Help me please I don’t understand any of this.....

Help Me Please I Dont Understand Any Of This.....

Answers

Answer 1

9514 1404 393

Answer:

  3.  B  (1, -7)

  4.  B  x < -4

Step-by-step explanation:

3. An ordered pair is a solution to a set of equations or inequalities when putting the x and y values into each expression makes the expression true.

Here, all of the y-values offered are less than 2, so we need to look at whether the given points satisfy the second inequality.

  A 0 -(-5) > 5   ⇒   5 > 5 . . . FALSE

  B 1 -(-7) > 5   ⇒   8 > 5 . . . True

  C -3 -(-4) > 5   ⇒   1 > 5 . . . FALSE

The point (1, -7) satisfies both inequalities, so is a solution of the system.

__

4. The boundary line of an inequality is solid when the "or equal to" case is included in the solution. The symbols used for that are ≤ or ≥. When the symbol is < or >, the "or equal to" case is not included, and the boundary line is dashed.

Here, you can answer the question based simply on the < symbol. There is only one inequality shown that will have a dashed boundary line: choice B.

__

On a usual graph, x-values increase to the right, and y-values increase in the up direction. This means lesser values of x or y are to the left or down. You can determine the side of a boundary line that is shaded by considering this fact.

All you really need to do is find a variable term with a positive coefficient and look at where it stands in relation to the inequality symbol. Here, we have ...

  x < (something)

This tells us the shading will be where x-values are less than (left of) those on the boundary line.

So, for x < -4, shading will be to the left of the dashed boundary line.


Related Questions

Help please Or else I will give You A holy SLAP

Answers

Answer:

z = 450 - 135

z + 135 = 450

Step-by-step explanation:

Han's house is 450 meters from school. Lin's house is 135 meters closer than Han's house from school. So,

450 - 135 = 315 <-- equation to look for

Lin's house is 315 meters from school.

How do I do this and show work

Answers

We are given the expression:

[tex]\frac{\sqrt{2} }{3} = -\frac{2}{3} Sin\theta[/tex]

[tex]\sqrt{2}} = -2 Sin\theta[/tex]                                           [multiplying both sides by 3]

[tex]Sin\theta = \frac{\sqrt{2}}{-2}[/tex]                                                [Dividing both sides by -2]

[tex]Sin\theta = \frac{-1}{\sqrt{2}}[/tex]

which means:

[tex]\theta = Sin^{-1}(\frac{-1}{\sqrt{2}} )[/tex]

[tex]\theta = -Sin^{-1}(\frac{1}{\sqrt{2}} )[/tex]

θ = -45°                                                    [because [tex]Sin^{-1}(\frac{1}{\sqrt{2}})[/tex] = 45°]

Hence, the answer is -45° OR (360-45) = 315°

Put the letters into the correct order to make worlds. Then match them to the definitions
oiffce psorin hlostipa ctotgae fcatyor gtues-hsoue

1. A room or building where people work at desks……..
2. A small hotel that is not very expensive………
3. A building where people are sent if they have committed a crime……..
4. A building where people go if they ill……..
5. A building where people make things, often using machines………
6. A small attractive house in the country……….

*************

1. A: Excuse me, can you tell me (1) the way to how far for the station?
B: Yes, sure. (2) Take/Turn left at the traffic lights and you'll see the station (3) in front / by
front of you.
2. A: Excuse me, (4) is it far / can you direct to the museum?
B: No. Just go (5) straight off / straight on for about half a kilometre and the museum is
(6) on / at your right.

Answers

Answer:

Step-by-step explanation:

Find the measure of the missing angle.

Answers

Answer:

its 79 k(kkkkkkkkkkkkkkkkk

Answer:

79 i think

Step-by-step explanation:

How can -6 1/3 be expressed as the sum of it's integer and fractional parts?
I'm giving 20 points for this one

Answers

Answer:

bottom left: -6 + (-1/3)

Step-by-step explanation:

hope this helps :)

It’s -6 + (-1/3) I think :)

Which is the equation of the given line?
x = 1 y = 2x y=x y=1 (need help ASAP)

Answers

Answer:

y = 1

Step-by-step explanation:

Since the line is a horizontal line through 1, y = 1.

6. 175 is ___% of 125
7. ___is 120% of 720

Answers

Answer:

6.  175/125=x/100

Cross products  equal 125x=17500

Solve for x and you get 140%

7.  20% of 720 is 144.  You need to find 120% so add the full 720 (100%) to the 144 and you get 864 (120%)

Step-by-step explanation:

Answer:

6. 140%    7. 864

Step-by-step explanation:

Step for #1:

1.) 175 ÷ 125 = 1.4

2.) 1.0=100   0.4=40

3.) 1.4 = 140%

Answer; 140%

Step for #2:

1.) 120% × 720 = ?

2.) 120 x 720 = 86,400

3.) 86,400 ÷ 100 = 864

Answer; 864

A DVD player had a $108. Price tags the store gave a 25% discount. What was the amount of the discount?

Answers

Answer:

$27

Step-by-step explanation:

If we know that %25 is equal to 1/4, or 0.25, then we can use an equation that look like this:
108 × 0.25 = 27

Therefore, the amount of the discount was $27

How can you solve for percentages?

Solving for percentages can be tricky, and you may need help on trying to solve a problem including one. If you need to find a percentage of a number, the easiest way to do that is to convert the percentage into a fraction or decimal and multiply the total by that number.

For ex.

What is 15% of 60?

To do this, convert the percentage into a decimal.

15% converted into a decimal is 0.15.

Now multiply 60 by 0.15.

60 ÷ 0.15 = 9

So, the answer to this example would be 9.

use substitution to solve each system of equations

2. y= 4x+5
2x+y=17

6. 3x +4y= -3
x+2y= -1

8. -1=2x - y
8x-4y=-4

10. y= -4x + 11
3x + y=9

15. -5x+4y=20
10x-8y= -40

Answers

I think it's answer this .

Simplify (with steps please:))
√((x+c)^2 + y^2) = x*a/c + a

Answers

On solving the expression for (y), we get two possible values, one real and one complex as -

y = √{ (a²x²/c² + a² + 2a²x/c) - (x² + c² + 2xc)}    -- Real

y = i√{(a{x/c + 1})² + (x² + c² + 2xc)}    -- Complex

What is expression?In mathematics, an expression or mathematical expression is a finite combination of symbols that is well-formed according to rules that depend on the context.Mathematical symbols can designate numbers (constants), variables, operations, functions, brackets, punctuation, and grouping to help determine order of operations and other aspects of logical syntax.

Given is the expression as follows -

√{(x + c)² + y²} = x (a/c) + a

√{(x + c)² + y²} = xa/c + a

√{(x + c)² + y²} = a{x/c + 1}

√{x² + c² + 2xc + y²} = a{x/c + 1}

{x² + c² + 2xc + y²} = ± (a{x/c + 1})²

Now, we can write -

{x² + c² + 2xc + y²} = (a{x/c + 1})²              ...... (1)

and

{x² + c² + 2xc + y²} = - (a{x/c + 1})²                 ......... (2)

Solving (1) as -

{x² + c² + 2xc + y²} = (a{x/c + 1})²    

{x² + c² + 2xc + y²} = a²(x/c + 1)²

{x² + c² + 2xc + y²} = a²(x²/c² + 1 + 2x/c)

{x² + c² + 2xc + y²} = (a²x²/c² + a² + 2a²x/c)

y² = (a²x²/c² + a² + 2a²x/c) - (x² + c² + 2xc)

y = √{ (a²x²/c² + a² + 2a²x/c) - (x² + c² + 2xc)}

Solving (2) as -

{x² + c² + 2xc + y²} = - (a{x/c + 1})²                

y² =  - (a{x/c + 1})² - (x² + c² + 2xc)

y² = - {(a{x/c + 1})² + (x² + c² + 2xc)}

y = √- {(a{x/c + 1})² + (x² + c² + 2xc)}

y = i√{(a{x/c + 1})² + (x² + c² + 2xc)}

Therefore, on solving the expression for (y), we get two possible values, one real and one complex as -

y = √{ (a²x²/c² + a² + 2a²x/c) - (x² + c² + 2xc)}    -- Real

y = i√{(a{x/c + 1})² + (x² + c² + 2xc)}    -- Complex

To solve more questions on expression evaluation, visit the link below -

brainly.com/question/1041084

#SPJ1

HELP BRAINLIEST FOR FASTEST AND CORRECT NO NEED TO EXPLAIN

Answers

Answer:

The answer is 48

Step-by-step explanation:

Answer:

48 students

4*12=48

Explain how I do this please and thank you!

Answers

Answer:

Step-by-step explanation:

You need to add both of the angles you already know (1 and 2). If you add angle 1 and angle 2 you get 74. This means m < J K M would be 74°.

Answer:

74 degrees

Step-by-step explanation:

You have to add angles 1 and 2

35 +39=74

Therefore, 74 is the answer

What is the radius and diameter of the following circle

Answers

Answer:

r=4.2

d=9

Step-by-step explanation:

The radius is 4.2cm

The diameter is d=9

Solution

d=2r=2·4.5=9

Hope this helped!!!!!

pls help with question image is linked

Answers

The kilogram of fruits sold each day are 135 kg, 110 kg and 70 kg

How to determine the amount sold each day

From the question, we have the following parameters that can be used in our computation:

Day 2 = Day 1 - 25

Day 3 = 2/7 * (Day 1 + Day 2)

Total weights = 315

Next, we use the following representations

x = Day 1, y = Day 2 and z = Day 3

So, we have the following equations

y = x - 25

z = 2/7(x + y)

x + y + z = 315

Substitute y = x - 25 in z = 2/7(x + y) and x + y + z = 315

z = 2/7(x + x - 25) = 2/7(2x - 25)

x + y + z = 315 ⇒ x + x - 25 + z = 315

So, we have

z = 2/7(2x - 25)

2x + z = 340

Substitute z = 2/7(2x - 25) in 2x + z = 340

2x + 2/7(2x - 25) = 340

So, we have

7x + 2x - 25 = 1190

Evaluate the like terms

9x = 1215

Divide by 9

x = 135

So, we have

y = x - 25 = 135 - 25 = 110

z = 2/7(x + y) = 2/7 *(135 + 110) = 70

Hence, the amounts are 135 kg, 110 kg and 70 kg

Read more about equations at

https://brainly.com/question/2972832

#SPJ1

Name the property that i hown by each equation. A. 6a 4 = 4 6a
B. 30 60 = 15(2 4)
C. 3(8x 4) = 3(4 8x)
D. 4(6a) = (4 · 6)a

Answers

A. Commutative property of addition

B. Distributive property

C. Commutative property of addition

D. Associative property of multiplication

Commutative property of addition: The commutative property of addition says that a change in the order of the numbers being added does not affect the sum. We define a commutative property of addition as adding the numbers in any order that will give the same answer.  

                                    a + b =b + a

        Here, a and b is whole numbers, integers or decimals, or even fractions.

Distributive property: According to this property, multiplying the summation of two or more addends by a number will give the same result as multiplying each addend individually by the number and then adding the products together. In other words, according to the distributive property, an expression of form A (B + C) can be solved as A (B+ C) = AB + AC.Associative property of multiplication:  The associative property of multiplication is defined as that while multiplying three numbers, regardless of the way the numbers are grouped, the end result will always be the same.

Read more about the distributive property:

https://brainly.com/question/2807928

#SPJ4

The complete question is:

Name the property that is shown by each equation.

A. 6a + 4 = 4 + 6a

B. 30 + 60 = 15(2 + 4)

C. 3(8x + 4) = 3(4 + 8x)

D. 4(6a) = (4 · 6)a

At the toy store, 4 toy cars cost $3.84. How much does it cost to buy 20 toy cars?

A. $20.20

B. $17.20

C. $19.20

D. $21.20

Whoever gets the correct answer will get a crown!!!

Answers

Step-by-step explanation:

To answer this, we need to find the scale factor which is to find how much one individual car is worth.

So we need to divide 3.84 and 4.

3.84 ÷ 4 = 0.96

So each car is $0.96.

To find 20 toy cars, we need to multiply 0.96 and 20.

The answer is:

$19.20

the answer is C. Since you already know 4 is 3.84(and 4x5=20) so you multiply 3.85x5=19.20

Ellie ha been training for the Cedar Ridge Off-Road Race. The firt week he trained, he ran 3 day and took the ame two route each day: 2. 5 mile on a path in the wood in the morning and a longer route at the park in the afternoon. By the end of the week, Ellie had run a total of 24 mile. Which equation can you ue to find how many mile, x, Ellie ran each afternoon

Answers

The Distance that Ellie ran each evening is 16.5 miles for a entirety week.

How to find the number of miles?

We can use the following equation to find how many miles, x, Ellie ran each afternoon:

x + 2.5(3) = 24

Here, x represents the number of miles Ellie ran each afternoon, 2.5 represents the number of miles she ran each morning, and 3 represents the number of days she trained. The total number of miles she ran, 24, is on the right side of the equation.

To solve for x, we can start by simplifying the left side of the equation:

x + 7.5 = 24

Then, we can subtract 7.5 from both sides:

x = 16.5

So, Ellie ran 16.5 miles each afternoon.

To know more on equation at:

brainly.com/question/2972832

#SPJ4

I need to know the steps in order to solve this math problem....Please briefly describe the steps

Answers

a) A function w(t) to represent the amount of water in the pool using the two functions is w(t) = -3t + 5.

b) The pool will leak out the water when w(t)=0.

c) It will take 1.67 hours to leak out all the water from the pool.

d) Yes, functions f(t) and d(t) will intersect on the graphs when the pool stops leaking all the water out.

e) The domain of the functions  f(t), d(t) and w(t) are 0 ≤ t ≤ 1.67.

What are functions?

A relation between a collection of inputs and outputs is known as a function. A function is, to put it simply, a relationship between inputs in which each input is connected to precisely one output.

Subtract the amount flowing into the pool by the amount being drained out the pool to get the amount of water in the pool .

The given functions are -

Flowing: f(t) = t² + 8t + 9.

Draining: d(t) = t² + 11t + 4.

The amount of water in the pool is -

w(t) = f(t) - d(t)

w(t) = t² + 8t + 9 - t² - 11t - 4

w(t) = -3t + 5.

Therefore, the function obtained is w(t) = -3t + 5.

When the condition is w(t) = 0 then, the pool will have leaked all the water.

Plugging in the values -

-3t + 5 = 0.

3t = 5

t = 1.67.

Therefore, the pool will leak all the water in 1.67 hours.

Functions f(t) and d(t) intersect on the graph when all the water of the pool has been leaked. The graph is shown below.

The domain of a function is the set that contains all input values of the function. The input is the time in the given situation, so -

Time cannot be negative, hence t ≥ 0.

When all the water has been drained, everything stops, hence t ≤ 1.67.

Therefore, the domain of the function is 0 ≤ t ≤ 1.67.

To learn more about function from the given link

https://brainly.com/question/22340031

#SPJ1

Please help me on this :/

Answers

Answer

8. b

9.C

10.a

11.a

12. c

13. b

brainliest pls <3

Unit 1 geometry basics Homework 2
pls help! i’ll mark brainliest

Answers

The value of AB= 24 BD is congruent to BC. BD=BC

BD = 5x – 26, BC = 2x + 1, and AC = 43

How to find value of AB?From the diagram , AC=AB+BCTo find out , we need to find  BC first . For that we have to find out xWE know that BD=BC, using that we solve for x5X-26=2X+1SUBSTRACT 2X3X-26=1ADD 263x=27x=9Now we plug in 9 for x  and find out BCBC=2x+1BC=2(9)+1BC=19We know AC= 43AC=AB+BC43=AB+19subtract 19AB=24

To learn more about find value of AB refers to:

brainly.com/question/11923213

#SPJ1

A Chemistry book is moved 2 meters to the left and then 1 meter to the right. What is its displacement?

Answers

Answer:

1 meter to the Left

Step-by-step explanation:

Displacement is the distance between the start and ending points

By having it at first 2 meters to the left, then to move it back 1 meter to the right, you are subtracting from the initial movemnet to the left.

(2-1) = 1 meter to the Left

Solve these for points I got a one in algebra so this would be helpful to my grade

Answers

The solution for each system of equations is given as follows:

1) x = -4, y = -8.

2) x = 5, y = -1.

3) x = -7, y = 2.

4) No solution.

5) x = 2, y = -6.

6) x = -3, y = 4.

How to solve the system of equations?

The system of equations are solved using the elimination method, writing  one variable as a function of another, replacing in the other equation, and then obtaining each variable.

For item 1, we eliminate x, as follows:

x = 12 + 2y.

Hence the solution for y is obtained as follows:

5(12 + 2y) + 3y = -44

60 + 10y + 3y = -44

13y = -104

y = -104/13

y = -8.

Then the solution for x is given as follows:

x = 12 + 2y = 12 + 2(-8) = -4.

For item 2, we have that:

y = 19 - 4x.

Hence:

7x - 2(19 - 4x) = 37

7x - 38 + 8x = 37

15x = 75

x = 5.

Hence the solution for y is of:

y = 19 - 4(5) = -1.

For item 3, we can simplify the second equation by two, hence:

-x + y = 9.

y = 9 + x.

Hence:

3x + 8(9 + x) = -5

3x + 72 + 8x = -5

11x = -77

x = -7.

Hence the solution for y is of:

y = 9 - 7 = 2.

For item 4, we have that:

x = 7 + 3y.

Hence:

2(7 + 3y) - 6y = 12

14 + 6y - 6y = 12

0y = -2. (no solution, division by zero).

For item 5, we have that:

y = -2 - 2x.

Hence:

5x + 3(-2 - 2x) = -8

5x - 6 - 6x = -8

-x = -2

x = 2.

Hence the solution for y is of:

y = -2 - 2(2)

y = -6.

For item 6, we simplify the second equation by two, hence:

2x + y = -2

y = -2 - 2x.

Replacing on the first equation, we have that:

2x + 5(-2 - 2x) = 14.

2x - 10 - 10x = 14

-8x = 24

8x = -24

x = -3.

Hence the solution for y is obtained as follows:

y = -2 - 2(-3)

y = -2 + 6

y = 4.

More can be learned about a system of equations at https://brainly.com/question/24342899

#SPJ1

Help me please?!!!!!!!!!

Answers

I think it’s the last one but I’m not sure

Answer:

Last option: f(x) = [tex]\sqrt[5]{\frac{x}{7} }[/tex]

Hope this helps!

This is algebra 2, please help.

Answers

The vertex and axis of symmetry of the graph is shown in image.

What is an expression?

Mathematical expression is defined as the collection of the numbers variables and functions by using operations like addition, subtraction, multiplication, and division.

Given that;

The function is,

⇒ f (x) = 1/4 (x + 6)² - 5

Now,

Since, The function is,

⇒ f (x) = 1/4 (x + 6)² - 5

Hence, The points corresponds to x = - 2 and - 4 are;

For x = - 2;

⇒ f (x) = 1/4 (x + 6)² - 5

⇒ f (x) = 1/4 (-2 + 6)² - 5

⇒ f (x) = 1/4 (4)² - 5

⇒ f (x) = 4 - 5

⇒ f (x) = - 1

For x = - 4;

⇒ f (x) = 1/4 (x + 6)² - 5

⇒ f (x) = 1/4 (-4 + 6)² - 5

⇒ f (x) = 1/4 (2)² - 5

⇒ f (x) = 1 - 5

⇒ f (x) = - 4

Thus, The points are;

⇒ (- 2, - 1) , (- 4, - 4)

And, The vertex of the function is,

⇒ ( - 6, - 5 )

And, The axis of symmetry of the graph is,

⇒ x = - 6

Learn more about the mathematical expression visit:

brainly.com/question/1859113

#SPJ1

A hot air balloon is cruising at an altitude of 120 m above ground when it begins its descent the balloon descends at a rate of 4.5 m per minute explain how you would set up the equation to model when the balloon will reach an altitude of 75 m above ground then solve the equation and check your solution

Answers

The equation to model the given situation is 120 - 4.5t= 75 and the solution to the equation is 10 minutes.

What is an equation?

An equation is a mathematical statement that is made up of two expressions connected by an equal sign. For example, 3x – 5 = 16 is an equation.

The balloon will reach an altitude of 75 meters above the ground.

Now, 120-75 =45 meters

Let t be the time to descends 45 meters

So, 120 - 4.5t= 75

= -4.5 t = 75-120

= -4.5t = -45

= t = -45/(-4.5)

= t = 10 minutes

Hence, the equation to model the given situation is 120 - 4.5t= 75 and the solution to the equation is 10 minutes.

Learn more about equation at:https://brainly.com/question/22688504

#SPJ1

What is the x-coordinate of the solution to the system shown?

3x - y = 6
3x + y = 34

Answers

The x-coordinate of the solution of the system of equations is x = 20/3

What is the x-coordinate of the solution?

Here we have a system of equations below:

3x - y = 6

3x + y = 34

And we want to find the x-cordinate of the solution, so we need to solve this for x.

We can use the elimination method, you can see that if we add both equations we will get:

(3x - y) + (3x + y) = 6 + 34

6x = 40

x = 40/6

We can simplify that fraction to get:

x = 20/3

That is the x-coordinate of the solution.

Learn more about systems of equations:

https://brainly.com/question/13729904

#SPJ1

In the diagram below, PQ is parallel to MN. If PQ, is 22 more than MP, PO=12, and MN=12, find the length of MP. Figures are not necessarily drawn to scale. State your answer in the simplest radical form, if necessary.

Answers

The measure of the length MP is equal to 6.

What are similar triangles?

Two triangles are similar triangles if they have the same corresponding angle measures and proportional side lengths.

Given is a triangle ΔOMN.

Now, ΔOMN and ΔOPQ are similar. This means that the side lengths are proportional to each other. We can write -

OP/OM = PQ/MN

12/OM = PQ/MN

12/(OP + PM) = PQ/MN

It is given that -

PQ = MP + 2

12/(OP + PM) = (MP + 2)/MN

12MN = (MP + 2)(OP + PM)

12 x 12 = (MP + 2)(MP + 12)

(MP)² + 12MP + 2MP + 24 = 144

(MP)² + 14(MP) - 120 = 0

Let MP = x, then we can write -

x² + 14x - 120 = 0

(x + 20)(x - 6) = 0

(x + 20) = 0   and    (x - 6) = 0

x = - 20   and   x = 6

x = 6      {Lengths cannot be negative}

Therefore, the measure of the length MP is equal to 6.

To solve more questions on similar triangles, visit the link below -

https://brainly.com/question/14926756

#SPJ1

On Melissa's 6th birthday, she gets a $2000 CD that earns 7% interest compounded quarterly. If the CD matures on her 13th birthday, how much money will be available?​

Answers

Answer:

[tex]A\simeq3250.83[/tex]

Step-by-step explanation:

The amount formula in compound interest is:

[tex]A=P(1+\frac{r}{n} )^{nt}[/tex]

where:

P = principal amount

r = annual interest

n = number of compounding periods

t = number of years

We already know that:

P = $2000

[tex]r = 7\% = \frac{7\%}{100\%}=0.07[/tex]

t = 7 (number of years from 6th to 13th bday)

n = 4 (quarterly in a year)

Then,

[tex]A=2000(1+\frac{0.07}{4} )^{(4)(7)}\\\\A=2000(1+\frac{0.07}{4} )^{28}\\\\A=3250.825792\\\\A\simeq3250.83[/tex]

Describe the transformation from the red figure to the blue figure.

The blue figure is translated ____ units ____ and ____ units ____ from the red figure.

Answers

Step-by-step explanation:

The blue figure is translated 2 units down and 6 units across from the red figure.

A cereal box is designed to hold a volume of 4096 cubic centimetres of cereal.
What dimensions will minimize the cost of producing the box?

Answers

Answer:

Refer to the step-by-step

Step-by-step explanation:

To minimize the cost of producing the box, we would want the box to be a cube.

Where the volume, [tex]V=s^{3}[/tex], where s is the length of one side of the box.

We were given the value, [tex]V=4096 cm^{3}[/tex], plug this into the equation above so we can find the dimensions of the box...

[tex]4096=s^{3} = > s=\sqrt[3]{4096} = > s=16[/tex]

Thus the dimensions to minimize the cost of the production of the box would be 16cm by 16cm by 16cm.

Other Questions
heres free wallpapers and pnts! :)) (phone and PC and chromebook wallpapers) (credits to those who made them !) A chemist has one solution that is 30.% acid and another solution that is 18% acid. How much of each solution should be used to get 300. L of a solution that is 21% acid?a. 23 L of the 30.% solution and 277 L of the 18% solutionb. 75 L of the 30.% solution and 225 L of the 18% solutionc. 131 L of the 30.% solution and 169 L of the 18% solutiond. 138 L of the 30.% solution and 162 L of the 18% solutione. 244 L of the 30.% solution and 56 L of the 18% solution The length of some material is 8.3m correct to 2 significant figures. Write the error intlength, x, of the material. What agreement clearly defines the status of military personnel of one country stationed in the territory of another Elise randomly surveyed students at her school to find out their favorite music. the table shows the results if Elises survey. if there are 400 students at Elises school, how many can she predict will like pop the best? Claire buys a new car for 5700.She pays a deposit of 12%She then pays the rest of the cost in 15 equal monthly payments.How much is each monthly payment Use the story, "To Build a Fire" by Jack London to answer questions 3-11:Jack London identifies the main character as a chechaquo, a newcomer to the Yukon. However, he also describes him as "quick and alert in the things of life, but only in the things, and not the significances."What inference can you make about the man based on this statement?Question 3 options:a) The man learns quickly and is likely to be successful on his journey.b) The man knows facts but does not appreciate the deeper meaning.c) The man is quick to learn new ideas and apply them.d) The man spends too much time thinking about things. Victor wants to conduct a survey to find how much time the students of his school spent playing football. Which of the following is an appropriate statistical question for this survey? Who plays football on weekends? Who plays football the most on Mondays? How many hours per week do you play football? How many students play football for one hour every day?-----------------------------honestly the best route on brainly is being a troll since nobody does anything about it.. what is the value of z? (multiple choice) Which expression can be written as[tex]k \sqrt{3} [/tex]where k is an integer?a.[tex] \sqrt{63} [/tex]b.[tex] \sqrt{108} [/tex]c.[tex] \sqrt{144} [/tex]d.[tex] \sqrt{150} [/tex] Which Southeast Asian countrys largest ethnic group is the Tagalog?A) MalaysiaB) The PhilippinesC) LaosD) Myanmar An object is moving at a speed of 11 yards every 6 months. Express this speed in centimeters per hour. Which of these is an example of nonverbal communication?O A. A medical assistant smiling at a patient before administering aneedleO B. A nurse telling a patient how many doses of medication to takeO C. An X-ray technician sharing the results of an X-ray with a patientD. A physical therapist instructing a patient on how to walk "WTI's two employees are paid weekly. As of the end of the year, two days' salaries have accrued at the rate of $100 per day for each employee. " SEVENTH GRADE ALGEBRA PLS HELPA group of 5 friends each have x action figures in their collections. Eachfriend buys 8 more action figures. Now the 5 friends have a total of 150action figures.Write an equation that can be used to find x, the number of actionfigures per person. a) Complete the prime factor trees for 24 and 40:24226240223b) What is the Lowest Common Multiple of 24 and 40?2215Submit Answer Why would an orthodontist extend your next appointment date? Is it a sign of getting your braces off soon? Please answer 1, A specialized computer used to collect, store, and report all the information about a sales transaction. 2. The report that summarizes the cash and credit card sales of a point-of-sale terminal. 3. The process of preparing a batch report from a point-of-sale terminal. 4. A special journal used to record only cash receipt transactions. 5. A cash discount on a sale taken by the customer. 6. The amount a business receives from the sale of an item of merchandise. 7. A subsidiary ledger containing all accounts for charge customers. 8. A special journal used to record only sales of merchandise on account. 9. A sale in which the customer pays for the total amount of the sale at the time of the transaction. 10. A report of credit card sales produced by a point-of-sale terminal. 11. A tax on a sale of merchandise or services. 12. The amount a business adds to the cost of merchandise to establish the selling price. 13. A listing of customer accounts, account balances, and total amount due from all customers. Why is cultural innovation important? A corporate bond's yield to maturity: Multiple select question. remains fixed over the life of the bond. changes over time. is usually not the same as a bond's coupon rate. is always equal to a bond's coupon rate.