Calculate the Kelvin temperature to which 21.0 L of a gas at 34°C would have to be heated to change the volume to 41.0 L. The pressure and number of particles remain constant.

Answers

Answer 1

In order to convert the volume from 21.0 L to 41.0 L while maintaining the same pressure and particle number, the gas would need to be heated to a temperature of 580.49 K.

When the amount of moles and pressure are both constant?

According to Boyle's law, the pressure and volume of a gas follow an inverse relationship when the gas's temperature and molecular composition are both constant.

This problem can be solved using the coupled gas law, which connects a gas's pressure, volume, and temperature:

(P1 V1) / T1 = (P2 V2) / T2

In this problem, we are given P1 = P2, V1 = 21.0 L, V2 = 41.0 L, and            T1 = 34°C. We want to find T2 in Kelvin.

First, we need to convert T1 from Celsius to Kelvin:

T1 = 34°C + 273.15

T1 = 307.15 K

Next, we can rearrange the combined gas law to solve for T2:

T2 = (P2 V2 T1) / (P1 V1)

Substituting the given values, we get:

T2 = (1 atm * 41.0 L * 307.15 K) / (1 atm * 21.0 L)

T2 = 580.49 K

To know more about gas law visit:-

https://brainly.com/question/24519415

#SPJ1


Related Questions

If electrons jump from a lower energy shell to a higher energy shell, they are said to be ____

Answers

Answer:

they are said to be excited.

Explanation:

excitation is a fundamental concept in atomic physics that helps explain many of the properties and behaviors of matter on both the macroscopic and microscopic scales.

ASAP PLEASE!!!
1. Claim: How are elements arranged on the periodic table in terms of valence
electrons? (2 points)
2. Evidence: Use the Element symbol provided to create a Bohr/ Orbital Model for
each. Use the PhET simulation to work through each. Complete the table below.
Include a picture of each that you either snip from the simulation or draw. We

Answers

The periodic table is arranged in such a way that elements with similar valence electron configurations are placed in the same group or column.

How are elements arranged on the periodic table in terms of valence?

Valence electrons are the outermost electrons in an atom, and they play a critical role in determining the chemical properties of an element.

The elements in each column of the periodic table have the same number of valence electrons, which gives them similar chemical properties

Learn more about valence:https://brainly.com/question/12744547

#SPJ1

It took 4.5 minutes for 1.0 L helium to effuse through a porous
barrier. How long will it take for 1.0 L Cl 2 gas to effuse under
identical conditions?

Answers

It took 19 minutes for 1.0L Cl₂ gas to effuse under identical conditions.

How to calculate the time required to effuse a gas under identical conditions?

1.0 L He = 4.5 min

1.0 L Cl₂ = x min

1.0 L He = 4.5 min = 0.22[tex]\frac{L}{min}[/tex]

Now, find the rate of Cl₂ using the molar mass of Cl₂ divided by the molar mass of He:   [tex]\frac{0.22}{xCl2}[/tex]   = 0.52 [tex]\frac{L}{min}[/tex]

Now, we need to solve for the time Cl₂ to effuse through a porous barrier, by setting it up as a proportion;

[tex]\frac{0.52L}{1 min}[/tex]   =  [tex]\frac{1.0L}{x min}[/tex]

   = 19 minutes.

Hence, It tooks 19 minutes for 1.0L Cl₂ gas to effuse under identical conditions.

Learn more about gas here:

https://brainly.com/question/3637358

#SPJ1

how many moles of helium gas are present in a 11.2l container at 298k and 1.35 atm the gas constant r =0.0821 atm/k mol

Answers

Answer

The first step is to use the ideal gas law equation: PV = nRT, where P is the pressure, V is the volume, n is the number of moles, R is the gas constant, and T is the temperature.

Rearranging the equation to solve for n, we get:

n = PV/RT

Substituting the given values, we get:

n = (1.35 atm) x (11.2 L) / [(0.0821 atm·L/mol·K) x (298 K)]

n = 0.553 mol

Therefore, there are 0.553 moles of helium gas present in the 11.2L container at 298K and 1.35 atm.

Explain which direction the molecules will move during diffusion.

Answers

Answer: During diffusion, molecules flow down their concentration gradient.

Explanation:

They're flowing from an area of high concentration to an area of low concentration. Molecules flowing down a concentration gradient is a natural process and does not require energy.

Given the thermochemical equations

X2+3Y2⟶2XY3Δ1=−370 kJ

X2+2Z2⟶2XZ2Δ2=−130 kJ

2Y2+Z2⟶2Y2ZΔ3=−220 kJ

Calculate the change in enthalpy for the reaction.

4XY3+7Z2⟶6Y2Z+4XZ2

Answers

The change in enthalpy for the given reaction is +330 kJ.

To calculate the change in enthalpy for the reaction:

4XY3 + 7Z2 ⟶ 6Y2Z + 4XZ2

we need to use the Hess's Law, which states that if a chemical reaction can be expressed as the sum of several stepwise reactions, the enthalpy change of the overall reaction is equal to the sum of the enthalpy changes of the individual reactions.

We can write the reaction in terms of the given thermochemical equations as follows:

4XY3 ⟶ 2X2 + 6Y2 (reverse of equation 1, with ΔH = +370 kJ)

2X2 + 4XZ2 ⟶ 8XY3 (multiply equation 2 by 2, with ΔH = -2×130 kJ = -260 kJ)

2Y2 + Z2 ⟶ 2Y2Z (reverse of equation 3, with ΔH = +220 kJ)

Adding these three equations gives:

4XY3 + 7Z2 ⟶ 6Y2Z + 4XZ2 (with ΔH = 370 kJ - 260 kJ + 220 kJ = +330 kJ).

Learn more about enthalpy here:

https://brainly.com/question/3393755

#SPJ1

Kelly wants to build a small koi fish pond in her back yard what natural material should she pine her pond with to make sure that no water leaks out the pond through gravitational water flow

Answers

Kelly should line her koi fish pond with clay to ensure that no water leaks out through gravitational water flow.

Building a koi fish pond

Clay is a natural material that is used widely in pond and water feature construction. It has excellent water-holding properties and is able to form a waterproof seal when properly installed. Clay liners can be formed using either bentonite clay or kaolin clay, both of which are readily available and relatively inexpensive.

When installing a clay liner, it is important to prepare the pond base by removing any sharp or protruding objects, compacting the soil, and smoothing out any irregularities. The clay liner can then be laid down in layers and compacted to ensure a uniform thickness and a solid seal.

Overall, using a clay liner is an effective way to prevent water from leaking out of a koi fish pond and to maintain a healthy environment for the fish.

More on fish ponds can be found here: https://brainly.com/question/29276248

#SPJ1

A sample of helium occupies a volume of 160cm3 at 100 KPa and 25°c. what volume will it occupy if the pressure is adjusted to 80 KPa and the temperature remains unchanged?​

Answers

Answer:

Explanation:Explore this page

About the gas laws calculator

This is an ideal gas law calculator which incorporates the Boyle's law , Charles's law, Avogadro's law and Gay Lussac's law into one easy to use tool you can use as a:

Boyle's Law-

[tex]\:\:\:\:\:\:\:\:\:\:\:\star\:\sf \underline{ P_1 \: V_1=P_2 \: V_2}\\[/tex]

(Pressure is inversely proportional to the volume)

Where-

[tex]\sf V_1[/tex] = Initial volume[tex]\sf V_2[/tex] = Final volume[tex]\sf P_1[/tex] = Initial pressure[tex]\sf P_2[/tex] = Final pressure

As per question, we are given that -

[tex]\sf V_1[/tex] = 160 cm³[tex]\sf P_1[/tex] = 100KPa[tex]\sf P_2[/tex] = 80KPa

Now that we have all the required values and we are asked to find out that volume which will be occupied if the pressure is adjusted to 80 KPa and the temperature remains unchanged. For that we can put the values and solve for the final volume of helium-

[tex]\:\:\:\:\:\:\:\:\:\:\:\:\:\:\:\star\:\sf \underline{ P_1 \: V_1=P_2 \: V_2}[/tex]

[tex]\:\:\:\: \:\:\:\:\:\:\longrightarrow \sf 100 \times 160 = 80 \times V_2\\[/tex]

[tex] \:\:\:\:\:\:\:\:\:\:\longrightarrow \sf V_2 = \dfrac{100 \times 160}{80}\\[/tex]

[tex] \:\:\:\:\:\:\:\:\:\:\longrightarrow \sf V_2 =100\times \cancel{\dfrac{ 160}{80}}\\[/tex]

[tex]\:\:\:\: \:\:\:\:\:\:\longrightarrow \sf V_2 = 100 \times 2\\[/tex]

[tex] \:\:\:\:\:\:\:\:\:\:\longrightarrow \sf \underline{V_2 = 200 \:cm^3 }\\[/tex]

Therefore, 200 cm³ will be occupied if the pressure is adjusted to 80 KPa and the temperature remains unchanged.

What are the carbohydrates’ that give positive result with Seliwanoff ? why?

Answers

Answer:

Fructose and sucrose

Explanation:

Sucrose gives a positive test as it is a disaccharide consorting of fructose and glucose

What is the normality of the solution that results when 4.0g of Al(NO3)3 (MW = 213.0) is dissolved in enough water to give 250mL of solution? What is the molarity of the solution?

Answers

the normality of the solution that results when 4.0g of Al(NO₃)₃ (MW = 213.0) is dissolved in enough water to give 250mL of solution the molarity of the solution is 0.0751 M.

To calculate the normality and molarity of the solution, we need to know the number of moles of Al(NO₃)₃ in the solution.

The number of moles can be calculated as:

moles = mass / molar mass

where mass is the mass of Al(NO₃)₃ and molar mass is the molecular weight of Al(NO₃)₃.

Substituting the given values, we get:

moles = 4.0 g / 213.0 g/mol = 0.01878 mol

The volume of the solution is given as 250 mL, which is equivalent to 0.25 L.

The normality of the solution is defined as the number of equivalents of solute per liter of solution. For Al(NO₃)₃, each mole of the compound produces 3 moles of ions, so the number of equivalents of Al(NO₃)₃ is:

equivalents = moles x 3

Substituting the value of moles, we get:

equivalents = 0.01878 mol x 3 = 0.05634 eq

The normality can now be calculated as:

normality = equivalents / volume

Substituting the given values, we get:

normality = 0.05634 eq / 0.25 L = 0.225 N

Therefore, the normality of the solution is 0.225 N.

The molarity of the solution is defined as the number of moles of solute per liter of solution. The number of moles of Al(NO₃)₃ in 250 mL of solution is the same as the number of moles in 1 L of solution, which is 0.01878 mol. Therefore, the molarity of the solution is:

molarity = moles / volume

Substituting the given values, we get:

molarity = 0.01878 mol / 0.25 L = 0.0751 M

Learn more about solution here:

https://brainly.com/question/30665317

#SPJ1

According to Beers Law, A-&bc; what should the slope and the intercept be in calibration curve for 'plot

Answers

If the route length is constant, the intercept of the calibration curve should be zero, and the slope should be proportional to the molar absorptivity times the path length.

What is the calibration graph for Beer's law's slope?

Beer's law, which links absorbance to concentration, is represented by a linear function. The molar attenuation coefficient multiplied by the cuvette width, or pathlength—1 centimetre in this lab—gives you the slope of your calibration curve. To find the concentration, rearrange the linear solution.

According to Beer's Law, a solution's absorbance (A) is inversely proportionate to its concentration.

A = εcl

The molar absorptivity () times the route length (l) are represented by the calibration curve's slope (m):

m = εl

If the route length is constant, the calibration curve's intercept (b) should be zero because there shouldn't be any absorbance at zero concentration:

b = 0

To know more about calibration curve visit:-

https://brainly.com/question/29729322

#SPJ9

Can you explain in detail how anion exchage occur in soil.

Answers

Answer:

With the adsorption of cations like zinc as Zn (OH)+ or ZnCl+ or both, the anion exchange is known to increase. The solid phase has an impact on the anions' concentration in the soil solution. Anions are negatively adsorbed as a result of the exchange complex's overall negative charge.

Under certain conditions the decomposition of ammonia on a metal surface gives the following data.

[NH3] (M) 3.0 ✕ 10−3 6.0 ✕ 10−3 9.0 ✕ 10−3

Rate (mol/L/h) 1.5 ✕ 10−6 1.5 ✕ 10−6 1.5 ✕ 10−6

(a)

Determine the rate equation for this reaction. (Rate expressions take the general form: rate = k . [A]a . [B]b.)
(b)
Determine the rate constant (in mol/L/h) using data from the first column.
WebAssign will check your answer for the correct number of significant figures.
mol/L/h
(c)
Determine the overall order for this reaction.

Answers

The given ammonia decomposition reaction on a metal surface is zero-order with respect to ammonia. The rate constant is [tex]1.5 × 10^-6[/tex] mol/L/h and the overall reaction order is zero.

(a) Since the rate remains constant while the concentration of ammonia changes, we can conclude that the reaction is zero-order with respect to ammonia. Therefore, the rate equation is:

rate = [tex]k[NH3]^0[/tex] = k

(b) Using data from the first column, we have:

rate = [tex]k[NH3]^0[/tex]

[tex]1.5 × 10^-6 mol/L/h = k(3.0 × 10^-3 M)^0[/tex]

k =[tex]1.5 × 10^-6[/tex] mol/L/h

(c) The overall order of the reaction is the sum of the orders with respect to each reactant. Since the reaction is zero-order with respect to ammonia, the overall order is zero.

Learn more about ammonia here:

https://brainly.com/question/14672082

#SPJ1


How many grams of hydrogen chloride can be produced from 0.490 g of hydrogen and 50.0 g chlorine? The balanced equation is:
H₂(g) + Cl₂(g) → 2 HCI(g)


Answers

Hydrogen is the limiting reactant and chlorine is in excess since there is less hydrogen chloride that can be made from it (4.56 g) than there is chlorine (51.7 g) that can. As a result, 4.56 g of hydrogen chloride can be generated.

From 0.490 g of hydrogen and 50.0 g of chlorine, how many grams of hydrogen chloride may be produced?

Let's first determine how much hydrogen chloride can be made from 0.490 g of hydrogen. We'll convert from moles of hydrogen to moles of hydrogen chloride using the balanced chemical equation:

1 mole of H2 yields 2 moles of HCl.

4.56 g HCl is equal to 0.490 g H2 times (1 mole H2 / 2.016 g H2), 2 moles HCl to 1 mole H2, and 36.46 g HCl to 1 mole H2.

The result is that 4.56 g of hydrogen chloride may be made from 0.490 g of hydrogen.

Let's now determine how much hydrogen chloride 50 g of chlorine can yield:

Cl2 creates 2 moles of HCl from 1 mole.

50.0 g Cl2 multiplied by (1 mole Cl2/70.90 g Cl2), (2 moles HCl/Mole Cl2), and (36.46 g/Mole Cl2) results in 51.7 g HCl.

The result is that 50.0 g of chlorine can make 51.7 g of hydrogen chloride.

To know more about chlorine gas visit:

https://brainly.com/question/29577369

#SPJ1

Which of these prostheses is used to support blood flow through an artery?
OA. A nanotube
OB. A passive prosthesis
OC. A stent
OD. A pacemaker

Answers

C: A Stent

It support the artery walls

I NEED THIS DONE TODAY !!!!!!!!Electromagnetic Spectrum Lab Report
Destructions: In this virtual lab, you will use a virtual spectrometer to analyze astronomical
bodies in space. Record your hypothesis and spectrometric recular in the lab report below. You
will submit your completed report to your butructor.
Name and Title:
Include your name, instru
1
and name of lab.
Objectives (1):
In your own words, what is the purpose of this lab?
Hypothesis:
In this section, please include the predictions you developed during your lab activity. These
statements reflect your predicted outcomes for the experiment.
Procedure:
The materials and procedures are listed in your virtual lab. You do not need to repeat them here.
However, you should note if you experienced any errors or other factors that might affect your
outcome. Using your summary questions at the end of your virtual lab activity, please clearly
define the dependent and independent variables of the experiment.
Data:
Record the elements present in each unknown astronomical object. Be sure to indicate "yes" or
"no" for each element.
Hydrogen Helium Lithium Sodiam Carbon
Moon One
Moon Two
Planet One
Planet Two
Nitrogen
Conclusion:
Your conclusion will inchade a summary of the lab results and an interpretation of the results.
Please answer all questions in complete sentences using your own words.
1. Using two to three sentences, summarize what you investigated and observed in this lab
2. Astronomers use a wide variety of technology to explore space and the electromagnetic
spectrum; why do you believe it is essential to use many types of equipment when
studying space?
3. If carbon was the most common element found in the moons and planets, what element is
missing that would make them splat to Earth? Explain why. (Hint: Think about the
carbon cycle)
4.
We know that the electromagnetic spectrum uses wavelengths and frequencies to
determine a lot about outer space. How does it help us find out the make-up of stars?
5. Why might it be useful to determine the elements that a planet or moon is made up of?
PLEASE MAKE SURE YOU ANSWER THE HYPOTHESIS AND PROCEDURE QUESTION!!!!

Answers

Below contains the complete lab report on electromagnetic spectrum

The Lab Report

Name: [Your Name]

Title: Electromagnetic Spectrum Lab Report

Instructor: [Instructor's Name]

Objectives:

The purpose of this lab is to analyze the elemental composition of different astronomical bodies using a virtual spectrometer and understand the importance of the electromagnetic spectrum in astronomical research.

Hypothesis:

I predict that the moons and planets will have varying compositions of elements, with hydrogen and helium being more common in gaseous bodies and heavier elements like carbon and nitrogen more common in rocky bodies.

Dependent variable: Presence of elements in astronomical bodies

Independent variable: Astronomical bodies (Moon One, Moon Two, Planet One, Planet Two)

Data:

[Please input your data for each object as per your virtual lab results]

Conclusion:

In this lab, I investigated the elemental composition of four different astronomical bodies using a virtual spectrometer and observed the presence or absence of various elements.

It is essential to use many types of equipment when studying space because different instruments can detect and analyze different aspects of the electromagnetic spectrum, providing a comprehensive understanding of the universe.

To make these moons and planets similar to Earth, oxygen would need to be present as it is a vital component of the carbon cycle and essential for life as we know it.

The electromagnetic spectrum helps us find out the makeup of stars by analyzing the emitted light, which contains information about the elements and their abundance within the star.

Determining the elements that a planet or moon is made up of helps us understand their formation, potential for life, and possible resources for future exploration or colonization.

Read more about Electromagnetic Spectrum Lab Report here:

https://brainly.com/question/30699255

#SPJ1

Why do sex-linked traits follow different patterns of inheritance than other
traits?

Answers

Answer: Sex-linked traits are different from other traits because they are located on the sex chromosomes. Since males and females have different numbers of these chromosomes, the inheritance of sex-linked traits is different between the two sexes. This means that certain traits are more likely to be expressed in males than in females, and that females can inherit these traits from both parents while males can only inherit them from their mother.

Explanation: Sex-linked traits follow different patterns of inheritance than other traits because they are located on the sex chromosomes (X and Y) rather than on the autosomes (non-sex chromosomes). Since males have one X and one Y chromosome, and females have two X chromosomes, the inheritance of sex-linked traits is affected by the sex of the individual and the number of copies of the gene present.

The X chromosome contains many more genes than the Y chromosome and therefore, most sex-linked traits are inherited in a dominant or recessive manner on the X chromosome. In females, the presence of two copies of the X chromosome allows for a greater range of genetic variability, as both copies can potentially express different alleles. In males, however, the presence of only one X chromosome means that any alleles on that chromosome will be expressed, regardless of whether they are dominant or recessive. This is why sex-linked traits are more commonly expressed in males than in females.

Additionally, since males only inherit one X chromosome from their mother, they can only inherit X-linked traits from her. Females, on the other hand, inherit one X chromosome from each parent, which means they can inherit X-linked traits from both their mother and father. This can affect the frequency and distribution of certain sex-linked traits in a population.

Overall, the unique inheritance patterns of sex-linked traits are a consequence of their location on the sex chromosomes and the differences in chromosome inheritance between males and females.

Gallium is a solid metal at room temperature but melts at 29.9 °C. If you hold gallium in your hand, it melts from body heat. How much heat must 2.5 g of gallium absorb from your hand to raise its temperature from 25.0 °C to 29.9 °C? The specific heat capacity of gallium is 0.372 J/g

Answers

In order for 2.5 g of gallium to transform from a solid state at 25.0 °C to a liquid state at 29.9 °C, it would require absorbing 19.56 J of heat from your hand.

Why is gallium utilised in high temperature applications?

Only gallium has a low melting point of 29.7°C and a high boiling point of 1500–2000°C. Together with these peculiar characteristics, it also exhibits undercooling (20 °C or below), which would make it a perfect thermometric liquid if not for its propensity to wet quartz and glass surfaces.

Q1 = m × c × ΔT

Q1 = 2.5 g × 0.372 J/g·°C × (29.9 °C - 25.0 °C)

Q1 = 5.58 J

Q2 = m × ΔH_fusion

Q2 = 2.5 g × 5.59 J/g

Q2 = 13.98 J

Q_total = Q1 + Q2

Q_total = 5.58 J + 13.98 J

Q_total = 19.56 J

To know more about solid state  visit:-

https://brainly.com/question/29488795

#SPJ1

A 0.231 M solution of acetate has a pOH of 4.90. What is the Kb of acetate?

Answers

Explanation:

o solve this problem, we need to use the relation between pOH, pH, and the dissociation constant of the conjugate base of the weak acid, which is given by:

Kb = Kw / Ka

where Kb is the dissociation constant of the conjugate base, Ka is the dissociation constant of the weak acid, and Kw is the ion product constant of water, which is 1.0 x 10^-14 at 25°C.

First, we need to find the pH of the solution, since we know the pOH:

pH + pOH = 14

pH = 14 - 4.90 = 9.10

The weak acid in this case is the acetic acid (CH3COOH), which dissociates in water according to the equation:

CH3COOH + H2O ↔ CH3COO- + H3O+

The dissociation constant of acetic acid (Ka) is 1.8 x 10^-5 at 25°C. We can use this value and the relation between Ka and Kb to find Kb:

Kb = Kw / Ka = 1.0 x 10^-14 / 1.8 x 10^-5 = 5.56 x 10^-10

Therefore, the Kb of acetate is 5.56 x 10^-10.

Question 1
Imagine yourself in the shoes of Dimitri Mendeleev. You are provided with two sets of cards that list properties of various
elements. These cards resemble the cards used by Mendeleev when he grouped elements. One set of cards lists the names
of known elements and their properties, while the other set of cards lists the properties of a few unknown elements. These
sets are shown below.
Known Elements Set
K
Physical State: solid
Density: 0.86 g/cm³
Conductivity: good
Physical State: solid
Density: 4.93 g/cm³
Conductivity: very poor
Solubility (H₂O): reacts rapidly Solubility (H₂O): negligible
Melting Point: 63°C
Melting Point: 113.5°C
Ge
Physical State: solid
Density: 5.32 g/cm³
Conductivity: fair
Solubility (H₂O): none
Melting Point: 937°C
CI
Ba
Physical State: solid
Density: 3.6 g/cm³
Conductivity: good
Au
Rb
Physical State: solid
Density: 19.3 g/cm³
Conductivity: excellent
Solubility (H₂O): None
Melting Point: 1064°℃
Physical State: gas
Density: 0.00178 g/cm³
Conductivity: none
Solubility (H₂O): reacts strongly Solubility (H₂O): negligible
Melting Point: 710°C
Melting Point: -189.2°C
Ag
Ar
A

Answers

Unknown Elements Set
Element X
Physical State: solid
Density: 7.2 g/cm³
Conductivity: very poor
Solubility (H₂O): insoluble
Melting Point: 182°C
Element Y
Physical State: gas
Density: 0.0012 g/cm³
Conductivity: good
Solubility (H₂O): reacts vigorously
Melting Point: -218.79°C

As Dimitri Mendeleev, I would first examine the known elements set of cards and try to identify any patterns or trends in the properties of the elements. Mendeleev noticed that certain properties of the elements repeated after a certain number of elements, which led him to develop the periodic table.

Next, I would examine the unknown elements set of cards and try to place them in the periodic table based on their properties. For example, Element X has a high density and a high melting point, which suggests that it may be a transition metal. Its poor conductivity indicates that it is not a good conductor of electricity, which is consistent with the properties of most transition metals. Based on these properties, I might place Element X in the transition metal group of the periodic table.

Element Y is a gas with a low density and a low melting point. Its good conductivity suggests that it may be a metal or a metalloid. Its reactivity with water suggests that it may be an alkali metal or an alkaline earth metal. Based on these properties, I might place Element Y in the alkali metal or alkaline earth metal group of the periodic table.

By organizing the elements in this way, I would be able to predict the properties of other unknown elements and potentially discover new elements based on their predicted properties.

CAN SOMEONE HELP WITH THIS QUESTION?✨

Answers

Fe²⁺ is the reducing agent in this reaction.

In the given chemical reaction:

[tex]Cr_2O_7^{2-} + 6Fe_2+ + 14H^+ -- > 2Cr_3+ + 6Fe_3+ + 7H_2O[/tex]

We can see that Fe²⁺ is being oxidized to Fe³⁺ as it loses one electron and its oxidation state increases from +2 to +3. This means that  Fe²⁺ is giving away electrons, which makes it the species that is being oxidized or the reducing agent.

Therefore,  Fe²⁺ is the reducing agent in this reaction.

There are species in a chemical reaction that experience changes in their oxidation states, meaning they either acquire or lose electrons. Because it reduces another species by transferring electrons to it, the species that sheds electrons is known as the reducing agent.

The species that acquires electrons is known as the oxidizing agent because, by taking electrons from another species, it oxidizes that species.

learn more about reducing agent here

https://brainly.com/question/12549467

#SPJ1

Based on molecular orbital theory, the only molecule in the list below that has unpaired electrons is ________.
Li2
N2
C2
F2
O2

Answers

The molecule that has unpaired electrons based on molecular orbital theory is O2.

What is Electron?

An electron is a subatomic particle with a negative charge that orbits the nucleus of an atom. Electrons have a mass of approximately 9.11 x[tex]10^{-31}[/tex]kilograms and a fundamental unit of charge, which is equal to -1.602 x [tex]10^{-19}[/tex]coulombs. Electrons are involved in chemical reactions and determine the chemical and physical properties of atoms and molecules. They are also involved in the production of electricity and are the basis of modern electronics.

Molecular orbital theory is a model used to explain the bonding of molecules. According to this theory, molecular orbitals are formed by the linear combination of atomic orbitals of the constituent atoms. These molecular orbitals can be bonding or antibonding in nature, and the number of electrons in the bonding and antibonding orbitals determines the stability and reactivity of the molecule.

Learn more about Electron from the given link

https://brainly.com/question/860094

#SPJ1

You are trying to increase the rate at which you can dissolve a large amount of sodium chloride into water to make a solution to use in lab.
Which of the following would be the BEST method of doing this?

A. stir and heat the mixture and use small pieces of sodium chloride

B. heat the water and use a large piece of sodium chloride

C. stir and heat the mixture and use a large piece of sodium chloride

D. heat the water and use small pieces of sodium chloride

Answers

The answer would be “A. Stirring and heating the mixture”, this will increase the kinetic energy of the water molecules.

Predicting Products: Mg + K2SO4. (2 and 4 are coefficients)

Answers

The reaction between magnesium (Mg) and potassium sulfate (K2SO4) is a double displacement reaction that occurs in an aqueous solution. The products that will form depend on the solubility of the resulting compounds.

When Mg and K2SO4 react, magnesium sulfate (MgSO4) and potassium (K) will be produced. This is because the magnesium will displace the potassium ion in the potassium sulfate compound, resulting in the formation of magnesium sulfate and potassium metal.

The balanced chemical equation for this reaction is:

2Mg + K2SO4 → MgSO4 + 2K

It is important to note that this reaction will only occur if the magnesium is more reactive than the potassium in the solution. If the opposite were true, no reaction would occur.

To know more about double displacement reaction , visit:

https://brainly.com/question/29307794

#SPJ1

draw and explain the energy profile diagram along with various possible conformations of cyclohexane

Answers

Answer:

we're is the diagram I don't see it

Q. The order of acidic strength of hydrogen halides is: acid HF < HCl CH-1 > Br¹>1-1 (b) F-1 < CH-1 < Br¹ Br¹> -1 (d) F-1> CI-1 < Br¹> -1. Hint: A strong acid has a weak conjugate base and vice versa.​

Answers

Answer:

im just here grabbing points dont take me as rude or anything

Explanation:

yours appreciatively bye

name two acids used in the manufacture of fertilizers​

Answers

Two acids commonly used in the manufacture of fertilizers are sulfuric acid and phosphoric acid

Select the two true statements about natural selection. Natural selection makes less advantageous variations become more advantageous over many generations. A population's environment affects the outcome of natural selection. Natural selection always makes a population gain new advantageous variations. Natural selection can change which variations are more common in a population over time. Submit

Answers

Answer:

The two true statements about natural selection are:

A population's environment affects the outcome of natural selection.

Natural selection can change which variations are more common in a population over time.

Natural selection acts on the existing variations within a population and favors those that confer a survival or reproductive advantage in a particular environment. Over time, the advantageous variations become more prevalent, and less advantageous ones may become less common or disappear from the population. However, natural selection does not necessarily create new variations; rather, it acts on the genetic variation that already exists within a population.

Consider the following intermediate chemical equations.

2 equations: first: upper C (s) plus one-half upper O subscript 2 (g) right arrow upper C upper O (g). Second: upper C upper O (g) plus one-half upper O subscript 2 (g) right arrow upper C upper O subscript 2 (g).

When you form the final chemical equation, what should you do with CO?

Answers

The CO gas produced in the first equation is used in the second equation to produce CO2 in the final equation.

In the intermediate equations, solid carbon (C) and molecular oxygen (O2) are transformed into gaseous carbon monoxide (CO), which is then reacted with more oxygen to produce carbon dioxide (CO2).

The final chemical equation can be created by combining the intermediate equations and cancelling out the intermediate reactant and product (CO and O2) to obtain the overall balanced equation for the reaction:

C(g) + O2(s) = CO2 (g)

Thus, the CO generated in the first equation is consumed in the second equation and does not show up in the third and final equation. The two intermediate reactions' combined outcome is represented by the final equation, which only includes the reactants (C and O2) and product (CO2).

Learn more about molecular oxygen here:

https://brainly.com/question/11587330

#SPJ1

For each of the following equilibria, write the equilibrium constant expression for Kc.


1. BaSO4(s) <---->Ba2+(aq) + SO42-(aq)

2. CH3COOH (aq) + H2O (l) <--->CH3COO- (aq) + H3O+ (aq)

Answers

Equilibria are chemical reactions that happen with a change in the concentration of the reactants or products. If the forward reaction is favored, a greater concentration of the product will be formed than the reactant(s), and the reaction is said to be favored. If the reverse reaction is favored, a greater concentration of the reactant(s) will be formed and thus the reaction is said to be favored. An equilibrium constant (constant K), is a number that describes the ratio of products to reactants at an equilibrium. K is also referred to as the equilibrium coefficient.

Answer:

1. Kc = [Ba2+][SO42-]

2. Kc = [CH3COO-][H3O+]/[CH3COOH]

Explanation:

The equilibrium constant expression for Kc is the product of the concentrations of the products raised to their stoichiometric coefficients divided by the product of the concentrations of the reactants raised to their stoichiometric coefficients.

1. For the first equilibrium, BaSO4(s) <---->Ba2+(aq) + SO42-(aq), the equilibrium constant expression for Kc is: Kc = [Ba2+][SO42-].

2. For the second equilibrium, CH3COOH (aq) + H2O (l) <—>CH3COO- (aq) + H3O+ (aq), the equilibrium constant expression for Kc is: Kc = [CH3COO-][H3O+]/[CH3COOH].

Note that the concentration of water is not included in the expression because it is a pure liquid and its concentration is considered constant.

Other Questions
if we suffer from stagflation, which of the following is true? the correct policy could involve either increasing or decreasing the demand we always combat inflation the economy can adjust by shifting the supply curve to the left prices are higher but the gdp is now above the full employment rate During the COVID-19 pandemic, many people were asked to stay at home to keep the disease from spreading. For many, this meant adjusting to working from home or attending school from home. People soon learned that going digital with work or school can make it harder to keep boundaries between work/school and family life.Explain whether you think it is possible to achieve a healthy balance while working remotely from home. Why do you feel the way you do? List at least two ways a person might adjust to attain a better work/family balance even if they are home all the time. Need help with question HW6 Supporters of the Tea Party:O have allied themselves with the Democratic Party.O strongly oppose the platform of the Libertarian Party.O will select their party candidates in the next primary election.O view taxation and regulation of business as a threat to capitalism anddemocracy. please do the capm estimation: what is the cost of equity for a firm if the beta equals 1.5, and you find the risk-free interest rate is 6% and the expected return on the market portfolio is 15%? creek company uses the percentage of credit sales method in determining its bad debt expense. the following information comes from the accounting records of creek company: cash sales$ 280,000 credit sales720,000 total sales1,000,000 credit balance in the allowance for doubtful accounts2,000 bad debt loss rate3% what is the estimated bad debt expense? a venture's common equity account increased by $100,000 the past year and ended the year at $500,000. what was its sustainable sales growth rate? if every moment was spent making sure that every individual in the world was more secure what would that look like how many shares do the founders hold pre-financing? (a) for trendsetter case study harvard business publishing what are some of the methods that anthropologists have attempted to move beyond ethnocentrism suppose a student conducted a titration of an unknown solution of the weak acid ch3cooh with 0.880 m naoh. first, the student diluted 15.0 ml of the ch3cooh solution with 85.0 ml of water in an erlenmeyer flask and added 2 drops of the indicator, phenolphthalein. then, 0.880 m naoh was titrated into the diluted ch3cooh solution until the color of the solution changed to pink and the end point of the titration was reached. at the end point, 6.80 ml of 0.880 naoh was added to the ch3cooh solution. calculate the concentration of the ch3cooh solution. Which of the Welton boys do you identify with? Why ? an investor has a budget of $30 million. he can invest in the projects shown above. if the cost of capital is 5%, what investment or investments should he make? Do the set of points in the figure represent a function? A. YesB. No Please help with this biology question! Photo is added of the problem. Which statement best describes the role of the speaker in the poem "El Olvido" by Julia Ortiz Cofer?The speaker is warning against forgetting ones heritage.The speaker is trying to reconnect with her own heritage.The speaker is expressing regret over moving away from home.The speaker is voicing embarrassment over her mothers cultural traditions. $3,423.55+$2,737.69+$2,014.95+$1,253.34+$450.76+$12,752.45+$13,438.31+$14,161.05+$14,922.66+$15,725.24 (Need Help please and thank you!) In what ways does Juliet speak the truth in her efforts to convince her parents and the nurse that shes agreeable to marrying Paris? a statistics teacher wants to know if the student birth month is distributed equally across all months. he uses school records to determine the birth month of all the students at the school and calculates a chi-square statistic to test this hypothesis. why is this not an appropriate use of a chi-square goodness-of-fit test?