Step-by-step explanation:
The answer will be zero
here are the steps:
cos(90-10)xcos(90-80)-sin(90-10)xsin(90-10)=
(cos10xcos10)-(sin80xsin80)=
0.965111-0.965111=0
have a good day :)
I hope it will benefit you.
HELP PWEASEEEEEEEEEEEEEEEEEEEEEEEEEEEEEE
Answer:
rap music
Step-by-step explanation:
^
Answer:
i’m not sure if these are right or not but
Step-by-step explanation:
the first one is no
i think the second one is no
i think the third one is yes
i think the fourth one is yes
i am not sure and i’m REALLY sorry if its wrong
ok so-
{[Math from BIM]}
ss below
Answer:
2 real solutions
Step-by-step explanation:
x=6i, -6i
Over which interval does f(t) have positive average rate of change?
A) -8,-2
B) -5,-1
C) -9,-8
D) 2,4
Answer:
D) 2,4
Step-by-step explanation:
The only answer with positive numbers
Answer:
D) 2,4
Step-by-step explanation:
A population of 60 foxes in a wildfire preserve doubles in size every 12 years. The function y = 60*2^x, where x is the number of 12-year periods, models the population growth. How many foxes will there be after 24 years?
A rectangular prism has a volume of 900 cubic units. The prism has a length of 25 units and a width of 12 units. Which equation could be used to find h, the height of the prism?
Answer:
52 cubic units
Step-by-step explanation:
got it right on edg
Answer:
37h 900
Step-by-step explanation:
4 people can dig a trench in 3 hours.
How long would it take 9 people?
Give your answer in minutes.
Answer:
80 minutes.
Step-by-step explanation:
do I need to explain? I hate explaining :(
What is the smallest solution to the equation 3x2 - 16 = 131?
Answer:
7,-7 are the solutions
Step-by-step explanation:
Not a perfect square so its
+-7
I would go with -7 since its the lowest amount
Answer:
-7
Step-by-step explanation:
Joe earns a monthly salary of 250 plus a commission on his total sales. Last month his total sales were $7,289 and he earned a total of $1,275. What is his commission rate?
Answer: Joe earns a monthly salary of 250 plus a commission on his total sales. Last month his total sales were $7,289 and he earned a total of $1,275. What is his commission rate?
Step-by-step explanation:
250 + $7,289 + $1,275 = 8814
3(x + 2) + 4(x - 5) = 10
solve x
3(x + 2) = 12
solve x
7(3 - x) = 8(4 - 2x)
solve x
8(x + 1) - 3(x + 4) = 7(2 - x)
solve x
7(x + 2) = 6(x + 5)
solve x
4(x + 2) = 48
siplfy
5x + 2(x - 3) = -2(x - 1)
Answer:
1. x=24/7
2. x=2
3. x= 11/9
4. x=3/2
5. x=16
6. x=10
7. x=8/9
Step-by-step explanation:
Isolate the variable by dividing each side by factors that don't contain the variable.
Answer:
1. x=24/7
2. x=2
3. x= 11/9
4. x=3/2
5. x=16
6. x=10
7. x=8/9
Step-by-step explanation:
Isolate the variable by dividing each side by factors that don't contain the variable.
Step-by-step explanation:
The volume of a cylinder can be determined using the formula V=πr2h, where r and h represent the radius and height of the cylinder, respectively. A volume of paint expressed as (8x3 + 31x2 + 32x)π and a volume of paint expressed as (10x3 + 17x2)π are poured into a paint can in the shape of a cylinder. Determine possible expressions for the radius of the can and the depth of the paint in the can.
Answer:
Possible expressions for the radius of the can and the depth of the paint in the can are [tex]r = \sqrt{9\cdot x^{2}+24\cdot x+16}[/tex] and [tex]h = 2\cdot x[/tex], respectively.
Step-by-step explanation:
Let be the initial volumes of the initial cans represented by these expressions:
[tex]V_{1} = (8\cdot x^{3}+31\cdot x^{2}+32\cdot x)\cdot \pi[/tex] (1)
[tex]V_{2} = (10\cdot x^{3}+17\cdot x^{2})\cdot \pi[/tex] (2)
The resulting volume of the paint can is the sum of the two functions:
[tex]V_{3} = (18\cdot x^{3}+48\cdot x^{2}+32\cdot x)\cdot \pi[/tex] (3)
Then, we proceed to factor the polynomial:
[tex]V_{3} = 2\cdot (9\cdot x^{2}+24\cdot x +16)\cdot x \cdot \pi[/tex]
[tex]V_{3} = \pi\cdot (9\cdot x^{2}+24\cdot x + 16)\cdot (2\cdot x)[/tex] (3b)
By direct comparison with the volume formula for the cylinder we have the following expressions:
[tex]r^{2} = 9\cdot x^{2}+24\cdot x + 16[/tex]
[tex]r = \sqrt{9\cdot x^{2}+24\cdot x+16}[/tex]
[tex]h = 2\cdot x[/tex]
Possible expressions for the radius of the can and the depth of the paint in the can are [tex]r = \sqrt{9\cdot x^{2}+24\cdot x+16}[/tex] and [tex]h = 2\cdot x[/tex], respectively.
HELP I NEED HELP ASAP
HELP I NEED HELP ASAP HELP I NEED HELP ASAP
HELP I NEED HELP ASAP HELP I NEED HELP ASAP
HELP I NEED HELP ASAP
Answer:
A) (2,5)
Step-by-step explanation:
longest side is between points (1,4) and (3,6)
so midpoint is ((1+3)/2), ((4+6)/2), which equals (2, 5)
• What is the diameter of the circle?
What is the circumference of the circle
What is the area of the circle
Answer:
Radius = r
Diameter = 2r
Circumference = 2πr
Area = πr²
a diameter of a circle is a line drawn through the center of a circle.
Does anyone mind helping me im confused-
Answer:
Malcolm owes the greatest amount.
Step-by-step explanation:
The question is asking for the amount owed by each person. That just means you take the absolute value of their bank balance if their bank balance is negative. Absolute value is just how far away the number is from zero (basically when a number is negative, you're just making it positive).
Sophia owes $150, Malcolm owes $325, and Oren owes $275.
325 > 275 > 150
Thus Malcolm owes the most, since his amount owed is the highest.
How many students are enrolled in a course either in calculus, discrete mathematics, data structures, 7. or programming languages at a school if there are 507, 292, 312, and 344 students in these courses, respectively; 14 in both calculus and data structures; 213 in both calculus and programming languages; 211 in both discrete mathematics 558 and data structures; 43 in both discrete mathematics and programming languages; and no student may take calculus and discrete mathematics, or data structures and programming languages, concurrently
Answer:
974
Step-by-step explanation:
Let assume that:
The set of student that took part in Calculus be = C
Those that took part in discrete mathematics be = D
Let those that took part in data structures be = DS; &
Those that took part in Programming language be = P
Thus;
{C} = 507
{D} = 292
{DS} = 312
{P} = 344
For intersections:
{C ∩ DS} = 14
{C ∩ P} = 213
{D ∩ DS} = 211
{D ∩ P} =43
{C ∩ D} = 0
{DS ∩ P} = 0
{C ∩ D ∩ DS ∩ P} = 0
According to principle of inclusion-exclusion;
{C ∪ D ∪ DS ∪ P} = {C} + {D} + {DS} + {P} - {C ∩ D} - {C ∩ DS} - {C ∩ P} - {D ∩ DS} - {D ∩ P} - {DS ∩ P}
{C ∪ D ∪ DS ∪ P} = 507 + 292 + 312 + 344 - 14 - 213 - 211 - 43 - 0
{C ∪ D ∪ DS ∪ P} = 974
Hence, the no of students that took part in either course = 974
PRE-CALC no links.
How much should be deposited in an account paying 3% interest, compounded monthly, in order to have a balance of $9,000 after 17 years and 3 months?
Answer:
$5367.54
Step-by-step explanation:
9000 = P(1 + .03/12)^207*
9000 = P×1.676744643
P = 5367.54
*207 = 12 x 17.25
Determine the area of a circle whose radius is 15 feet. Use pie=3.14
Answer:
Down below
Step-by-step explanation:
[tex]A=\pi r^2\\A=3.14*(15)^2\\A=3.14*225\\A=706.5[/tex]
increase 50$ by 15%
Can you say how to do it and answer?
Find the distance between the points (4,10) and (4, -7)
Answer:
17
Step-by-step explanation:
Hello There!
Once again we are going to use the distance formula to find the answer
[tex]d=\sqrt{(x_2-x_1)^2+(y_2-y_1)^2}[/tex]
This time we need to find the distance between the points (4,10) and (4,-7)
*we plug in the values into the formula)
[tex]d=\sqrt{(4-4)^2+(-7-10)^2} \\4-4=0\\-7-10=17\\d=\sqrt{0^2+(-17)^2} \\0^2=0\\-17^2=289\\\sqrt{289} =17[/tex]
so we can conclude that the distance between the points (4,10) and (4,-7) is 17 units
Graph y=2x+1
Can you please help.
Answer:
Here is the image you need to replicated
(っ◔◡◔)っ ♥ Hope It Helps ♥
The ratio of mass to volume for a type of metal is 27 g to 10 cm³ a sample of the metal has a mass of 81 g what is the volume in cubic centimeters of the sample of metal
Answer:
volume in cubic centimeters = 30 cm³
Step-by-step explanation:
Ratio of mass to volume = 27 g : 10 cm³
what is the volume in cubic centimeters of the sample of metal if mass = 81 g
Let
volume in cubic centimeters = v
Ratio of mass to volume = 81 g : v
Equate both ratios
27 g : 10 cm³ = 81 g : v
27/10 = 81/v
Cross product
27 * v = 10 * 81
27v = 810
v = 810/27
v = 30 cm³
volume in cubic centimeters = 30 cm³
A cylindrical test tube holds 6π cm of liquid when filled to the 6cm mark what is the diameter of the test tube to the nearest hundredth of a Centimeter
Answer:
2cm
Step-by-step explanation:
Given data
Capacity/volume of liquid held= 6π cm^3
Height= 6cm
Required
The diameter d of the tube
let us apply the expression for the volume of cylinder
V=πr^2h
6π=πr^2*6
6=r^2*6
r^2= 6/6
r^2=1
r= √1
r=1cm
Hence the diameter d = 2r= 2*1= 2cm
Please help I will give 20 points if right
Answer:
for my own advice you should add those numbers then that Square unit if she's there it's 90° so you should find the area of the polygon which that thing when you come this sides you get the number of the polygon with your plus then by those numbers then he write his equals to 90 degree then you'll get your answer thank you
Kaylee deposited $1,450 in an account that earns 2.596 interest compounded annually. Which function represents the situation, where tis
the time in years?
fit) = 1450(2.5)
f(t) = 1450(1.25)
FO) = 1450(.025)
f(t) = 1450(1,025)
Answer:
[tex]f(t) = 1450(1.025)^{t}[/tex]
Step-by-step explanation:
Given
[tex]P =1450[/tex] -- principal
[tex]r = 2.5\%[/tex] --- rate
[tex]n = 1[/tex] --- compounded once a year
Required
Determine the function for compound interest
Compound interest f(t) is calculated as:
[tex]f(t) =P(1 + r/n)^{nt[/tex]
So, we have:
[tex]f(t) = 1450(1 + 2.5\%/1)^{1 * t}[/tex]
[tex]f(t) = 1450(1 + 2.5\%)^{t}[/tex]
[tex]f(t) = 1450(1 + 0.025)^{t}[/tex]
[tex]f(t) = 1450(1.025)^{t}[/tex]
Hang was trying to factor 10x^2 + 5x she found that the greatest common factor of these terms was 5x and made an area model what is the width of the area model
Width of Heng's area model is 2x + 1
Step-by-step explanation:
Given:
Greatest common factor is 5x
To Find:
The width = ?
Solution:
let the be the area
And 5x be the length
Then area = length x width
Now rewriting the formula for width, we get
Width =
Substituting the values in the above formula
Width =
Width = 2x + 1
Describe the attributes of An acute triangle: An obtuse triangle: A right triangle: How many equal sides does an equilateral triangle have: isosceles: scalene pls help I will give you 15 pointss
Answer:
An acute triangle - interior angles are always less than 90 degrees with different side measures.
An obtuse triangle - one of the interior angles is more than 90 degrees. if one angle measures more than 90 degrees, then the sum of the remaining two angles is less than 90 degrees.
An right triangle - a triangle with a right angle (90 degrees)
Equilateral triangle has three equal sides. Isosceles triangles has two equal side lengths. Scalene triangles has no equal side lengths
Need help as soon as possible pls help
1. The value of x is:
180° - 40° - 30° = 110°
2. The value of x is:
90°- 38° = 52°
Answer:
Step-by-step explanation:
180 = 40 + x + 30
110 = x
90 = 38 + x
52 = x
4(2a - 3) = 2(3a + 1)
What's the answer?
Answer:
a=7
Step-by-step explanation:
4(2a-3) = 2(3a+1)
8a-12 = 6a+2
2a-12=2
2a=14
a=7
A spinner is divided into 8 equal sections and each section contains a number from 1 to 8. What probability of the spinner landing on 5?
Answer:
1/8
Step-by-step explanation:
1 number out of eight possible choices.
Answer:
1/8
Step-by-step explanation:
the answer
Find GCF (212, 96) and LCM (212, 96) using prime factoring.
Anyone know...
Answer:
8x12 and 2x2x53
Step-by-step explanation:
Sao can text 1500 words per hour. He needs to text a message with 85 words. He only has 5 minutes between classes to complete the text. Can he do it in 5 minutes?