Solve 48x - 30 = 30 + 78x

Answers

Answer 1
X = -2 how this helps
Solve 48x - 30 = 30 + 78x

Related Questions

Find the value of x.

No links please!

Answers

Answer:

Step-by-step explanation:

tan(26)=42/x hence x=42/tan(26)=86.113

There are 15 pieces of the same size candy in a bag. Four are banana flavored, three strawberry flavored, six cherry flavored, and two orange flavored. What would be the probability of picking an orange or a cherry flavored candy from the bag? Round to the nearest tenth.

Answers

The probability of picking an orange or a cherry flavored candy from the bag is [tex]\frac{8}{15}[/tex].

Given that, total number of candies=15, banana flavoured candies=4, strawberry flavoured candies=3, cherry flavoured candies=6 and orange flavoured candies=2.

We need to find out what would be the probability of picking an orange or a cherry-flavoured candy from the bag.

What is a probability formula?

According to the probability formula, the likelihood that an event will occur is equal to the proportion of favourable outcomes to all outcomes.

The probability of an event[tex]=\frac{Number of favourable outcomes}{Total Number of outcomes}[/tex].

Now, the probability of picking an orange flavored candy from the bag [tex]=\frac{2}{15}[/tex]

The probability of picking a cherry flavored candy from the bag [tex]=\frac{6}{15}[/tex]

The probability of picking an orange or a cherry flavored candy from the bag [tex]=\frac{2}{15}+\frac{6}{15}=\frac{8}{15}[/tex].

Therefore, the probability of picking an orange or a cherry flavored candy from the bag is [tex]\frac{8}{15}[/tex].

To learn more about the probability visit:

https://brainly.com/question/11034287.

#SPJ1

There are 20 black, 15 white, 12 green, 12 red, 9 blue and 2 yellow candies in a box. How many candies should you take (without looking at them) to be sure that you have at least 3 candies the same color?

Answers

Answer:  13

=============================================================

Explanation:

The best case scenario is that you get 3 of the same color in a row on the first three attempts. The lower bound is 3.

However, we have to consider the worst case scenario when we want to guarantee something like this, without looking at the candies we selected.

Consider the case of something like this sequence:

blackwhite greenredblueyellowblackwhitegreenredblueyellowblack

As you can see above, I've listed the colors in the order presented by your teacher. I pick one candy at a time. Once I reach yellow, I restart the cycle. In slots 1, 7 and 13, we have a black candy selected. This example shows that we must make 13 selections to guarantee that we get at least 3 candies of the same color (that color being black). The order of the candies selected doesn't matter. We could easily use any other color except yellow to do this example. The black candy just happened to be the first listed, so I went with that.

Note how we have 6 unique colors in the set {black, white, green, red, blue, yellow}. If we pick 2 candies of each color, then we've selected 6*2 = 12 candies so far. That 13th candy (some color other than yellow) is guaranteed to be a color we already selected; therefore, we'll be guaranteed to have 3 of the same color. We won't know what color it is but we will know we have a match like this.

For more information, check out the Pigeonhole Principle.

Peter uses 13.5 cups of flour tomake 6 batches of muffins. How many cups of flour did he use per batch?

Answers

Answer:

2.25

Step-by-step explanation:

13.5 divided by 6 = 2.25

PLEASE GIVE BRAINLIEST!!!

a locker contains 3 pairs of tennis shoes, 1 pair of jogging shoes, and 2 pairs of leather shoes. without looking , what's the probability of pulling out the pair of jogging shoes and then one pair of tennis shoes. (assume that you don't put the first pair of jogging shoes back in the locker.) write your answer as a fraction

Answers

Answer:

1/3 chance

Step-by-step explanation:

hoped this helped you!

if some one can bike 32 miles in 160 minutes how long will it take them to go 1 mile

Answers

5 minutes

32/160 = 0.2 mile/min

0.2x = 1

0.2x/0.2 = 1/0.5

x = 5

5 minutes

use order of operations

Answers

Answer:

97

Step-by-step explanation:

[tex] {4}^{2} + 3(37 - (2 \times 5)) \\ {4}^{2} + 3(37 - 10) \\ {4}^{2} + 3(27) \\ {4}^{2} + 81 \\ 16 + 81 \\ 97[/tex]

Hope this helps! Brainliest would be really appreciated!



can someone help please

Answers

Answer:

x=33°

Step-by-step explanation:

(x-1)+x=x+32 (ext angle of a triangle)

x-1+x=x+32

x+x-x=32+1

x=33

x = 33. Is the answer

For BRAINILY please help I need to pass this class

Answers

This is an isosceles triangle, which means that is has two congruent legs and two congruent base angles. Therefore, because IJ and IH are congruent, angles J and H are also congruent.

v = 54 degrees

Hope this helps!! :)

how do you subtract integers​

Answers

Answer:

1: First, keep the first number (known as the minuend) 2 .Second, change the operation from subtraction to addition

2. Third, get the opposite sign of the second number (known as the subtrahend)

4: finally, proceed with the regular addition of integers

Step-by-step explanation:

Example: 1: (6-(-4)

6+4=10

(10)

2: (-1-(-9)

-1+9=8

(8)

6+8/2 I need help on this

Answers

Answer:

10

Step-by-step explanation:

1. Any number has a denominator of 1 so you have 6/1 and 8/2.

2. To add you need to make the denominators the same so multiply the 2 to the numerator and denominator of 6/1 which makes 12/2.

3. 12/2+8/2 is 20/2.

4. Simplify 20/2 by dividing the top and bottom by 2 to get 10/1.

Answer: 10

Help me!
A 180
B 115
C 65

Answers

Answer:

ik this

Step-by-step explanation:

i believe its 180

Answer: B) 115

Step-by-step explanation: i hop this help if not sorry :(

Round to the nearest tenth

2.642 to the nearest tenth

29.10 to the nearest tenth

2,492 to the nearest tenth

3.44 to the nearest tenth

5,239 to the nearest tenth

89.43 to the nearest tenth

Round to the nearest hundredth

23.987 to the nearest hundredth

3,7096 to the nearest hundredth

4,449 to the nearest hundredth

44.043 to the nearest hundredth

999.474 to the nearest hundredth

7.44430 to the nearest hundredth

Answers

Answer:

1. 2.6

2. 29.1

3. 2490

4 3.4

Step-by-step explanation:

Find an equation for the perpendicular bisector of the line segment whose endpoints
are (8, 7) and (-4,3)

Answers

Answer:

y = -3x + 11.

Step-by-step explanation:

The slope of the given line segment  is (3-7)/(-4-8) = -4/-12 = 1/3.

The midpoint of the line has  coordinates (8-4)/2, (7+3)/2.

= (2, 5).

The slope of  the  perpendicular bisector = -1/ 1/3 = -3.

So it's bisector has equation:

y - y1  = m(x - x1)=

y - 5 = -3(x - 2)

y = -3x + 6 + 5

y = -3x + 11.

4.
Michael started a savings account. After 5 weeks, he had $340 dollars and after 9
weeks, he had $580. What is the rate of change of money in his savings account per
week?

Answers

Answer:

$60.00 in his savings account per week

Step-by-step explanation:

First, we can convert the information given into points so we can more easily find the rate of change, or slope:

(5, 340) and (9, 580)

Then, we can subtract the y-values and x-values of both, then divide those differences, to find the slope. Remember that the change in y goes on top of the division problem and the change in x goes on the bottom of the division problem:

(580-340)/(9-5) = 240/4 = 60

So, $60 in his savings account per week.

Answer:

he saves 18.45 dollars in each week

A jumping spider's movement is modeled by a parabola. The spider makes a single jump from the origin and reaches a maximum height of 10 mm halfway across a horizontal distance of 80 mm.

Part A: Write the equation of the parabola in standard form that models the spider's jump. Show your work. (4 points)

Part B: Identify the focus, directrix, and axis of symmetry of the parabola. (6 points)

Answers

The spider's movement is an illustration of a parabola.

The equation of a parabola is: [tex]\mathbf{y = -\frac{1}{160}(x - 40) + 10}[/tex]The focus of a parabola is: (40,-30)The axis of symmetry is: [tex]\mathbf{x = 40}[/tex]The directrix is:[tex]\mathbf{y = 50}[/tex]

(a) The equation

The spider passes through the origin.

So, we have:

[tex]\mathbf{(x,y) = (0,0)}[/tex]

The spider jumps to a maximum height of 10mm, midway 80mm.

So, the vertex is:

[tex]\mathbf{(h,k) = (40,10)}[/tex]

The equation of a parabola is:

[tex]\mathbf{y = a(x - h)^2 + k}[/tex]

So, we have:

[tex]\mathbf{0 = a(0 - 40)^2 + 10}[/tex]

Subtract 10 from both sides

[tex]\mathbf{a(0 - 40)^2 =- 10}[/tex]

[tex]\mathbf{1600a =- 10}[/tex]

Solve for a

[tex]\mathbf{a =- \frac{1}{160}}[/tex]

Substitute [tex]\mathbf{a =- \frac{1}{160}}[/tex] and [tex]\mathbf{(h,k) = (40,10)}[/tex] in [tex]\mathbf{(h,k) = (40,10)}[/tex]

[tex]\mathbf{y = -\frac{1}{160}(x - 40) + 10}[/tex]

(b) The focus, directrix and the axis of symmetry

The focus of a parabola is:

[tex]\mathbf{Focus= (h, k + p)}[/tex]

Where:

[tex]\mathbf{p = \frac{1}{4a}}[/tex]

So, we have:

[tex]\mathbf{p = \frac{1}{4 \times -1/160}}[/tex]

[tex]\mathbf{p = -\frac{160}{4}}[/tex]

[tex]\mathbf{p = -40}[/tex]

So, we have:

[tex]\mathbf{Focus = (40,10-40)}[/tex]

[tex]\mathbf{Focus = (40,-30)}[/tex]

The axis of symmetry is:

[tex]\mathbf{x = h}[/tex]

So, we have:

[tex]\mathbf{x = 40}[/tex]

The directrix is:

[tex]\mathbf{y = k - p}[/tex]

[tex]\mathbf{y = 10 + 40}[/tex]

[tex]\mathbf{y = 50}[/tex]

Read more about parabolas at:

https://brainly.com/question/25237745

Solve the inequality. Graph the solution

Answers

Answer:

1.  y > -3/5 and y < 7/5        Direction to  graph 1 below.

2. r > 1 and r < 13/3              Direction to  graph 2 below

Step-by-step explanation:

|5y - 2| + 5 > 0

Case 1    Positive ||                                 Case 2  Negative ||

5y - 2 + 5 > 0                                       -(5y - 2) + 5 > 0

5y +3 > 0                                             -5y + 2 +5 > 0

5y > -3                                                  -5y + 7 > 0

y .> -3/5                                               -5y > -7

                                                             -y > -7/5

                                                             y < 7/5   y value negative, change sign

The graph 1: open circle at -3/5;  close circle at 7/5; shade between these two numbers.  

2.    |8-3r|< 5

       Case I                                           Case II

8 - 3r < 5                                                   -(8-3r) < 5

-3r < 5 - 8                                                   -8 + 3r < 5

-3r < -3                                                         3r < 5 + 8  

-r < -3/3                                                        3r <  13

r >1       r is negative, change                        r < 13/3

            the direction of the sign

Graph 2: Open circle at 1; open circle at 13/3;  shade between the two numbers.                    

   

Jada had some dimes and quarters that had a total value of $12.50

Answers

Answer:

1.She has 115 dimes because 0.10*115=11.5 0.25*4=1.00 11.5+1.00=12.5

2.She has 100 dimes because 0.10*100=10.00 and 0.25*10= 2.5 10+2.5=12.5

3.I think they don’t function because quarters are worth more than a dime.

4.he has 40 quarters because 0.25*40=10.00 0.10*25=2.5 10.00+2.5=12.5.

5.She has 38quarters because 0.25*38=9.5 0.10*30=3 9.5+3=12.5

6.Yes they can function because q=dx-12.5

The Questions:

Question 1 - 1 pts

If Jada has 4 quarters, how many dimes does she have?

Question 2 - 1 pts

If Jada has 10 quarters, how many dimes does she have?

Question 3 - 1 pts

Is the number of dimes a function of the number of quarters? If yes, write a rule (that starts with d =...) that you can use to determine the output, d, from a given input, q. If no, explain why not.

Question 4 - 1 pts

If Jada has 25 dimes, how many quarters does she have?

Question 5 - 1 pts

If Jada has 30 dimes, how many quarters does she have?

Question 6 - 1 pts

Is the number of quarters a function of the number of dimes? If yes, write a rule (that starts with q =...) that you can use to determine the output, q, from a given input, d. If no, explain why not.

The following table shows how many pizzas Dave’s pizzeria has sold each hour.

Write the slope intercept equation, and find the constant rate of change and the vertical intercept of the line. Explain how they are related to this situation.

Answers

Answer:

x=3.3333333333333333333333333333333

A water bucket in your backyard has a small hole in it. You notice that it drained a total of 3.5 liters

in 4 days. What is the average change in water volume each day? (hint: divide)

Answers

In each day the average change in the water volume is 0.875 liters

PLS HELP! GIVING BRAINLIEST!
Given g(x)=2x+4, find: g(4)

PLS SHOW WORK !!

Answers

Answer:

b(x)=2x+4

Factor out 2.

2(x+2)

EVALUATE

2(x+2)

Step-by-step explanation:

PLS HELP WILL MARK BRAINLIEST, NO FAKE ANSWERS

Answers

Answer:

1. 4a+5b

2. 6p+4r

3.  -20y-3x

Answer:

1.   4a + 5b;   2.  6p + 4r;    3.  -22y - 3x

Step-by-step explanation:

1. (4a + 5b) + (2a - 6b) - 2(a - 3b)

  (4a + 5b) + (2a - 6b)  + (- 2a + 6b)         Distributive

 (4a + 2a -2a) + (5b - 6b + 6b)                 Combine like terms

  4a + 5b

 2.  2(5p - q + 2r) - (p + 4q + 3r) - 3(p -2q - r)  

       10p - 2q + 4r - p - 4q - 3r - 3p + 6q + 3r

       (10p - p -3p) + (-2q - 4q + 6q ) + ( 4r - 3r + 3r)

         6p + 0 + 4r

          6p + 4r

3.    - (9y + x) + 2(x - 6y) - (4x + y)

         -9y - x  + 2x - 12y - 4x - y

        (-9y -12y -y) + (-x + 2x - 4x)

           -22y - 3x

     

, Nicole played basketball and went swimming before dinner. She spent 1 hour and 30 minutes playing basketball and 1 hour and 17 minutes swimming. Dinner lasted for 53 minutes. If dinner ended at 6:14 P.M., what time did Nicole start playing basketball?

Answers

Answer2:34 P.M

Step-by-step explanation:

Answer:

2: 34pm

Step-by-step explanation:

6.14 - 53= 5.21pm

5.21 - 1.17= 4.04pm

4.04 - 1.30= 2.34pm

WILL GIVE BRAINLIEST 100 POINTS

BRAINLIEST TO BEST EXPLANATION OF WHAT YOU DO TO FIND SCALE FACTOR AND CENTER :D

ANSWER ALL QUESTIONS FOR BRAINLIEST

Answers

Answer:

to find the scale factor for a dilation, we would find the center point of dilation and measure the distance from this center point to a point on the shape from before (preimage) and also the distance from the center point to a point on the shape.

calculate the time taken for a train to travel 1000m if its initial is 3 m/s and it is moving at a constant acceleration of 0.1m/s^2

Answers

Answer:

Step-by-step explanation:

For obects already in motion, the distance travelled, s, is:

s = vi*t + (1/2)at^2

where vi is the initial velocity, a is the acceleration, and t is the time in seconds.

We want the time, t, to reach 1000 meters.

1000 m = (3 m/s)*t + (1/2)*(0.1m/s^2)*(t^2)

(1/2)*(0.1m/s^2)*(t^2) = 0.05t^2

0.05t^2 + 3t -1000 = 0

Solve quadratic equation:

t = 114.6 seconds

Un paralelogramo con una base de 13cm y una altura de 8cm, su área es de

Answers

El área del paralelogramo con base de 13 centímetros y altura de 8 centímetros es 104 centímetros cuadrados.

El área del paralelogramo, en centímetros cuadrados, es igual al producto de su base por su altura, ambos en centímetros. En consecuencia, el área de la figura geométrica es la siguiente:

[tex]A = (13\,cm)\cdot (8\,cm)[/tex]

[tex]A = 104\,cm^{2}[/tex]

El área del paralelogramo con base de 13 centímetros y altura de 8 centímetros es 104 centímetros cuadrados.

Invitamos cordialmente a ver esta pregunta sobre paralelogramos: https://brainly.com/question/17205536


Peter, Jamal and Khan were on their way to a resort. Peter drove of the journey at a
constant speed of 64 km/h. Jamal took over and drove 5 of the journey for 20 min at
a constant speed of 60 km/h. Khan then took over and drove the remaining journey.
(a) How far did Jamal drive?
(b) How many minutes did Peter drive?

Answers

Answer:

that's what can I give

Step-by-step explanation:

hope it helps

Diego can type 140 words in 4 minutes.

At this rate, how long will it take him to type 385 words?
How many words can he type in 15 minutes?


If you get stuck, consider creating a table.

Answers

I hope you find this useful, Mark as Brainliest please, it's very much appreciated.

Explanation:

In one minute, Diego can type 35 words;140÷4

At this rate, it will take him 11 minutes to type 385 words;385÷35

Therefore, he can type 525 words in 15 minutes; 35×15

Answer:

Hope this helps.

Step-by-step explanation:

1. 385 x 4 = 1540/140

    =11

2. 15/4 = 3.74 x 140

    =525

Pls Help me!A,B,C OR D​

Answers

Answer:

D. y = - 2/3x - 3

Step-by-step explanation:

The slope is - 2/3 and the point on the line is (-3, -1).

Find the y-intercept:

-1 = (-3)(-2/3) + bb = -1 - 2b = -3

The line is:

y = - 2/3x - 3

Correct choice is D

Equation in point slope form

y+1=-2/3(x+3)y+1=-2/3x-2y=-2/3x-3

Option D

Based on what you've read, answer the following questions.
1. Laura bought a rectangular rug for her living room. It measures 9 feet long and 8 feet wide. What is the area of her rug?
2. One can of paint will cover an area of 400 square feet. Will one can of paint be enough to cover an exterior brick wall that is 48 feet long and 9 feet high?
3. Roger owns a one-acre piece of land. The length of the land is 484 feet. What is the width of his property? (Hint: One acre = 43,560 square feet)
4. The Animal World Safari Park is a rectangular piece of land with an area of 323 square miles. The length of the park is 17 miles. What is its width?
5. Penny is making a square tablecloth that has an area of 49 square feet. What is the length of one of its sides?

Answers

Answer:

1. The area is 72 ft².

2. No, one can of paint will not be enough.

3. The width of his property is 90 ft.

4. The width of the park is 19 miles.

5. The length of a side is 7.

Step-by-step explanation:

We will use the formula Area = length x width to answer the questions.

1. 9 x 8 = 72

2. 48 x 9 = 432, 432 > 400

3. 43560/484 = 90

4. 323/17 = 19

5. √49 = 7

Hope this helps!

Answer:

1. The area is 72 ft².

2. No, one can of paint will not be enough.

3. The width of his property is 90 ft.

4. The width of the park is 19 miles.

5. The length of a side is 7.

Step-by-step explanation:

Other Questions
classify each of these reactions pb(no3)2+nicl2=pbcl2+ni(no3)2 g(x) = 3x-1f(x) = x + 5.find g (f (4) What one accomplishment do you consider to be the greatest of the ancient Mesopotamian civilizations? help plz 20 points What is the equation of the line that passes through the point (-6, -7) and has a slope of 0 what dreams do you have?please write 44 words (Someone help asap! I searched this question but some people are saying true and others are saying its false so im not sure what to do cause the test im doing is a huge part of my grade.)Is this statement true or false?One of the reasons for the lack of Indian unity in fighting Europeans was, that the Indians were descended from different peoples who came in different waves of immigration.truefalse tortoise A walks 32 feet per hour and Tortoise B walks 8 inches per minute. who travels faster A family wants to be able to give their child $5,000 per year for 4 years of college. The child will leave for college in 8 years, at which point the family will stop contributing to the college fund. How much money should be set aside each year on the child's birthday in order to follow through with this plan Part A and Part C the same? Why or why not? Find the elapsed time of 8:45AM to 1:10 PM Similar to el Zcalo, what public spaces in the United States play host to major celebrations and protests? And in other parts of the world? 1. Rice, beans tortillas, and plantains are common foods in Central American countries. Where does the comma belong in this sentence? hello and good morning, todays question is..name the most popular thing today. vs the most popular item in the 90s a serious neck injury may leave a person paralyzed from the neck down. explain why. $200 is divided in the ratio 6: 4, What is the smaller part? What is the molecule in this image?Nucleic acid A protein A lipidA carbohydrate Given the following functions, find the indicated values,f(x)= 1 - 5x(a) f(-4) (b) f(0) (C) f(5)(a) f( 4)=0 Is coup detat means overthrow? Look again at "Lincoln the Great." Which detail best supports the inference that not all of the research on Lincoln is accurate?Lincoln the Greatby Wilfred W. McClay (adapted excerpt)The American Civil War and the enigmatic' man whose election in 1860 precipitated it hold an inexhaustibleinterest for us. Thousands of volumes on both subjects have streamed out of publishing houses in the past centuryand a half, covering every conceivable topic and vantage point, from arcana of military operations to probing, andoccasionally preposterous, efforts to explore Lincoln's psyche. Nor does this flow seem to be diminishing. We areabout to launch into a grand national celebration of the bicentennial of Lincoln's birth that may eclipse all suchprevious commemorations.For a country said to be uninterested in its past, this would seem to be a giant exception to the rule. There arefew if any decisive new facts remaining to be unearthed. There continue to be bands of Lincoln assassinationenthusiasts who find it irresistible to speculate about what did or did not happen those fateful days in the spring of1865. But they don't explain the passionate interest in the man.The lure of the Civil War is that it taps into something far deeper, a vein of powerful meanings and buriedfeelings that run beneath the surface of everyday American life. There is a feeling of instinctive4 reverence that Which models represent 56 as a sum of fractions with a common denominator of 6?