more about reversible reactions here: https://brainly.com/question/11114490

How does nano frabic work

Answers

Answer:

Nano silver is woven into fabric to give it anti-bacterial properties.

Explanation:

Helps by fending off the bacteria that make those clothes smell after you sweat. Nano-titanium dioxide adds sun protection to clothing just as it does in sunscreen. The use of nanoparticles to achieve fresh-smelling clothes and UV protection may not be safe.

is xenon a metal and is Beryllium a metal

Answers

Answer:

No and yes

Explanation:

Xenon is a noble gas and beryllium is a metal

Answer: no and yes i also agree

Xenon is a noble gas and Beryllium a metal

Explanation:

1. Which of the following is not a major classification for elements in the periodic table?
O a. metals
O b. metalloids
O c. nonmetals
O d. noble gases

Answers

Answer:

Noble gases

Explanation:

Noble gases good studying

Darwin told us that science:
saves lives

Answers

Answer:yup!!

Explanation:

please answer willl give brainlist !!! Name the noble gases. What are the common properties between them?

Answers

Answer: Other characteristics of the noble gases are that they all conduct electricity, fluoresce, are odorless and colorless, and are used in many conditions when a stable element is needed to maintain a safe and constant environment. This chemical series contains helium, neon, argon, krypton, xenon, and radon.

Sodium metal reacts violently with water and chlorine is a toxic gas, yet we eat sodium chloride. Why is this possible? Select one: a. The properties of compounds are different from the properties of the elements that form the compounds.
b. The properties of compounds are identical to the properties of the elements that form the compounds, and we should not eat sodium chloride because it is toxic.
c. The physical properties of compounds are different from the physical properties of the elements that form the compounds, but the chemical properties of the elements and compound are the same.
d. The chemical properties of compounds are different from the chemical properties of the elements that form the compounds, but the physical properties of the elements and compound are the same.

Answers

Answer:

The properties of compounds are different from the properties of the elements that form the compounds.

Explanation:

When elements form compounds, their properties are significantly modified. The physical and chemical properties of compounds and that of the elements that compose them are significantly different.

The introduction of chemical bonds between different atoms in compounds make the compounds to differ from elements where the atoms are bonded to atoms of the same element.

What determines the appearance of the moon from earth?

Answers

It’s determined by the phases of the Moon, and the positions of the Moon. The Moon’s phase only really depends only on its position relatively Earth an the Sun.

To solve this we must be knowing each and every concept related to satellite. Therefore,  moon phases and moon placements have a role the appearance of the moon from earth.

What is satellite?

Any object that circles a planet in a curved route is considered a satellite. There are several man-made (manufactured) satellites, most of which are closer to Earth than the moon, which is Earth's original natural satellite.

We must revisit our buddy Newton in order to comprehend why satellites move in this manner. Gravity, according to Newton, is a force that unites all of the universe's objects. Moon phases and moon placements have a role in determining this. The only major factor affecting the Moon's phase is where it is in relation to Earth and the Sun.

Therefore,  moon phases and moon placements have a role the appearance of the moon from earth.

To learn more about satellite, here:

https://brainly.com/question/21034894

#SPJ2

when a substance melts the kinetic energy

A Decreases then increase

B Decrease

C Stays the same

D Increase

Answers

Answer:

C stays The same.

Is the answer.

Answer = C

the overall kinetic energy level between the two substances actually remains the same

3. How many moles are in 1.49 x 1023 molecules of iodine?

Answers

Answer:

The answer is 0.25 moles

Explanation:

To find the number of moles in a substance given it's number of entities we use the formula

[tex]n = \frac{N}{L} \\ [/tex]

where n is the number of moles

N is the number of entities

L is the Avogadro's constant which is

6.02 × 10²³ entities

From the question we have

[tex]n = \frac{1.49 \times {10}^{23} }{6.02 \times {10}^{23} } = \frac{1.49}{6.02} \\ = 0.247508305...[/tex]

We have the final answer as

0.25 moles

Hope this helps you

how many significant figures are in 0.00970 g?

Answers

Answer:

3

Explanation:

begining 0's are never significant

all numbers 1-9 are always significant

ending 0's are only significant when there is

a decimal.

True or False;
aa is faster moving lava than pahoehoe?

Answers

Answer:

It is false :l

Explanation:

Pahoehoe is a smooth and continuous lava crust. Pahoehoe forms when the effusion rate is low and consequently the velocity of lava flow is slow. Pahoehoe lava flow is usually at least 10 times slower than typical aa lava flow.

:/

Non examples of chemical change
List some please

Answers

Answer:

Crushing a can.

Melting an ice cube.

Boiling water.

Mixing sand and water.

Breaking a glass.

Dissolving sugar and water.

Shredding paper.

Chopping wood.

Some non-examples of the chemical reaction should be boiling water, glass breaking out, etc.

Chemical reaction

It is a process where one or more substances that we know as reactants should be transformed into one or more distinct substances that we know as products. Here the substances should be treated as the elements of chemicals or the compounds.Chemical reactions are an integral part of technology, culture, and indeed of life itself. Burning fuels, smelting iron, making glass and pottery, brewing beer, and making wine and cheese are among many examples of activities incorporating chemical reactions that have been known and used for thousands of years. Chemical reactions abound in the geology of Earth, in the atmosphere and oceans, and in a vast array of complicated processes that occur in all living systems.

Therefore, Some non-examples of the chemical reaction should be boiling water, glass breaking out, etc.

Learn more about non examples of chemical change

https://brainly.com/question/1737296

#SPJ2

Help please !
A
B
C
D

Answers

Answer:

the answer is letter B. the entropy

Answer:B (the entropy of the gas will increase, and it will spread out to fill both containers) is the correct answer

A student observes that a popcorn kernel has a hard coat. He places the kernel in a moist paper towel and observes it for several days. He notices that the coat splits and a small root emerges. He concludes that

Answers

Answer: Water inside the seed coat creating a pushing force, breaking the seed coat.

Explanation:

Seed germination can be defined as the process by which a new plant emerge out from a seed. The radicle is the first emerging part from a seed and it develops into a root and the plumule is the second emerging part and it develops into a shoot. The light, water, adequate temperature, and soil are the factors that are necessary for seed germination.

According to a given situation, the popcorn kernel will receive the moisture necessary for the germination process, the water will imbibe into the seed coat creating pressure inside the seed and which will cause the seed coat to break and the new plant parts or seedling will emerge out of the seed coat.

Predict: Note the type of reaction you expect for
the sole reactant Na2CO3.
a. single replacement
b. double replacement
c. combustion (and synthesis)
d. synthesis
e. decomposition

Answers

Answer:

double replacement

Explanation:

Answer:

It is indeed double replacement

Explanation:

400 liters of a certain gas is collected at STP. What will the volume be at 273 C and 190 torr pressure?

Answers

Answer:

2.00 L of a gas is collected at 25.0°C and 745.0 mmHg. What is the volume at STP? STP is a common abbreviation for "standard temperature and pressure." You have to recognize that five values are given in the problem and the sixth is an x. Also ... 273 1. A gas has a volume of 800.0 mL at minus 23.00 °C and 300.0 torr.

Explanation:

If a radiation source has a wavelength of 4.76 x 10-6 m, then what is its frequency?

Answers

Answer: 6.3 * 10^15

Explanation:

wavelength = speed of light / frequency

so rewriting the equation gives frequency = speed of light / wavelength

so 3.0 *10^10 / 4.76 * 10^-6  = 6.3 * 10^15

Redi placed pieces of meat in several jars. He divided the jars into two groups. He covered the first group of jars with fine cloth. He left the second group of jars uncovered. Redi observed the jars for several days. He saw flies on the cloth of the covered jars, and he saw flies laying eggs on the meat in the uncovered jars. Maggots appeared only on the meat in the group of jars left uncovered.


What is the question in Redi's experiment?


What is the independent (test) variable?


What is the dependent (outcome) variable?


Write a hypothesis for Redi's experiment

Answers

Answer:

Experiment Question, Independent & Dependent Variable, Null & Alternate Hypothesis

Explanation:

Experiment Question : Whether fine cloth coverage over chicken jars effect flies & their eggs in ambience ?

Independent Variable : The causal variable, ie cloth cover existence on the chicken jar

Dependent Variable : The resultant variable, ie presence of flies & their eggs near jar, meat

Null Hypothesis [H0] : Cloth cover on chicken jar doesn't effects flies' & eggs' presence around jar, chicken.

Alternate Hypothesis [H1] : Cloth cover on chicken jar effects flies' & eggs' presence around jar, chicken.

Does Rubidium (Rb) have high or low electronegativity?

Answers

Answer:

high

Explanation:

If a neutral compound is composed of carbon and hydrogen and you know that it has exactly 2 carbons connected by a double bond, how many hydrogens will the compound have?

Answers

Answer: 4 hydrogens

Explanation:

This is what the structure will look like C=C. Remember that it's important that all structures have a complete octet. As it looks right now each carbon is sharing 4 valence electrons so each needs 2 more bonds to hydrogen complete its octet.

Answer: 4 hydrogens

Explanation:

Helpppppp!!!!! It’s due today
URGENT!!!!!

Answers

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

formal units are formed by?

Answers

Answer:

However, when formal units are used to measure length, the measurement can usually be read from a scale on a ruler or tape, which shows units of a particular size. Unit iteration involves knowledge of repeatedly placing identical tightly packing units so that there are no overlaps or gaps.

Explanation:

John is performing an experiment in which a solution alternates between a clear color and a bluish-purple color at a regular time interval. He observes that the time interval between color changes is 30 seconds (s). Sally replicates the experiment with the same solution, but at a temperature that is 10 degrees Celsius (°C) higher. What is the most likely time interval between color changes at this higher temperature? *

Answers

Answer:

15 sec

Explanation:

Which bond is a very strong dipole-dipole force?
A. A covalent bond
B. An ionic bond
C. A hydrogen bond
D. A metallic bond

Answers

Answer : C. A hydrogen bond

Explanation:

Answer:

A. covalent bond

Explanation:

dipole-dipole interaction results from difference in electronegativity , eg H-F where Fluorine has strong electronegativity but Hydrogen has less electronegativity. hence the bond has dipole moment towards F atom.

Other Questions
Which detail about the box suggests something sinister ? Part AWhat inference can be made from the text "Healing a Wounded Heart: Daniel Hale Williams"?African Americans seeking to be trained in health care had many opportunities.African Americans were able to see the same doctors as white people.Prejudice against African Americans ended after the Civil War.Prejudice against African Americans continued after the Civil War.Question 2Part BWhich evidence from the text best supports the answer to Part A?"Williams himself had come a long way before founding the hospital.""After three years of hard work, Williams graduated with his M.D. degree in 1883.""He also saw that black people...did not receive the same quality of care available to white people.""He was born in Pennsylvania in 1856, before the Civil War, at a time when almost four million African Americans...were still slaves." 4. All of the following are limiting factors to a population EXCEPT A. competition B. predation C. human disturbances D. immigration The question is in the link pls help a student out guys this is my a question for my end of semester. In constructing a common-size income statement, depreciation will be______. A. omitted since it is a noncash expense. B. expressed as a percentage of sales. C. added back to convert net income to cash flows. D. expressed as a percentage of total assets. E. expressed as a percentage of gross fixed assets. How does Socrates use allegory to characterize the typical human being awareness PLEASE ANSWER! WORTH 5-10 POINTS! What is a main reason that the alliance between Ousamequins people and the people of Plymouth ended?A-Tens of thousands of English settlers arrived, overwhelming the region of New England.B-Some Wampanoag groups became Christians.C-The U.S government forced the Wampanoag people to relocate.D-The settlers insisted on sharing the land.Its not D by the way. Is the electoral college democratic? Why or why not? Explain in one paragraph why it is necessary to verify data after it as been entered Why does it hurt right where my Appendix was, if i already had it removed, and i almost could have died, but why does it still hurt me now? Is it bad or normal? I got it removed October 26 2019. Certain gases in the atmosphere trap heat on earth. What is the name of this phenomenon. A.glacial melting B.cooling period C.global warming D.the greenhouse effect When it first entered World War II, why did the United States agree to commit most of its resources to the war in Europe? A photon has an energy of 2.34x10-28 J. What is its frequency? What was the condition made by Andrew Johnson upon granting his pardons for citizens of the South? that all individuals pardoned must pay a minimal fine that only former enslaved people would be pardoned, as they were forced into servitude that all individuals would be pardoned as long as they never again committed the act of slavery SOMEONE PLEASE HELP MEHow does Dickens present the Ghost of Christmas Past?(analyse and include quotations) Mediterranean is a type of ____.polar climatetemperate continental climatedry climatetemperate marine climate Is y = 5x 3 a linear function? If so, graph the function. 3*10^4+2.5*10^0ghfuigffhh Explain one way the neolithic and bronze ages were different The chart below shows the numbers of endagered and threatened species both here in the United States and abroad Endangered Threatened United States Foreign United States Foreign Mammals 68 251 10 20 Birds 77 175 13 6 Reptiles 17 67 22 19 Anphibians 11 8 10 1 Find the probability that it is: a. Threatened and in the United States b. An endangered foreign bird c. A mammal or a threatened foreign species