Calculate the PH of the solution in the Image

Calculate The PH Of The Solution In The Image

Answers

Answer 1

The solution has a pH of around 5.93.

Why is the buffer system of CH3COOH and CH3COONa used?

When a weak acid or a weak base is applied in modest amounts, buffer solutions withstand the pH shift. A buffer made of a weak acid and its salt is an example of which is an acetic acid and sodium acetate solution (CH3COOH + CH3COONa).

The weak acid is then partially dissociated in water, resulting in the conjugate base and hydrogen ions:

CH3COOH + H2O ⇌ H3O+ + CH3COO-

The acid dissociation constant, Ka, which is what this reaction's equilibrium constant is, is as follows:

Ka = [H3O+][CH3COO-]/[CH3COOH]

The Henderson-Hasselbalch equation may be used to determine the pH of a solution:

pH = pKa + log([A-]/[HA])

To begin with, we must figure out how much CH3COOH is present in the solution:

moles of CH3COOH = M x V = 0.15 mol/L x 0.050 L = 0.0075 mol

mass of CH3COOH = moles x molar mass = 0.0075 mol x 60.05 g/mol = 0.450 g

After adding sodium acetate, the solution's residual CH3COOH will be:

0.450 g - 1.00 g

= -0.55 g

The amount of sodium acetate supplied may be used to determine the CH3COO- concentration:

moles of CH3COO-=1.00g/82.03 g/mol

=0.0122 mol

The concentration of CH3COO- in the solution will be:

0.0122 mol/0.050 L=0.244 M

The Henderson-Hasselbalch equation may now be used to determine the pH of the solution:

pH = pKa + log([A-]/[HA])

pKa = -log(Ka) = -log(1.75 x 10⁻⁵) = 4.756

[A-]/[HA] = [CH3COO-]/[CH3COOH]

= 0.244 M / 0.0075 M = 32.53

pH = 4.756 + log(32.53)

= 5.93

To know more about solution visit:-

https://brainly.com/question/22695394

#SPJ1


Related Questions

About how many elements are known to form bonds with atoms

Answers

As of now, about 118 elements are known to form bonds with atoms. However, the number may increase as new elements are being discovered and studied by scientists.


Answer:

The number refers to the number of bonds each of the element makes: Hydrogen makes 1 bond, Oxygen makes 2 bonds, Nitrogen makes 3 bonds and Carbon makes 4 bonds. These four elements are widely used when it comes to drawing Lewis structures at introductory chemistry level.

Explanation:

if it helped you please mark me a brainliest :))

A solid chloride sample weighing 0.3147 g required 43.75 mL of 0.05273 M AgNO, to reach the Ag,CrO, end point.

a. How many moles Cl ion were present in the sample? (Use Eqs. 2 and 3.)

b. How many grams Cl- ion were present? (Use Eq. 4.)

c. What was the mass percent C ion in the sample? (Use Eq. 5.) moles Cr g Cr % Cr​

Answers

Answer:its a

Explanation: i juts know it is hope it helps

In which two phase changes does energy decrease?

Answers

Answer: potential energy

Explanation:  During a phase change, the heat added (PE increases) or released (PE decreases) will allow the molecules to move apart or come together. Heat absorbed causes the molecules to move farther apart by overcoming the intermolecular forces of attraction.

Work out what the substances are and which one was used? I know what the first one is and I know what other chromatography one is used i just don't know how to identify it.

Answers

d (i)  Rf of 0.54 could be substance B or substance D.

d (ii) It would eliminate any potential errors or uncertainties from the first experiment.

Describe Chromatography?

Chromatography is a laboratory technique used for separating and analyzing mixtures of substances. It involves passing a mixture through a stationary phase, which is typically a solid or liquid, and a mobile phase, which is a gas or liquid. The different components of the mixture will interact differently with the stationary and mobile phases, causing them to move at different rates and ultimately separate from each other.

1 (d) (i) Based on the Rf values given in the table, two possible identities for the substance that caused the spot with an Rf of 0.54 could be substance B or substance D.

1 (d) (ii) To confirm which one of the substances (B or D) caused the spot, a chromatography experiment with a different solvent could be carried out. This would involve using a solvent that has a different polarity than water, such as hexane or chloroform, and running a new paper chromatography of the mixture. If the same spot appears at the same Rf value as in the previous experiment, then it is likely that the substance causing the spot is substance B. However, if a different spot appears at a different Rf value, then the substance causing the original spot is likely to be substance D. This experiment would help to confirm the identity of the substance causing the spot and would eliminate any potential errors or uncertainties from the first experiment.

To know more about experiment visit:

https://brainly.com/question/30296545

#SPJ1

The volume of a sample of hydrogen gas was decreased from 10.89 L
to 4.18 L
at constant temperature. If the final pressure exerted by the hydrogen gas sample was 8.95 atm,
what pressure did the hydrogen gas exert before its volume was decreased?

Answers


Answer:

3.44 atm

Explanation:

boyles law

p1v1=p2v2

p1*10.89 L=4.18 L*8.95 atm

p1*10.89=4.18*8.95

p1*10.89 = 37.411

p1 = 37.411/10.89

p1 = 3.43535353535

1. Element X and element Y have a difference in electronegativity of 0.7; Will the bond XY be covalent or ionic? explain using electronegativity difference.

2. Which two substances would have a higher melting point. O2 or quatz (SiO2)? Explain your answer.

3. write the name of the covalent compound
Cl2O6

Answers

1. When the difference in electronegativity between two elements is less than 1.7, the bond between them is generally covalent. In this case, the difference in electronegativity between element X and element Y is 0.7, which is less than 1.7. Therefore, the bond XY is likely to be covalent.

2. Quartz (SiO2) would have a higher melting point than O2. This is because quartz is a giant covalent structure, meaning that it has a three-dimensional network of covalent bonds throughout the entire crystal. In contrast, O2 is a simple molecular substance, meaning that it consists of discrete molecules held together by weak intermolecular forces. The strong covalent bonds in quartz require more energy to break than the weak intermolecular forces in O2, resulting in a higher melting point for quartz.

3. The name of the covalent compound Cl2O6 is dichlorine hexoxide.

Acceleration refers to the rate of change in an object’s 5.________

Answers

Answer:

velocity

Explanation:

you’ve had a light snack that has 14 grams of glucose, 4 grams of olive oil, and 3 grams of amino acids. How many calories are in your snack?

Answers

The total number of calories in snack that has 14 grams of glucose, 4 grams of olive oil, and 3 grams of amino acids is 141calories.

Given the mass of glucose = 14g

The mass of olive oil = 4g

The mass of amino acids = 3g

To calculate the amount of calories in the snack, we first need to look at the calories per gram of each component of the snack:

Glucose: 4 calories per gram

14 grams of glucose x 4 calories per gram = 56 calories

Olive oil: 9 calories per gram

4 grams of olive oil x 9 calories per gram = 36 calories

Amino Acids: 4 calories per gram

3 grams of amino acids x 4 calories per gram = 12 calories

Now that we have the calories per gram for each component, we can add them together to get the total number of calories in the snack:

56 calories from glucose + 36 calories from olive oil + 12 calories from amino acids = 104 calories

Finally, we can add a 10% calorie adjustment for the other components of the snack (such as fat and fiber) to get the total number of calories:

104 calories + 10% (10.4 calories) = 141.4 calories

Therefore, the total number of calories in your snack is 141.

To learn more about amino acids click here https://brainly.com/question/1837143

#SPJ1

30/3/2023
7 Num 224/321094
CHM 106
irse
Assignment
What Do you understand by the term
florescence the forth
Alatrone
of
Carbon
2 Bxplain it's uses. as Mano tubules, Nano Structures,
Nano Chemist

Answers


Fluorescence is a phenomenon where a substance absorbs light at a specific wavelength and then emits light at a longer wavelength. This process occurs when an electron in a molecule or atom absorbs energy, becomes excited, and then returns to its ground state by releasing the absorbed energy as light.

Carbon is a versatile element that forms various allotropes such as graphite, diamond, and fullerenes. In the context of nanotechnology, carbon is used to create nanostructures like carbon nanotubes, graphene, and other related materials.

Carbon nanotubes (CNTs) are cylindrical nanostructures made up of carbon atoms, and they have extraordinary mechanical, electrical, and thermal properties. These properties make CNTs useful in various applications such as electronics, energy storage, and composite materials.

Graphene, another carbon nanostructure, is a single layer of carbon atoms arranged in a hexagonal lattice. It exhibits remarkable electronic, thermal, and mechanical properties. Graphene has potential applications in fields like electronics, sensors, and energy storage.

A nanochemist is a scientist who specializes in studying the synthesis, characterization, and applications of nanomaterials, including carbon-based nanostructures.

In summary, fluorescence is a light emission process that can be observed in certain substances, while carbon nanostructures like carbon nanotubes and graphene are materials with unique properties that have promising applications in nanotechnology.

For more questions on: phenomenon

https://brainly.com/question/23850381

#SPJ11  

K
Beaction
H₂SO4+Za=26804+H₂
of paper. Then complete the
for you.
Reactants
Reactants Products
Fes
Products

Answers

Answer:

jbfnuebufubdbybefydbybdruubedbusbubedbufyubrfybrfbyfrybburuefubfburbufbu

Explanation:

jbfwbyeybfybefbueujdhyevfbyrcybyebcybrcybybcrybeyfybrfybfrybrgyb

HELPPPP

A student dissolves 0.03450 mol of solid salt in 49.83 g of distilled water and observes the temperature of the water rise from 25.2˚C to a final temperature of 31.4˚C. If the calorimeter constant is 37.4 J/˚C, what is the calculated enthalpy of the reaction of the salt in units of kJ/mol? Explain how you would go about solving the problem and show all work for each step in your solution.

Answers

The heat of reaction for the dissolution of the salt can be obtained to be 335 kJ/mol.

What is the heat capacity?

Heat capacity is the amount of heat energy required to raise the temperature of a substance by a certain amount. More specifically, it is defined as the amount of heat energy required to raise the temperature of a substance by one degree Celsius or one Kelvin. The heat capacity is typically measured in units of joules per degree Celsius (J/°C) or joules per Kelvin (J/K).

We know that the heat that is absorbed can be obtained from;

H = mcdT

H = 49.83 g *  37.4 J/˚C * ( 31.4˚C - 25.2˚C)

H = 11.55 kJ

Then we have;

Hrxn = 11.55 kJ/ 0.03450 mol

= 335 kJ/mol

Learn more about heat capacity:https://brainly.com/question/28302909

#SPJ1

If a negatively charged object is brought near a neutrally charged sphere what will happen

Answers

Answer:

If a negatively charged object is brought near a neutral sphere, the electrons in the neutral sphere will move away from the negatively charged object, causing one side of the sphere to become slightly negative and the other side to become slightly positive.

Explanation:

This is because the negative charge repels the electrons in the neutral sphere, creating an imbalance of charges on the sphere.

I need the answer for number 2

Answers

Answer:

+ Triple covalent bond (CB) > double CB > single CB in terms of bond strength and energy needed to break the bonds

+ Triple bonds are the most reactive, double bonds are reactive but single bonds are unreactive

+ Single bond > double bond > triple bond in bond length

+ in single bond, 2 electrons are shared
+ in double bond, 4 electrons are shared
+ in triple bond, 6 electrons are shared

The CF4 molecule has a central C atom bonded to four F atoms, as shown in the figure. Which of the following statements about the CF4 molecule is or are true?
I. The electrons in the C-F bonds are attracted to both the C and F nuclei.
II. The Lewis structure of CF4 shows four bonding pairs of electrons and no nonbonding pairs.
III. Every atom in the CF4 molecule satisfies the octet rule.
A: I and III are true.
B: II and III are true.
C: Only one of the statements is true.
D: All three statements are true.
E: I and II are true.

Answers

The correct answer is B. The Lewis structure of CF4 indicates four bonding pairs of electrons and no nonbonding pairs. and Every atom in the CF4 molecule satisfies the octet rule.

Lewis structures are used to determine the molecular geometry and bonding patterns in molecules. It is named after Gilbert N. Lewis, who introduced the concept of the chemical bond and valence electrons. In a Lewis structure, each atom is represented by its chemical symbol, and its valence electrons are shown as dots or lines around the symbol. The dots represent electrons that are not involved in chemical bonding, while the lines represent covalent bonds between atoms.

Covalent bonds are formed by the sharing of electrons between atoms, and the number of electrons shared between atoms determines the strength of the bond. They also help in predicting the polarity and reactivity of molecules. For example, a molecule with a polar covalent bond will have a dipole moment and will be more reactive in chemical reactions. Overall, the Lewis structure is a fundamental tool in chemistry that allows us to understand the behavior of molecules and their interactions with other molecules.

To learn more about Lewis structure visit here:  

brainly.com/question/20300458

#SPJ4

At the equivalence point of a strong acid string base titration, all of the acid and base have reacted producing water and a salt

Answers

Yes, that is correct. At the equivalence point of a strong acid-strong base titration, all the acid and base have reacted completely to form water and a salt. The solution is neutral as the pH is 7. This is because the strong acid and strong base react completely in a 1:1 ratio to form the salt and water. The salt formed depends on the specific acid and base used in the reaction. For example, if hydrochloric acid (HCl) and sodium hydroxide (NaOH) are used, the salt formed would be sodium chloride (NaCl).

Without checking their boiling points, how would you expect Cl2’s boiling point to compare to Br2's? Explain.

Answers

Based on their molecular properties, I would expect that the boiling point of Cl2 would be lower than that of Br2.

How does the boiling points compare?

The boiling point of a substance is largely determined by the strength of the intermolecular forces between its molecules. In particular, substances with stronger intermolecular forces tend to have higher boiling points.

Both Cl2 and Br2 are halogens and exist as diatomic molecules. However, Br2 has more electrons than Cl2, and as a result, it has more electrons available for intermolecular interactions.

This means that Br2 molecules can form stronger London dispersion forces with each other than Cl2 molecules can. London dispersion forces are the weakest intermolecular force, but they still contribute to the overall strength of intermolecular attractions.

Learn more about boiling point:https://brainly.com/question/2153588

#SPJ1

Several weather variables are used to measure weather conditions. Identify 3 weather variables and their instruments that you would use to observe and collect data to determine the relationship between air mass movements and changes in weather.

Answers

The following are three weather variables and the tools that can be used to observe and gather data on them to ascertain how air mass movements and weather changes are related:

Temperature is a crucial factor in comprehending weather conditions and is measured using a thermometer.The quantity of water vapor in the air is known as humidity, and it is measured with a hygrometer. An anemometer and a wind vane are used to measure the speed and direction of the wind, respectively.

Temperature: For instance, a high temperature means the air is warm and light, and it will rise. Conversely, if the temperature is low, the air will sink since it is heavy and chilly.Air pressure: High-pressure regions are known for having calm, sunny skies, whereas low-pressure regions are known for having gloomy, stormy skies.Wind speed: The direction of the wind can be used to determine the nature and movement of an air mass. The air mass is traveling from the north to the south, for instance, if the wind is blowing from the north.

Scientists can discover patterns and connections between changes in weather and changes in air mass movement by observing and recording data on these meteorological variables.

learn more about weather conditions here

https://brainly.com/question/1034593

#SPJ1

look at the reaction and Ans

zinc carbonate+ sulfuric acid = zinc sulfate + carbon Dioxide + water

where did the hydrogen in water come from the reaction?

where did carbon from carbon dioxide come from?

Answers

In the given reaction:

zinc carbonate + sulfuric acid = zinc sulfate + carbon dioxide + water

The sulfuric acid was the source of the hydrogen in water. In the process, zinc carbonate (ZnCO3) and sulfuric acid (H2SO4) combine to create zinc sulfate (ZnSO4), carbon dioxide (CO2), and water. (H2O).

The carbon in zinc carbonate is what produces carbon dioxide (CO2). (ZnCO3). Zinc carbonate (ZnCO3) and sulfuric acid (H2SO4) interact during the process to produce zinc sulfate (ZnSO4), carbon dioxide (CO2), and water. (H2O).

The sulfuric solution is where water gets its hydrogen from. A substance called sulfuric acid is made up of the elements of hydrogen, sulfur, and oxygen.

Hydrogen ions (H+), which combine with the hydroxide ions (OH-) from the zinc carbonate to create water, are released into the solution when sulfuric acid reacts with zinc carbonate.

The carbon particle in the zinc carbonate molecule is where the carbon in carbon dioxide originates. Compounds containing zinc, carbon, and oxygen make up zinc carbonate. The carbon atom joins two oxygen atoms from the sulfuric acid during the reaction to create carbon dioxide. (CO2).

learn more about sulfuric acid here

https://brainly.com/question/10220770

#SPJ1

What is the molarity (M) of a bleach solution containing 9.50 grams of bleach (NaOCI) in 2,000 ml of solution? BLEACH

show work​

Answers

The molarity of the bleach solution is 0.0637 M.

Steps

To find the molarity (M) of the bleach solution, we first need to calculate the number of moles of NaOCl present in the given mass of bleach. We can use the formula:

moles = mass / molar mass

where the molar mass of NaOCl is 74.44 g/mol.

mass of NaOCl = 9.50 g

molar mass of NaOCl = 74.44 g/mol

moles of NaOCl = 9.50 g / 74.44 g/mol = 0.1274 mol

Next, we need to calculate the volume of the solution in liters, since molarity is defined as the number of moles of solute per liter of solution:

volume of solution = 2,000 ml = 2.000 L

Now we can calculate the molarity of the bleach solution:

Molarity = moles of NaOCl / volume of solution

= 0.1274 mol / 2.000 L

= 0.0637 M

Therefore, the molarity of the bleach solution is 0.0637 M.

learn more about molarity here

https://brainly.com/question/26873446

#SPJ1

Glutamic acid is an amino acid with pKa values of 2.19, 4.25 and 9.67, a-ketoglutarate is a bivalent organic acid. What is the approximate charge
difference between glutamic acid and a-ketoglutarate at pH 9.5?
a) 1 1/2
b) 2
c) 0
d) 1/2
e) 1

Answers

The approximate charge difference between glutamic acid and a-ketoglutarate at pH 9.5 would be 1. Option E.

Charge difference between 2 amino acids

At pH 9.5, the protonation state of glutamic acid and a-ketoglutarate can be determined as follows:

Glutamic acid: At pH 9.5, the carboxyl group (-COOH) will be deprotonated, and the amino group (-NH2) will be protonated, giving the species -COO-CH2-CH(NH3+)-COO-.

The side chain carboxyl group (-COOH) can also be deprotonated to a small extent, giving the species -COO-CH2-CH(NH3+)-COO- and -COO-CH2-CH(NH2)-COO-. At this pH, the predominant species will be the first one, since the pKa of the carboxyl group is 2.19, which means that it will be mostly deprotonated at pH 9.5.

a-ketoglutarate: At pH 9.5, both carboxyl groups (-COOH) will be deprotonated, giving the species -COO-CH2-CO-CH2-COO-.

Therefore, the charge difference between glutamic acid and a-ketoglutarate at pH 9.5 can be calculated by subtracting the number of positive charges (protonated amino group) and negative charges (deprotonated carboxyl groups) in a-ketoglutarate from the corresponding charges in glutamic acid:

Glutamic acid: -1 (protonated amino group) - 2 (deprotonated carboxyl groups) = -3

a-ketoglutarate: 0 (no protonated amino group) - 2 (deprotonated carboxyl groups) = -2

Therefore, the charge difference is: -3 - (-2) = -1

More on amino acids can be found here: https://brainly.com/question/15687833

#SPJ1

Which compound would undergo nucleophilic addition? A ethene, C₂H4 B bromoethane, C₂H,Br Cethanal, CH₂CHO D ethane, C₂H6​

Answers

Out of the given compounds, the one that would undergo nucleophilic addition is ethanal, CH₂CHO (option C).

What is nucleophilic addition?

Nucleophilic addition is a type of chemical reaction in which a nucleophile (an electron-rich species, such as a negatively charged ion or a molecule with a lone pair of electrons) attacks an electrophilic center (an electron-poor atom or group) and forms a new covalent bond.

In this type of reaction, the nucleophile donates a pair of electrons to the electrophilic center, resulting in the formation of a new bond and the creation of a new compound.

This process can occur in various types of molecules and functional groups, but is particularly common in compounds with polar double or triple bonds, such as alkenes and alkynes, or in compounds with polar functional groups, such as carbonyl groups (C=O) and imines (C=N).

Learn more about Nucleophilic addition here https://brainly.com/question/16033779

#SPJ1

10. For the reaction
2C(s)+N2(g)+5H2⇌2CH3NH2(g)
with K=1.8×10−6. If you begin the reaction with 1.0 mol of N2, 2.0 mol of H2, and sufficient C(s) in a 2.00 L container, what are the concentrations of N2 and CH3NH2 at equilibrium? What happens to K if the concentration of H2 is doubled?

Answers

Answer: The balanced chemical equation for the given reaction is:

2C(s) + N2(g) + 5H2(g) ⇌ 2CH3NH2(g)

The equilibrium constant expression for the reaction is:

Kc = [CH3NH2]^2/([N2][H2]^5)

At the beginning of the reaction, the concentration of N2 is 1.0 mol/2.00 L = 0.50 M and the concentration of H2 is 2.0 mol/2.00 L = 1.0 M. The concentration of C(s) is not given, but it is assumed to be large enough that its concentration does not change significantly during the reaction. Let the concentration of CH3NH2 at equilibrium be x mol/L. Then, according to the stoichiometry of the reaction, the equilibrium concentrations of N2 and H2 are (0.50 - x) mol/L and (1.0 - 5x) mol/L, respectively.

Substituting these values into the equilibrium constant expression and solving for x, we get:

Kc = [CH3NH2]^2/([N2][H2]^5)

1.8×10−6 = x^2/[(0.50 - x)(1.0 - 5x)^5]

1.8×10−6 (0.50 - x)(1.0 - 5x)^5 = x^2

1.8×10−6 (0.50 - x)(1 - 5x)^5 = x^2

This is a cubic equation that can be solved numerically to find the value of x, which represents the equilibrium concentration of CH3NH2. Using a numerical solver, we find that x = 5.42×10^-4 M. Therefore, the equilibrium concentrations of N2 and CH3NH2 are 0.50 - x = 0.499 M and x = 5.42×10^-4 M, respectively.

If the concentration of H2 is doubled, its concentration at equilibrium becomes 2.0 M - 5x. Substituting this new value into the equilibrium constant expression, we get:

K'c = [CH3NH2]^2/([N2][H2]^5)

K'c = (x^2)/[(0.50 - x)(2.0 - 5x)^5]

The value of K'c is different from Kc because it depends on the new concentration of H2. To find the ratio of K'c to Kc, we can divide the two expressions:

K'c/Kc = [(x^2)/[(0.50 - x)(2.0 - 5x)^5]] / [(x^2)/[(0.50 - x)(1.0 - 5x)^5]]

K'c/Kc = [(2.0 - 5x)^5]/[(1.0 - 5x)^5]

Substituting x = 5.42×10^-4, we get:

K'c/Kc = [(2.0 - 5(5.42×10^-4))^5]/[(1.0 - 5(5.42×10^-4))^5]

K'c/Kc = 1.31

Therefore, if the concentration of H2 is doubled, the equilibrium constant Kc increases by a factor of 1.31.

50 points
Which type of process is this.
Chemical Process
Physical Process
Nuclear Process ​

Answers

Explanation:

That's Nucleus process

At standard temperature and pressure, a given sample of water vapor occupies a volume of 2.80 L. What is the weight of the water?

Answers

Explanation:

The weight of water vapor can be determined by using the ideal gas law, which relates the pressure, volume, and temperature of a gas to the number of moles of gas present. We can then use the molar mass of water to calculate the weight of the water vapor.

At standard temperature and pressure (STP), the pressure is 1 atm and the temperature is 273.15 K. The ideal gas law is expressed as:

PV = nRT

where P is the pressure in atmospheres, V is the volume in liters, n is the number of moles, R is the gas constant (0.08206 L·atm/mol·K), and T is the temperature in Kelvin.

Rearranging this equation to solve for n, we have:

n = PV/RT

Substituting the values we know, we get:

n = (1 atm)(2.80 L) / (0.08206 L·atm/mol·K)(273.15 K)

n = 0.1082 mol

The molar mass of water is 18.01528 g/mol, so the weight of the water vapor is:

weight = n x molar mass

weight = 0.1082 mol x 18.01528 g/mol

weight = 1.952 g

Therefore, the weight of the water vapor is 1.952 g.

How many grams are there in 5.47 x 1021 molecules of SO2?

O.33 grams of SO2
O.58 grams of SO2
O.72 grams of SO₂
O.49 grams of SO₂

Answers

Answer:

The correct answer is option (B) 0.58 grams of SO2.

An object can be moving at a constant speed and still accelerating if it is changing 6.______

Answers

If an object is changing directions, it can be moving at a constant speed while yet accelerating.

This is due to the fact that acceleration is a vector number that takes into consideration the speed of an object both in magnitude and direction.

Steps

An object's acceleration vector also changes as it changes direction, which causes the object's velocity vector to change.

As a result, even though the item is moving at a constant speed, the change in its velocity vector is causing it to accelerate.

Centripetal acceleration is the term for the type of acceleration that keeps objects moving in a circular motion.

Even though an object's speed is constant while it moves in a circular pattern, it is still accelerating.

This is due to the fact that acceleration is a vector number that takes into consideration the speed of an object both in magnitude and direction.

As an item follows a circular course, its acceleration vector also constantly changes direction along with its velocity vector.

learn more about constant speed here

https://brainly.com/question/2681210

#SPJ1

B) Dilution Problems. Calculate the concentration of a) each solute and b) each ion when the following are mixed.
50.0 mL of 0.750 M KOH and 25.0 mL of 0.500 M KOH

Answers

a. The final concentration of KOH is 0.500 M.

b. The concentration of K+ and OH- ions is 0.500 M.

Step by step explanation

To solve this problem, we need to use the equation:

M1V1 = M2V2

where M1 is the initial concentration of the solution, V1 is the initial volume of the solution, M2 is the final concentration of the solution, and V2 is the final volume of the solution.

a) To find the concentration of each solute, we need to first determine the final volume of the solution:

Final volume = 50.0 mL + 25.0 mL = 75.0 mL

Now we can use the equation above to find the final concentration of KOH:

M1V1 = M2V2

(0.750 M)(50.0 mL) = M2(75.0 mL)

M2 = (0.750 M)(50.0 mL) / (75.0 mL)

M2 = 0.500 M

Therefore, the final concentration of KOH is 0.500 M.

b) To find the concentration of each ion, we need to use the final concentration of KOH and the fact that KOH dissociates into K+ and OH- ions in solution. The concentration of K+ and OH- ions will be the same as the final concentration of KOH:

[ K+ ] = 0.500 M

[ OH- ] = 0.500 M

Therefore, the concentration of K+ and OH- ions is 0.500 M.

Learn more about ionic concentration here https://brainly.com/question/27586088

#SPJ1

The pOH of a solution is 8.3. Which of the following is true about the solution?

a
It is acidic and has a pH of 5.7.

b
It is acidic and has a pH of 3.8.

c
It is basic and has a pH of 5.7.

d
It is basic and has a pH of 3.8.

Answers

An answer has a pOH of 8.3. True about the solution is that it is basic and has a pH of 5.7.

What does "solution" mean in its simplest form?

When one or more solutes are dissolved in a solvent, the result is a homogenous mixture known as a solution. a solvent is a substance that helps a solute dissolve so that a homogenous mixture results. When a substance dissolves in a solvent, it forms a homogenous mixture, which is known as a solute.

Why is a solution important in chemistry?

A continuous variation in the relative proportions of a number of substances that is homogeneous and can be changed up to the solubility limit. Although the word "solution" is typically used to describe the liquids state of a substance, it is also possible for gases and solids to form solutions.

To know more about Solution visit:

https://brainly.com/question/30665317

#SPJ1

The correct answer is that it is acidic and has a pH of 5.7.

C2H6O + 3 O2 → 2 CO2 + 3 H2O
How many moles of CO2 is produced with 8.5 g of O2
0.32 mol
5.7 mol
0.53 mol
0.18 mol

Answers

The number of moles of CO₂ produced from the reaction of 8.5 g of oxygen gas, O₂ is 0.18 mole (last option)

How do i determine the number of mole of CO₂ produced?

We shall begin by obtaining the mole in 8.5 g of oxygen gas, O₂. Details below:

Mass of oxygen gas, O₂ = 8.5 grams Molar mass of oxygen gas, O₂ = 32 g/mol Mole of oxygen gas, O₂ =?

Mole = mass / molar mass

Mole of oxygen gas, O₂ = 8.5 / 32

Mole of oxygen gas, O₂ = 0.266 mole

Finally, we shall determine the number of mole of CO₂ produced. Details below:

C₂H₆O + 3O₂ -> 2CO₂ + 3H₂O

From the balanced equation above,

3 moles of O₂ reacted to produce 2 moles of CO₂

Therefore,

0.266 mole of O₂ will react to produce = (0.266 × 2) / 3 = 0.18 mole of CO₂

Thus, the number of mole of CO₂ produced is 0.18 mole (last option)

Learn more about number of mole:

https://brainly.com/question/13375719

#SPJ1

WORTH 100 POINTS, ANSWER ALL PARTS

INFO. An unknown compound containing tellurium and bromine is analyzed and it is determined that 28.53% of the compound by mass is composed of tellurium.

Part A. What quantity in moles of Te are present in 100.00 g of the compound?
Part B. What is the mass percent of Br in the compound?
Part C. What quantity in moles of Br are present in 100.00 g of the compound?
Part D. Determine the empirical formula of the unknown compound.
Part E. Provide the correct IUPAC name of the unknown compound.

Answers

PART A - 0.2236 mol Te
PART B - 71.47% Br
PART C - 0.8945 mol Br
PART D - TeBr4
PART E - tellurium tetrabromide
Other Questions
the role of defense lawyers is to a. decide their clients' guilt or innocence. b. mislead the court by providing false information if necessary, to obtain a finding of not guilty. c. use perjured testimony to ensure their clients are found not guilty. d. provide the best possible legal counsel and advocacy within the legal and ethical limits of the profession. I need to know how to graph this Please write a paragraph of why Andrew Jackson would be portrayed in this manner. the following annual costs are associated with three new extruder machines being considered for use in a styrofoam cup plant: data x x-trud supr-x useful life, years 7 17 13 first cost $2,980,000 $2,870,000 $2,360,000 salvage value $95,000 $121,000 $92,000 annual benefit $226,000 $640,000 $748,000 m&o $75,000 $70,000 $57,000 m&o gradient $13,000 $12,500 $13,500 the company's interest rate (marr) is 7%. which extruder should the styrofoam company choose? use annual cash flow analysis and provide the right reason. group of answer choices choosing supr-x will maximize the euab-euac; its value is $771,283 higher than x and $144,991 higher than x-trud. choosing supr-x will maximize the euab-euac; its value is $231,283 higher than x and $23,991 higher than x-trud. choosing supr-x is best because it has the highest annual benefit choosing supr-x is best because it has the lowest m&o cost in yr1 Using the definition of the speed of light (299,792,458), if light has a wavelength of 7E-7m, what is it's frequency? how is potential energy a scalar quantity even though it can be negative? 24 divide by 6 please just get an answer Describe the conservation of mechanical energy of a 5.0 kg stone perched near the edge of cliff 25.0 m high which falls down to the ground below. Determine the velocity of the stone just before it hits the ground. Use the base of the cliff as a reference point, and write down all assumptions made.NEED ASAP PLS Desmon and Garrett are running a marathon. Desmon raised $3,654 and Garrett raised $2,765. Jesse and Mikayla are running the same marathon. Jesse raised $4,876 and Mikayla raised $2,874. How much more money did Jesse and Mikayla raise than Garrett and Desmon? what causes high insurance charges in international trade how was germany able to experience a period of prosperity between 1924 and 1929? for a company with a related diversification strategy, the most appropriate is a functional organizational structure. group of answer choices true false which of the following can be a reason for a favorable price variance for direct materials? group of answer choices less amount of material used during production than planned for actual output an unexpected increase in the price of materials workers taking less time to produce the products than was expected a decrease in the price of materials due to an oversupply of materials as production increases, the gap between atc and avc: group of answer choices increases. is proportional to mc. diminishes. remains constant. Determine the coordinates of the image if triangle ABC is translated 6 units to the right.A(-2, 1), B(6, 1), C(2, 5)A(-2, 1), B(-6, 1), C'(-10, 5)A'(-6, 7), B'(0,7), C'(-4, 11)A'(-6, -5), B'(0, -5), C'(-4,-1) factor out -1/2 from -1/2(x-0)^2+x+4=0 Use the poem Giles at 14 to complete the activity. n one to two sentences, analyze how the poets word choice shows the speakers feelings about Giles the cat. Given triangle ABC with ordered pairs:A - (1, -3)B - (3, 0)C - (4, -2)Rotate ABC 180 degrees about the origin and then reflect it over the y-axis. Determine the points of A', B', and C'. what does the following inferences is best supported by the passage below -4 to 11? Mother start sewing as a factory where the coin begins repair in cars. The rest of us must go to school repeating the last grade left unfinished Bob Marley used Sly and Robbie for a rhythm section. Peter Tosh recorded with Sly and Robbie on at least one of his records. (Begin the second sentence with a transition word that shows comparison and contrast