A unit of substance that contains the Avogadro number of atoms or molecules is referred to as a ____________ of the substance. ​

Answers

Answer 1

Answer:

A unit of substance that contains the Avogadro number of atoms or molecules is referred to as a mole of the substance.

Explanation:

The mole (symbol: mol) is the unit of measurement for amount of substance in the International System of Units (SI). A mole of a substance or a mole of particles is defined as exactly 6.02214076×1023 particles, which may be atoms, molecules, ions, or electrons. In short, for particles, 1 mol = 6.02214076×1023.


Related Questions

If a radiation source has a wavelength of 4.76 x 10-6 m, then what is its frequency?

Answers

Answer: 6.3 * 10^15

Explanation:

wavelength = speed of light / frequency

so rewriting the equation gives frequency = speed of light / wavelength

so 3.0 *10^10 / 4.76 * 10^-6  = 6.3 * 10^15

Which bond is a very strong dipole-dipole force?
A. A covalent bond
B. An ionic bond
C. A hydrogen bond
D. A metallic bond

Answers

Answer : C. A hydrogen bond

Explanation:

Answer:

A. covalent bond

Explanation:

dipole-dipole interaction results from difference in electronegativity , eg H-F where Fluorine has strong electronegativity but Hydrogen has less electronegativity. hence the bond has dipole moment towards F atom.

In a solution, what term is given to the liquid?

Answers

Answer: solvent

solvent is  A solvent is usually a liquid

Answer: Solvent

Explanation: Everything that dissolves in water and the things which dissolve are called solutes and the liquid in which they dissolve in is called a solvent to form a solution.

What determines the appearance of the moon from earth?

Answers

It’s determined by the phases of the Moon, and the positions of the Moon. The Moon’s phase only really depends only on its position relatively Earth an the Sun.

To solve this we must be knowing each and every concept related to satellite. Therefore,  moon phases and moon placements have a role the appearance of the moon from earth.

What is satellite?

Any object that circles a planet in a curved route is considered a satellite. There are several man-made (manufactured) satellites, most of which are closer to Earth than the moon, which is Earth's original natural satellite.

We must revisit our buddy Newton in order to comprehend why satellites move in this manner. Gravity, according to Newton, is a force that unites all of the universe's objects. Moon phases and moon placements have a role in determining this. The only major factor affecting the Moon's phase is where it is in relation to Earth and the Sun.

Therefore,  moon phases and moon placements have a role the appearance of the moon from earth.

To learn more about satellite, here:

https://brainly.com/question/21034894

#SPJ2

please answer willl give brainlist !!! Name the noble gases. What are the common properties between them?

Answers

Answer: Other characteristics of the noble gases are that they all conduct electricity, fluoresce, are odorless and colorless, and are used in many conditions when a stable element is needed to maintain a safe and constant environment. This chemical series contains helium, neon, argon, krypton, xenon, and radon.

Darwin told us that science:
saves lives

Answers

Answer:yup!!

Explanation:

Help please !
A
B
C
D

Answers

Answer:

the answer is letter B. the entropy

Answer:B (the entropy of the gas will increase, and it will spread out to fill both containers) is the correct answer

400 liters of a certain gas is collected at STP. What will the volume be at 273 C and 190 torr pressure?

Answers

Answer:

2.00 L of a gas is collected at 25.0°C and 745.0 mmHg. What is the volume at STP? STP is a common abbreviation for "standard temperature and pressure." You have to recognize that five values are given in the problem and the sixth is an x. Also ... 273 1. A gas has a volume of 800.0 mL at minus 23.00 °C and 300.0 torr.

Explanation:

If a neutral compound is composed of carbon and hydrogen and you know that it has exactly 2 carbons connected by a double bond, how many hydrogens will the compound have?

Answers

Answer: 4 hydrogens

Explanation:

This is what the structure will look like C=C. Remember that it's important that all structures have a complete octet. As it looks right now each carbon is sharing 4 valence electrons so each needs 2 more bonds to hydrogen complete its octet.

Answer: 4 hydrogens

Explanation:

1. Which of the following is not a major classification for elements in the periodic table?
O a. metals
O b. metalloids
O c. nonmetals
O d. noble gases

Answers

Answer:

Noble gases

Explanation:

Noble gases good studying

Does Rubidium (Rb) have high or low electronegativity?

Answers

Answer:

high

Explanation:

how many significant figures are in 0.00970 g?

Answers

Answer:

3

Explanation:

begining 0's are never significant

all numbers 1-9 are always significant

ending 0's are only significant when there is

a decimal.

A student observes that a popcorn kernel has a hard coat. He places the kernel in a moist paper towel and observes it for several days. He notices that the coat splits and a small root emerges. He concludes that

Answers

Answer: Water inside the seed coat creating a pushing force, breaking the seed coat.

Explanation:

Seed germination can be defined as the process by which a new plant emerge out from a seed. The radicle is the first emerging part from a seed and it develops into a root and the plumule is the second emerging part and it develops into a shoot. The light, water, adequate temperature, and soil are the factors that are necessary for seed germination.

According to a given situation, the popcorn kernel will receive the moisture necessary for the germination process, the water will imbibe into the seed coat creating pressure inside the seed and which will cause the seed coat to break and the new plant parts or seedling will emerge out of the seed coat.

formal units are formed by?

Answers

Answer:

However, when formal units are used to measure length, the measurement can usually be read from a scale on a ruler or tape, which shows units of a particular size. Unit iteration involves knowledge of repeatedly placing identical tightly packing units so that there are no overlaps or gaps.

Explanation:

is xenon a metal and is Beryllium a metal

Answers

Answer:

No and yes

Explanation:

Xenon is a noble gas and beryllium is a metal

Answer: no and yes i also agree

Xenon is a noble gas and Beryllium a metal

Explanation:

Helpppppp!!!!! It’s due today
URGENT!!!!!

Answers

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

The total amount of energy before and after a chemical reaction is the same. Therefore, energy is _____.
created

destroyed

converted

conserved

Answers

Answer:

Option (a) is the correct answer.

Explanation:

The law of conservation of energy states that energy can neither be created nor it can be destroyed. It can only be transformed from one form to another.

Therefore, the total amount of energy before and after a chemical reaction is the same. Thus, energy is conserved.

Therefore, we can conclude that option (a) is the correct answer.

Answer:

conserved

Explanation:

law of conservation of energy says that energy can neither be created or destroyed

when a substance melts the kinetic energy

A Decreases then increase

B Decrease

C Stays the same

D Increase

Answers

Answer:

C stays The same.

Is the answer.

Answer = C

the overall kinetic energy level between the two substances actually remains the same

Non examples of chemical change
List some please

Answers

Answer:

Crushing a can.

Melting an ice cube.

Boiling water.

Mixing sand and water.

Breaking a glass.

Dissolving sugar and water.

Shredding paper.

Chopping wood.

Some non-examples of the chemical reaction should be boiling water, glass breaking out, etc.

Chemical reaction

It is a process where one or more substances that we know as reactants should be transformed into one or more distinct substances that we know as products. Here the substances should be treated as the elements of chemicals or the compounds.Chemical reactions are an integral part of technology, culture, and indeed of life itself. Burning fuels, smelting iron, making glass and pottery, brewing beer, and making wine and cheese are among many examples of activities incorporating chemical reactions that have been known and used for thousands of years. Chemical reactions abound in the geology of Earth, in the atmosphere and oceans, and in a vast array of complicated processes that occur in all living systems.

Therefore, Some non-examples of the chemical reaction should be boiling water, glass breaking out, etc.

Learn more about non examples of chemical change

https://brainly.com/question/1737296

#SPJ2

Can someone help me please will give BRAINIEST
Complete the conversions for the following temperature measurements:
55.3C=_____K
255K=_____C
447K=_____C
-14C=_____K

Answers

55.3C= 328.45K
255K= -18.5C
447K= 174.85C
-14C= 259.15K

Answer:

55.3 = 328.45k

255 = 18.15°c

447 = 173.85°c

-14 = 14k

An oxide named CrO. So the salt of chromium has the corresponding valence​

Answers

Answer:

this question doesnt make any sene

Explanation:

How does nano frabic work

Answers

Answer:

Nano silver is woven into fabric to give it anti-bacterial properties.

Explanation:

Helps by fending off the bacteria that make those clothes smell after you sweat. Nano-titanium dioxide adds sun protection to clothing just as it does in sunscreen. The use of nanoparticles to achieve fresh-smelling clothes and UV protection may not be safe.

Predict: Note the type of reaction you expect for
the sole reactant Na2CO3.
a. single replacement
b. double replacement
c. combustion (and synthesis)
d. synthesis
e. decomposition

Answers

Answer:

double replacement

Explanation:

Answer:

It is indeed double replacement

Explanation:

John is performing an experiment in which a solution alternates between a clear color and a bluish-purple color at a regular time interval. He observes that the time interval between color changes is 30 seconds (s). Sally replicates the experiment with the same solution, but at a temperature that is 10 degrees Celsius (°C) higher. What is the most likely time interval between color changes at this higher temperature? *

Answers

Answer:

15 sec

Explanation:

True or False;
aa is faster moving lava than pahoehoe?

Answers

Answer:

It is false :l

Explanation:

Pahoehoe is a smooth and continuous lava crust. Pahoehoe forms when the effusion rate is low and consequently the velocity of lava flow is slow. Pahoehoe lava flow is usually at least 10 times slower than typical aa lava flow.

:/

3. How many moles are in 1.49 x 1023 molecules of iodine?

Answers

Answer:

The answer is 0.25 moles

Explanation:

To find the number of moles in a substance given it's number of entities we use the formula

[tex]n = \frac{N}{L} \\ [/tex]

where n is the number of moles

N is the number of entities

L is the Avogadro's constant which is

6.02 × 10²³ entities

From the question we have

[tex]n = \frac{1.49 \times {10}^{23} }{6.02 \times {10}^{23} } = \frac{1.49}{6.02} \\ = 0.247508305...[/tex]

We have the final answer as

0.25 moles

Hope this helps you

What happens when A mixture of ammonia and oxygen is passed over platinum gauze heated to 800°C .​

Answers

Answer:

The mixture forms nitrogen oxide and water upon reaction. However, 800 degree Celsius falls at higher limit of the process condition. It being an exothermic reaction, the reaction rate will be on the lower side than average.

Sodium metal reacts violently with water and chlorine is a toxic gas, yet we eat sodium chloride. Why is this possible? Select one: a. The properties of compounds are different from the properties of the elements that form the compounds.
b. The properties of compounds are identical to the properties of the elements that form the compounds, and we should not eat sodium chloride because it is toxic.
c. The physical properties of compounds are different from the physical properties of the elements that form the compounds, but the chemical properties of the elements and compound are the same.
d. The chemical properties of compounds are different from the chemical properties of the elements that form the compounds, but the physical properties of the elements and compound are the same.

Answers

Answer:

The properties of compounds are different from the properties of the elements that form the compounds.

Explanation:

When elements form compounds, their properties are significantly modified. The physical and chemical properties of compounds and that of the elements that compose them are significantly different.

The introduction of chemical bonds between different atoms in compounds make the compounds to differ from elements where the atoms are bonded to atoms of the same element.

Which formula equation shows a reversible reaction? 2 Upper N a + Upper F Subscript 2 Baseline right arrow 2 Upper N a Upper F. Upper C a Upper C Upper O Subscript 3 Baseline right arrow Upper C a Upper O + Upper C Upper O Subscript 2. Upper N Upper H Subscript 4 Baseline Upper C l (s) double-pointed arrow Upper N Upper H Subscript 3 Baseline (g) + Upper H Upper C l (g). 2 Upper H Subscript 2 Baseline Upper O Subscript 2 Baseline (a q) right arrow with n above it 2 Upper H Subscript 2 Baseline Upper O (l) + Upper O Subscript 2 Baseline (g).

Answers

Answer:

NH₄Cl    ⇄      NH₃   +    HCl

Explanation:

The formula equation shows a reversible reaction is:

NH₄Cl(s) ⇄ NH₃(g) + HCl(g)

Classification of reactions according to their reversibilityReversible reactions: They occur in both senses, as denoted by a double arrow.Irreversible reactions: They occur in one sense, as denoted by a single arrow.

Let's consider which formula equation shows a reversible reaction.

2 Na + F₂ ⇒ 2 NaF

The single arrow indicates that this is an irreversible reaction.

CaCO₃ ⇒ CaO + CO₂

The single arrow indicates that this is an irreversible reaction.

NH₄Cl(s) ⇄ NH₃(g) + HCl(g)

The double arrow indicates that this is a reversible reaction.

2 H₂O₂(aq) ⇒ 2 H₂O(l) + O₂(g)

The single arrow indicates that this is an irreversible reaction.

The formula equation shows a reversible reaction is:

NH₄Cl(s) ⇄ NH₃(g) + HCl(g)

Learn more about reversible reactions here: https://brainly.com/question/11114490

A sealed can of soda contain a pressure of 1.15 atm at 23°C. What is the new pressure at 79 °C? Report your answer to the hundredths place (two decimal places) You do NOT need units in your answer

Answers

Answer:

P₂ = 1.37

Explanation:

Given data:

Initial pressure = 1.15 atm

Initial temperature = 23°C (23+273= 296 K)

Final pressure = ?

Final temperature = 79°C (79+273=352 K)

Solution:

According to Gay-Lussac Law,

The pressure of given amount of a gas is directly proportional to its temperature at constant volume and number of moles.

Mathematical relationship:

P₁/T₁ = P₂/T₂

Now we will put the values in formula:

1.15 atm / 296 K = P₂/352 K

P₂ = 1.15 atm × 352 K / 296 K

P₂ = 404.8 atm. K /296 K

P₂ = 1.37 atm

Other Questions
what are the ADJECTIVES in this sentence below:The hero in his adventure story is named Gregory. f a substance is ionic, then it likely will Which traits are common in all four career pathways of the Information Technology field? Check all that apply.A)accuracy and attention to detailB)problem-solving and critical-thinking skillsC)knowledge of programming languageD)ability to work independentlyE)ability to protect confidential informationF)ability to learn quickly Who is telling the story?Click here to read the passage "That Tiny Tubman Woman" to answer the question.an unnamed narratorSamuelan unnamed speakerMinty Agreement Spanish Homework fill in the blank The smoke alarms in an office building need new batteries. Larry has 1,311 batteries. Each office in the building needs 6 batteries. How many offices will get new batteries? How many batteries will be left?A.320 offices, 3 batteries leftB.218 offices, 3 batteries leftC.221 offices, 1 battery leftD.218 offices, 5 batteries left For her birthday, Kendra received a gift card in the mail from her grandparents. The gift card was worth $50. Kendra thought, since she had just received other gifts for her birthday, she would wait a while to spend the gift card. Unfortunately, Kendra forgot all about the gift card, and the card loses $5 every month after its date of purchase if it has not been used. If Kendra forgot the card for three months, she lost $______. A. 9 B. 10 C. 15D. 12i will give you brainiest and it has to be the right answer. 40 POINTS!A 2,200 kg SUV is traveling at 25 m/s. What is the magnitude of its momentum? A. 55,000 kgm/s B. 550 kgm/s C. 2,200 kgm/s D. 88 kgm/s Linear, exponential or neither?ao = 2; an = an-1 + 4A LinearB ExponentialC Neither Hate my teacher for this one smh....Is there enough information to prove the two triangles congruent? If yes, write the congruence statement and name the postulate you would use. If no, write not possible and tell what other information you would need. What is a common belief in Deaf culture?the belief that the hearing community doesn't accept thembeing born deaf is more welcomed in the Deaf community rather than becoming deaf later in lifethe reaction against the idea of deafness as a disabilitythe Deaf community shouldn't be considered as a separate ethnic group Which challenges have the Andean and midlatitude countries faced since gaining independence?Choose all answers that are correct.recent takeovers by nondemocratic governmentsharsh rule by military leadersextreme gaps between the rich and the poordifficulty in controlling and developing resources In IJK, j = 7.6 cm, k = 7.8 cm and I=27. Find the length of i, to the nearest 10th of a centimeter. what job would an experienced designer who enjoys giving client presentations most likley go intoA. Convention speaker B. Game designer Calculate the amount of heat needed to evaporate 235.0 grams of water from 25.0C to 100.0C. what does the word fauvism mean? The president can veto bills from Congress. Which arrow on the diagram stands for this checkon legislative power?Which arrow on the diagram stands for this check on legislative Calculate the force needed to cause a 6 kg bowling ball to accelerate 20 m/s2. What is the missing step in this proof?(image attached below) Find the unit rate from the graph :