pls help me . !!!!!!!

Pls Help Me . !!!!!!!

Answers

Answer 1

The exponents a and b in the simplified expression are:

a = 1

b = 7

How to simplify the expression?

Remember the rules for exponents:

[tex]a^x*a^y = a^{x + y}\\\\a^x/a^y = a^{x - y}\\\\(a^x)^y = a^{x*y}[/tex]

Now we need to use these rules to simplify our expression:

[tex]\frac{x^2(y^3)^4}{x*y^5}[/tex]

We can rewrite that as:

[tex]\frac{x^2(y^3)^4}{x*y^5} = \frac{x^2}{x} *\frac{(y^3)^4}{y^5} = x^{2 - 1}\frac{y^{3*4}}{y^5} \\\\= x*y^{12 - 5} = x*y^7[/tex]

Then the values of a and b are:

a = 1

b = 7

Learn more about exponents at:

https://brainly.com/question/847241

#SPJ1


Related Questions

you operate a tour service that offers the following rates: $600 per person if 30 people (the minimum number to book the tour) go on the tour. for each additional person, up to a maximum of 130 people total, the rate per person is reduced by $3. it costs $7380 (a fixed cost) plus $390 per person to conduct the tour. how many people does it take to maximize your profit?

Answers

67 people can maximize the profit.

Let's aasume that x represent the number of people.

so, the number of people on the tour = x + 50

The cost function would be:

C = 6000 + 32x

and the revenue:

R = (200 - 2x)(50 + x)

R = 10000 - 100x + 200x - 2x^2

R = 10000 + 100x - 2x²

So, the profit would be:

P = R - C

P = 10000 + 100x - 2x² - 6000 - 32x

P = 4000 + 68x - 2x²

Now we take the derivative of profit function:

P' = 68 - 4x

Consider P'(x) = 0

68 - 4x = 0

4x = 68

x = 17

So, the number of people on tour: 50+17 = 67

This means that 67 people can maximize the profit.

and the profit would be:

P = 4000 + (68 × 17) - (2 × 17²)

P = $4578

Learn more about the profit here:

https://brainly.com/question/28856941

#SPJ4

Is the following equation true or false?

3.6 + (4.2 x 2.4) ÷ 2 = 8 x 2 – 7.46

True
OR
False

Answers

Answer:

False

Step-by-step explanation:

I need somebodys help quickly please!
(look at the attachment it shows the math equation).​

Answers

Answer: x = -2

Step-by-step explanation: -2 is the answer because -2 to the 3rd power is -8. Hence, 8 * -8 = -64 as the solution.

Someone help plss/a. Consider the cube shown below. Identify the two-dimensional shape of the cross-section if the
cube is sliced horizontally.
b. Starting with the same cube, identify the two-dimensional shape of the cross-section if the cube is
sliced vertically.
c. Explain why the shapes are the same or different.

Answers

a.the two-dimensional shape of the cross-section will be a square.

b. the two-dimensional shape of the cross-section will also be a square.

c .The shapes are the same because regardless of the orientation of the cut, the cross-section will always be a square since all sides of a cube are equal.

Define  two-dimensional shape

A two-dimensional shape is a geometric figure that has only two dimensions, namely length and width, but no thickness or depth. Examples of two-dimensional shapes include circles, squares, triangles, rectangles, and polygons. These shapes are typically represented on a flat surface such as a piece of paper or a computer screen.

a. If the cube is sliced horizontally, the two-dimensional shape of the cross-section will be a square.

b. If the cube is sliced vertically, the two-dimensional shape of the cross-section will also be a square.

c. The shapes are the same because regardless of the orientation of the cut, the cross-section will always be a square since all sides of a cube are equal. The orientation of the cut only affects which faces of the cube are visible in the cross-section, but the shape itself remains the same.

To know more about triangle, visit:

https://brainly.com/question/2773823

#SPJ1

3x-10/3x+1+4x+28/3x^2+10x+3= x+1/x+3 I can't get the right answer of the rational equation. I don't really get it yet so I need help to understand this better

Answers



3x-10/3x+1+4x+28/3x^2+10x+3= x+1/x+3

Collecting like terms and then simplifying:

7x+28/3x^2+13x-10/3x+1= x+1/x+3

Multiplying both sides by 3x+3 to eliminate fractions:

(7x+28)(3x+3)+13x-10(3x+3)= (x+1)(3x+3)

21x^2+84x+84+39x-30= 3x^2+4x+3

Combining like terms on both sides:

21x^2+123x-27= 3x^2+4x+3

18x^2+123x-30= 0

Subtracting 18x^2 from both sides:

123x-30= 0

Dividing both sides by 123:

x-30/123= 0

x= 30/123

The graph shown can be used to
convert between gallons and litres.
a) Convert 11 gallons to litres.
50
litres
=
b) Convert 40 litres to gallons.
8.8
gallons
A tank has a volume of 120000 cm³.
1 litre 1000 cm
c) What is the capacity of this tank
in gallons?
I gallons
Litres
80
70
60
50
40
30
20
10
0
2
4
6
8 10 12 14 16
Gallons

Answers

The volume of 11 gallons is 50 litres.

The volume of 40 litres is 8.8 litres.

The capacity of the tank in gallons is 26.7 gallons

How to solve proportional graph?

The graph of a proportional relationship is always a straight line through the origin.

Therefore, the graph is a relationship between the variables volumes in litres and gallons. The litres is on the y axis while the gallons is on the x axis.

Hence, let's use the graph to convert the volumes.

11 gallons = 50 litres

40 litres = 8.8 litres

A tank has a volume of 120, 000 cm cube.

1 litre  = 1000 cm³

The capacity of the tank in gallons can be found as follows:

1000 cm³ = 1 litres

120,000 cm³= ?

volume in litres = 120,000 / 1000

volume in litres = 120 litres

From the graph,

36 litres = 8 gallons

120 litres = ?

cross multiply

volume in gallons = 120 × 8  / 36

volume in gallons = 960 / 36

volume in gallons = 26.6666666667

Therefore, the capacity of the tank in gallons is 26.7 gallons

learn more on proportional graph here: https://brainly.com/question/30139035

#SPJ1

Answer:

  a) 50 L

  b) 8.8 gal

  c) 26.4 gal

Step-by-step explanation:

Given a graph showing the relationship between (imperial) gallons and litres, you want equivalents for 11 gallons, 50 litres, and 120000 cm³.

a) 11 gallons

You have correctly read the graph, which tells you 11 gallons is about 50 litres.

b) 40 litres

You have correctly read the graph, which tells you 40 litres is about 8.8 gallons.

c) 120,000 cm³

You are told that 1000 cm³ is 1 litre, so 120,000 cm³ will be 120 litres.

You notice this is 3 times the volume of the previous question:

  120 L = 3×(40 L) = 3×(8.8 gal) = 26.4 gal

120000 cm³ is about 26.4 gallons.

__

Additional comment

A more precise conversion of 120000 cm³ is 26.3963097959... gallons. The decimal has a very long repeat.

Once sales tax is included, a $470 rug ends up costing $517. What is the sales tax percentage?

Answers

Answer:

10%

Step-by-step explanation:

(517-470)/470x100

=10%

Find the difference after tax and divide by the original price and times 100%

you have three empty boxes and eight balls. how many ways can you distribute the balls among the three boxes so that each box contains at least one ball?

Answers

The number of possible ways you can distribute the balls among the three boxes so that each box contains at least one ball = 21

Here we have 3 empty boxes.

Let us assume that a, b and c be these empty boxes.

and the total number of balls = 8

We need to distribute the balls among the three boxes so that each box contains at least one ball.

This means that a + b + c = 8

By allotting 1 ball to each box so that no box remains empty.

We get an equation a + b + c = 5

So, the possible number of ways to by allotting 1 ball to each box so that no box remains empty would be:

⁷C₂

Using combination formula:

⁷C₂

= 7! / 2!(7 - 2)!

= 21

Therefore,  the required number of ways = 21

Learn more about the combination here:

https://brainly.com/question/28720645

#SPJ4

Need help with these please test is tommorw

Answers

Answer:

3.75 and B

Step-by-step explanation:

for the first one if the actual is 48 feet, and the image is 12.8, divide both by the image(12.8). The value you have for the image should then become one centimeter, therefore the value you have for the parking lot is the amount of feet/1cm. For the second image, its the same idea. In this case you want to know how tall the scale is, so divide by the amount of meters(just as 6/2=3 and 6/3=2 the real value/scale value=representation of 1 unit and real value/representation of 1 unit = scale value). You get 12.5, however that is per 1 unit, so multiply by five since(the value you get by simply dividing is the answer IF 30 meters were represented in the scale by 1centimeter, but its represented by 5 so you multiply by five)You get 63.5

A coach collects the height and weight of 10 players on
the basketball team as shown in the table.
Height
(Inches)
76
70
68
69
69
65
66
67
74
Weight
(Pounds)
200
185
170
175
200
160
160
175
205
215
The equation of the least-squares regression line is
9-146.7+4.76x, where is the weight and x is the
height. Which show the residual plot?
Residual
20
15
10
6
0
-5
-15
-20
64
66
68 70 72 74 76 78
Height (Inches)

Answers

The graph that shows the residual plot for the height and weight of the 10 players is B. Graph B.

How to find the residual plot ?

To find the residual plot, you need to use the data on height and weight of 10 players shown on the table, and compare it to figures you get from the formula given of y = -146.7 + 4.76 x.

Doing this, we find two residuals being:

x = 68

Predicted y = -146.7 + 4.76(68) = 175.88

Actual y = 170

Residual = Actual y - Predicted y = 170 - 175.88 = -5.88

x = 70

Predicted y = -146.7 + 4.76(70) = 185.3

Actual y = 185

Residual = Actual y - Predicted y = 185 - 185.3 = -0.3

These points of (68, - 5.88) and ( 70, - 0.3) tally with Graph B so this is the residual plot.

Find out more on residual plots at https://brainly.com/question/27733055

#SPJ1

divide the length of the hypotenuse of triangle ABC by the length of one of its sides divide the length of the hypotenuse of triangle ACD by the length of one of its sides make a conjecture that explains the results

Answers

Therefore , the solution of the given problem of triangle comes out to be    h/s = h/√(h² - s²)..

A triangle is exactly what?

If a polygon has at least one additional segment, it is a hexagon. Its form is a straightforward rectangle. Something like this can only be distinguished from a regular triangular by edges A and B. Euclidean geometry only creates a portion of the cube, despite the precise collinearity of the borders. A triangular has three sides and three angles.

Here,

Triangle ABC and triangle ACD are both right triangles with a common hypotenuse, as shown by the given diagram.

Let's write the lengths of the sides AB or AD as s and the hypotenuse AC as h. (since both triangles have a common side with length s).

The Pythagorean formula can now be used to determine the length of each triangle's third side:

Triangle ABC's third side's length (BC) can be calculated using this formula:

=> BC = √(h² - s²).

The third side's (CD) length in the triangle ACD is also determined by:

=> CD = √(h² - s²).

By dividing each triangle's hypotenuse's (h) length by one of its sides' (s) lengths, the following result is obtained:

In the triangular ABC,

=> h/s = h/ √(h² - s²).

In the triangular ACD

=>  h/s = h/√(h² - s²).

To know more about triangle visit:

https://brainly.com/question/2773823

#SPJ1

A χ2 statistic provides strong evidence in favor of the alternative hypothesis if its value is
A. a large negative number.
B. close to 1.
C. exactly 1.96
D. close to 0.
E. a large positive number.

Answers

Is this selection (A) the best one? a high positive number. The result of multiplying a negative number by a positive number is always negative.

The result of multiplying two numbers, whether they are positive or negative, is always positive. 3 plus 4 equals 12. The result is minus 12 since there is only one optimistic and one negative number.

Why does adding two negative numbers together results in a positive number?

Repeated subtraction equals multiplication by a negative. Negative numbers were reduced in negative value after they have been multiplied together. Students may easily relate both ideas thanks towards this comparison among both multiplication and addition.

To know more about multiplying click here

brainly.com/question/25114566

#SPJ4

Find the slope of the graph.
Please help! :)​

Answers

y = 3x + 4

As it travels over 1 unit, it goes up 3, so the slope is 3. The y intercept occurs when y = 4, giving us:

y = 3x + 4

Question content area top
Part 1
Point B has coordinates ​(3,​1). The​ x-coordinate of point A is -3. The distance between point A and point B is units. What are the possible coordinates of point​ A?

Answers

We have two possible values for y, we have two possible Coordinates for point A: (-3, 1 + √((units)² - (3 - (-3))²)) and (-3, 1 - √((units)² - (3 - (-3))²)).

Here are the terms and steps we'll use in the solution:

1. Point B coordinates: (3, 1)
2. Point A x-coordinate: -3
3. Distance formula: √((x2 - x1)² + (y2 - y1)²)

Let's find the possible coordinates of point A:

Step 1: We know the x-coordinate of point A is -3, so its coordinates will be in the form (-3, y).

Step 2: Apply the distance formula to find the distance between point A (-3, y) and point B (3, 1):

Distance = √((3 - (-3))² + (1 - y)²)

Step 3: Square the distance equation to eliminate the square root:

Distance² = (3 - (-3))² + (1 - y)²

Step 4: Plug in the given distance value and solve for y:

(units)² = (3 - (-3))² + (1 - y)²

Step 5: Solve for (1 - y)²:

(1 - y)² = (units)² - (3 - (-3))²

Step 6: Take the square root of both sides:

1 - y = ±√((units)² - (3 - (-3))²)

Step 7: Solve for y:

y = 1 ±√((units)² - (3 - (-3))²)

Since we have two possible values for y, we have two possible coordinates for point A: (-3, 1 + √((units)² - (3 - (-3))²)) and (-3, 1 - √((units)² - (3 - (-3))²)).

To LEarn More About Coordinates

https://brainly.com/question/29660530

SPJ11

dfghjklkjytrewqaASDCV

Answers

Answer:

]]] explanation:

Solve: 4u−7/−7= u−4/4

Answers

Answer:

[tex]2 \frac{10}{23} [/tex]

Step-by-step explanation:

[tex] \frac{4u - 7}{ - 7} = \frac{u - 4}{4} [/tex]

Use the property of the proportion:

4 × (4u-7) = -7 × (u-4)

16u -28 = -7u + 28

16u + 7u = 28 + 28

23u = 56 / : 23

u =

[tex] 2\frac{10}{23} [/tex]

an a-frame tent is in the shape of an isosceles triangle. the base of the triangle is 7 ft and the two congruent sides are each 6 ft. what is the height of the tent

Answers

The height of the tent is approximately 4.87 feet.

To find the height of the tent, we need to first determine the length of the altitude (perpendicular line) drawn from the apex (top point) of the triangle to the base. Let's call this length "h".

We can use the Pythagorean theorem to find "h". Let's draw a line from the apex of the triangle to the midpoint of the base, which will split the isosceles triangle into two congruent right triangles. Then we have

h^2 + (7/2)^2 = 6^2

h^2 + 49/4 = 36

h^2 = 36 - 49/4

h^2 = 95/4

h = sqrt(95)/2

h ≈ 4.87 ft

Learn more about isosceles triangle here

brainly.com/question/30192667

#SPJ4

Option t Suppose you have $150.00 with which to start a business. You have Exactly the skills and
training you have right now. What business will you start? How will you spend the money? What will you do
to make sure your business works? How would you advertise?

Answers

You can successfully begin a business that serves the requirements of expression your community by leveraging your existing skills and networks and investing in targeted marketing methods.

what is expression ?

An expression in mathematics is a collection of representations, digits, and conglomerates that mimic a statistical correlation or regularity. A real number, a mutable, or a combination of the two can be used as an expression. Mathematical operators include addition, subtraction, rapid spread, division, and exponentiation. Expressions are often used in arithmetic, mathematics, and form. They are employed in the representation of mathematical formulas, the solving of equations, and the simplification of mathematical relationships.

Offering a service that leverages your existing talents and training is one suggestion for beginning a business with $150.00. For example, if you are a graphic designer, you may offer logo creation or other graphic design services to local small businesses or people. Instead, if you have experience with social media marketing, you might offer to handle small businesses' social media accounts.

Ultimately, launching a firm on a tight budget necessitates ingenuity and resourcefulness. You can successfully begin a business that serves the requirements of your community by leveraging your existing skills and networks and investing in targeted marketing methods.

To know more about expression visit :-

https://brainly.com/question/14083225

#SPJ1

Please help me with these maths problems on return of investments PLEASE

Answers

The answer of the given question based on Return on Investment is (a) 19.64% , (b) $51,575 , (c)  -28.30% , (d)  $42,000.

What is Investment?

Investment is the act of allocating resources, like money, time, or effort, with the expectation of generating a return or profit in the future. Investment can take many forms, including purchasing stocks, bonds, mutual funds, real estate, or other financial assets.

The main goal of investment is to grow wealth over time by generating returns that exceed the rate of inflation. There are several types of investment strategies, such as value investing, growth investing, income investing, and diversification, that investors can use to achieve their financial goals.

a. ROI = (final value - initial value)/initial value * 100%

ROI = (67000 - 56000)/56000 * 100% = 19.64%

b. ROI = (final value - initial value)/initial value * 100%

$24,756 = 48% * initial value

initial value = $24,756 / 0.48 = $51,575

c. ROI = (final value - initial value)/initial value * 100%

ROI = ($62.56 - $87.24)/$87.24 * 100% = -28.30%

The negative ROI indicates a loss in investment.

d. The lowest price is $25 and the highest price is $67, so the total return on investment is:

Total Return = 1000 shares * ($67 - $25) = $42,000.

To know more about Profit visit:

https://brainly.com/question/30091032

#SPJ1

rita numbered the circles of the figure from 1 to 8, so that the sum of the three numbers on each of the four sides of the square equals 13. what is the sum of the four numbers written on the colored circles?

Answers

Rita numbered the circles of the figure from 1 to 8, so that the sum of the three numbers on each of the four sides of the square equals 13. The sum of the four numbers written on the colored circles is 10.

What is the figure?

The figure is as shown below:

Now, let's check how the numbers are arranged:The sum of the numbers 1, 6, and 6 is 13, and they are written on the same side of the square as the circle labeled with 1.

Similarly, the numbers 2, 5, and 6 are on the same side of the square as the circle labeled with 2, and the numbers 2, 6, and 5 are on the same side of the square as the circle labeled with 3.

Now, the remaining number that has not been used in any of the sides of the square is 4.

Therefore, it should be placed at the center of the square, as shown below:

The numbers on the colored circles are: 1, 2, 3, and 4. Thus, their sum is:

1 + 2 + 3 + 4 = 10

for such more question on colored circles

https://brainly.com/question/2121322

#SPJ11

angle is constructed with its base on the x-axis and its upper two vertices on the parabola . what are the dimensions of the rectangle with the maximum area? what is the area?'

Answers

The double integral of sin(xy) over the rectangle r equals 1 when a is approximately equal to 0.986, with 0 ≤ a ≤ π.

The iterated integral to compute the double integral over the rectangle r = {(x,y) : 0 ≤ x ≤ π, 0 ≤ y ≤ a} of sin(xy) is given by:

∫∫r sin(xy) dA = ∫₀^a ∫₀^π sin(xy) dx dy

Integrating with respect to x first, we have:

∫₀^a ∫₀^π sin(xy) dx dy = ∫₀^a [-cos(πy) + cos(0)] dy

= ∫₀^a (1 - (-1)^n) dy

= a - (a/π)sin(πa)

For what values of a is ∫∫r sin(xy) dA equal to 1?

We need to solve the equation:

a - (a/π)sin(πa) = 1

Multiplying both sides by π, we get:

aπ - a sin(πa) = π

Now, let f(a) = aπ - a sin(πa) - π. We need to find the values of a such that f(a) = 0.

Using numerical methods, we can find that there is only one solution in the interval [0,π], which is approximately a = 0.986.

Therefore, the double integral of sin(xy) over the rectangle r equals 1 when a is approximately equal to 0.986, with 0 ≤ a ≤ π.

Click the below link, to learn more about Double integral:

https://brainly.com/question/30217024

#SPJ11

A package contains 20 golf balls. The total
weight of the golf balls is 32 ounces. Use the
model to show the number of ounces per
golf ball and the number of golf balls per
Ounce.

Answers

In Linear equation, 5/8 golf balls per ounce are the number of golf balls per Ounce.

What in mathematics is a linear equation?

An algebraic equation with simply a constant and a first-order (linear) term, such as y=mx+b, where m is the slope and b is the y-intercept, is known as a linear equation.

                          Sometimes, the aforementioned is referred to as a "linear equation of two variables," where x and y are the variables. Equations with power 1 variables are known as linear equations. One example with only one variable is where ax+b = 0, where a and b are real values and x is the variable.

Number of golf balls (n) = 20

Total weight (w) = 32 ounces

total weight = number of balls (n) * weight of 1 golf ball

∴ weight of 1 golf ball = w/n =32/20 ounces

⇒ the weight distribution is 1.6 ounce per golf ball

Now, apply unitary method :

32 ounces is total weight of 20 golf balls

∴ 1 ounce amounts to 20/32 golf balls

⇒ there are 5/8 golf balls per ounce

Learn more about Linear equation

brainly.com/question/11897796

#SPJ1

I NEED HELP ON THIS FAST!

Answers

The two sides of the triangle are equal the triangle is an isosceles triangle.

What is an isosceles triangle?

Triangles with two equal sides are known as isosceles triangles. Triangles are three-sided polygons that can be categorised as equilateral, isosceles, or scalene depending on how long their sides are.

The uneven side of this triangle is referred to as the base since the other two sides are equal in it. The triangle's two equal sides are always opposing equal angles. An isosceles triangle's height is calculated from its base to its vertex (topmost point). The third angle of a right isosceles triangle is 90 degrees.

The coordinates of the triangle are J(-2, 4), K(8, 4) and L (6, -2).

Using the distance formula we have:

The distance between J and K: √((8 - (-2))² + (4 - 4)²) = 10

The distance between K and L: √((6 - 8)² + (-2 - 4)²) = 6.324

The distance between L and J: √((-2 - 6)² + (4 - (-2))²) = 10

Since two sides of the triangle are equal the triangle is an isosceles triangle.

Learn more about isosceles triangle here:

https://brainly.com/question/2456591

#SPJ1

how do i do this? geometry is the death of me

Answers

Answer:

Step-by-step explanation:

17/x = 30/84  1. Set up the proportion

30x = 1428     2. Cross multiply and solve for x

x=47.6            3. There's the solution

What are two possible expressions equal to the product of 2 and 1 3/6

Answers

The product of 2 and 1 3/6 can be expressed as either 18/6 or 3

The product of 2 and 1 3/6 can be found by multiplying 2 by the mixed number 1 3/6. To do this, we need to convert the mixed number to an improper fraction, then multiply it by 2. Here are two possible expressions that are equal to the product of 2 and 1 3/6

Improper fractions

2 x 1 3/6 = 2 x (1 + 3/6) = 2 x (6/6 + 3/6) = 2 x 9/6 = 18/6

Therefore, the product of 2 and 1 3/6 is equal to 18/6.

Decimals

We can also convert the mixed number 1 3/6 to a decimal and then multiply it by 2. To convert the mixed number to a decimal, we divide the numerator (3) by the denominator (6), which gives us 0.5. Then we add the whole number (1) to get 1.5.

2 x 1.5 = 3

Therefore, the product of 2 and 1 3/6 is equal to 3.

Learn more about product here

brainly.com/question/22339195

#SPJ4

Write the equation of the graph shown below in factored form.

A. f(x) = (x − 2)2(x + 1)(x − 4)
B. f(x) = (x + 2)2(x − 1)(x + 4)
C. f(x) = (x + 2)2(x + 1)(x + 4)
D. f(x) = (x − 2)2(x − 1)(x − 4)

Answers

Answer:

C

Step-by-step explanation:

given x = a is a solution of f(x) then (x - a) is a factor

here the solutions, where the graph crosses the x- axis, are

x = - 4 , x = - 2 , x = - 1 , then the corresponding factors are

(x - (- 4)) , (x - (- 2)) , (x - (- 1)) , that is

(x + 4) , (x + 2) , (x + 1)

f(x) is then the product of these factors, that is

f(x) = (x + 2)(x + 1)(x + 4) ← in factored form

if the absolute value of your calculated t-statistic exceeds the critical value from the standard normal distribution, you can: conclude that most of the actual values are very close to the regression line. reject the assumption that the error terms are homoskedastic. reject the null hypothesis. safely assume that your regression results are significant.

Answers

Answer:

Saanvi recorded the number of math problems she did for homework each night for 10 days.

Step-by-step explanation:

why does Kingston get less rainfall than port Antonio. it's tomorrow ​

Answers

Answer:

Step-by-step explanation:

D.

Relief rainfall causes Port Antonio on the windward side of the Blue Mountains to receive an average of 430 mm (17 inches) of rain in November while Kingston, in the rain shadow, receives only 175 mm (7 inches).

To explain how the formula for area, A=bh
, can be used to derive the formula for the area of a circle, start by taking a circle, dividing it into small pizza shaped slices, and laying the slices out as shown.



The smaller the slices are, the less curvature and the closer to a parallelogram the shape becomes.

The base of the parallelogram, in terms of the circle, is
, and the height of the parallelogram is
.

Area is base times height, so multiply the base and the height together.

Now we have the formula area =
.

Answers

bh, where b is the base and h is the height of the parallelogram.

In the case of the circle, the base of the parallelogram is the circumference of the circle, which is equal to 2πr, where r is the radius of the circle. The height of the parallelogram is the distance from the center of the circle to the edge of the circle, which is also the radius r. Therefore, we have:

b = 2πr

h = r

Substituting these values into the formula for the area of a parallelogram, we get:

Area = bh = (2πr)(r) = 2πr^2

So the formula for the area of a circle is derived from the formula for the area of a parallelogram by using the circumference of the circle as the base and the radius of the circle as the height.

A circle has a Centre at (1,2). One point on its circumference is (-3,-1). What is the radius of the circle?

Answers

Answer:

5

Step-by-step explanation:

In the given question,

center of the circle C = (1, 2)

let P be the point (-3, -1) on the circle (on circumference)

radius of the circle is equal to the distance between the center and any point on its circumference.

[tex]d = \sqrt{(x_2 - x_1)^2 + (y_2 - y_1)^2}[/tex] (distance between two points)

therefore,

[tex]r = \sqrt{(-3 - 1)^2 + (-1 - 2)^2}[/tex]

[tex]r = 5[/tex]

Hopefully this answer helped you!

Other Questions
(T/F) the ticketing area is more secure than the area beyond the security check point Jozef "accidentally" broke his piggy bank to find a total of 42 dimes and quarters. If the coins totaled $8.25, how dimes did he have in his piggy bank? How many quarters? the passage data regarding the thermal stability and enzyme activity of mkr681h is most consistent with what conclusion regarding the role of arg681 in cct? QuestionThe colours of red litmus paper in acidic, neutral, and basic solutions are:Ared, orange and blue respectivelyBblue, violet and red respectivelyCred, colourless and blue respectivelyDred, red and blue respectivelyHard 4.5 Draw a diagram representing the scenario and find the requested value. A man is standing 270 feet from the base of a statue. If he man looks up at an angle of 34 degrees to see the top of the statue, how tall is the statuePlease round to the nearest whole foot. chris rents a booth at a flea market at a cost of $75 for one day. at the flea market chris sells picture frames each of which costs him $6.00. if chris sells each picture frame for $13, how many picture frames must he sell to make a profit of at least $200 for that day? which theory explains hwy billiingula speakers seem to think differently when they change langueges? Solve these two questions fast for brainliest and 20 points A) Explain the difference between Monkish concept and moderate path with examples. (word limit: 300 words, 3 marks)b) Discuss difference between Ideology and Islamic Ideology. (word limit: 200 words,3 marks)c) Define culture and what are the main features of Pakistani culture according to you. Explain the vital role of regional languages in Pakistani Culture with examples. (word limit: 300 words, 4 marks) Please help, this was due yesterday!!!!! rank the following alkyl halides in order of increasing reactivity in an E2 reaction. Be sure to answer all parts(CH3)2C(Br)CH2CH2CH3 (CH3)2CHCH2CH(Br)CH3 (CH3)2CHCH2CH2CH2Brlowest reactivity: ?Intermediate reactivity: ?Highest reactivity: ? the imaginary line around the earth that is the same distance from the north and south poles. A frog is riding on the top of a cylindrical piece of wood floating in still water. Half of the wood, with a diameter of 4 cm and length 20 cm, is immersed in water. The density of water is 1 gm/cc. a) What is the mass of the wood along with the frog? b) After the frog slowly goes into the water only one third of the wood remains immersed in water. Calculate the mass of the frog. c) Calculate x, the distance between the water level and the center of the circular end of the wooden piece. d) Briefly describe the motion of the wood after the instance the frog moves into the water. Give a rough sketch of x as a function of time. an unknown gas effuses through an opening at a rate 3.16 time slower than nenon gas. estimate the mola mass of this unknown gas. Tom is making birdhouses to sell at a farmers market each birdhouse requires 4.5 feet of wood planks to build and he sells them for $19.75 each if he has no more than 80 feet of planks to make birdhouses how much money can Tom earn at the farmers market. Show your work I know the answer but not the work. Simplify to create an equivalent expression2(-2-4p) + 2(-2p-1) How high would a 8 kg mass need to be lifted to have a potential energy of 400 J? Cmo presentars el escenario y los personajes de tu fbula? a car loan is taken for $23,000 to be paid back in 6 years, with monthly payments of $564. what nominal annual interest rate is being charged in this loan? what is the solubility of strontium sulfate, srso4, in 0.36 m sodium sulfate, na2so4 solution?