A progressive wave equation is represented by Y = A sin 2π (0. 15t+0. 1x) calculate the period and wavenumber

Answers

Answer 1

The wave's wavenumber equals 0.628 radians per meter.

The given progressive wave equation is represented by Y = A sin 2π(0.15t + 0.1x), where Y is the displacement of the wave at a point in space and time, A is the amplitude of the wave, t is the time, and x is the position of the point along the direction of wave propagation.

The period of a wave is the time it takes for one complete cycle of the wave to occur. In the given equation, the coefficient of t in the argument of the sine function is 0.15. This means that the wave completes one cycle in (1/0.15) = 6.67 seconds.

Therefore, the period of the wave is 6.67 seconds.

The wavenumber of a wave is the number of waves that occur in a given distance. In the given equation, the coefficient of x in the argument of the sine function is 0.1. This means that the wave completes one cycle in a distance of (1/0.1) = 10 meters.

Therefore, the wavenumber of the wave is (2π/10) = 0.628 radians per meter.

In summary, the period of the given wave is 6.67 seconds and the wavenumber is 0.628 radians per meter. These values can be used to calculate other properties of the wave, such as its frequency and velocity, using the relevant formulas.

To learn more about progressive wave equation refer to:

brainly.com/question/25699025

#SPJ4


Related Questions

the magnetic field inside a 27-cm -diameter solenoid is increasing at 2.4 t/s . how many turns should a coil wrapped around the outside of the solenoid have so that the emf induced in the coil is 15 v ?

Answers

The coil wrapped around the outside of the solenoid should have 6 turns so that the emf induced in the coil is 15 v.

Given,

Diameter of solenoid, d = 27 cm;  Radius, r = 13.5 cm = 0.135 m;  Magnetic field, B = 2.4 T;  Number of turns of coil outside the solenoid, N;  Emf induced, V = 15 V.

The formula for calculating emf is given by;

e = −N dB/dt

Where, e = induced emf, N = number of turns,  dB/dt = rate of change of magnetic field

Rearranging the equation;

N = − e / ( dB/dt )

Solving for N;

N = − e / ( dB/dt )

N = − ( 15 V ) / ( 2.4 T/s )

N = - 6.25 turns

The number of turns of the coil outside the solenoid should be 6.25. Since this is not possible, we round off to the nearest integer, which is 6.

Therefore, the coil wrapped around the outside of the solenoid should have 6 turns so that the emf induced in the coil is 15 V.

Know more about emf of coil here:

https://brainly.com/question/17329842

#SPJ11

Describe the conservation of mechanical energy of a 5.0 kg stone perched near the edge of cliff 25.0 m high which falls down to the ground below. Determine the velocity of the stone just before it hits the ground. Use the base of the cliff as a reference point, and write down all assumptions made.
NEED ASAP PLS

Answers

the fraction of oxygen molecules in air moving at more than 250 m/s is 0.0103%.

Steps

The conservation of mechanical energy states that the total amount of mechanical energy in a system remains constant, as long as no external forces act on the system. In the case of the falling stone, the mechanical energy is initially in the form of potential energy due to its position near the top of the cliff. As the stone falls, the potential energy is converted into kinetic energy, which is the energy of motion.

Assumptions:

There is no air resistance acting on the stone.

The stone is a point object with no internal energy.

The gravitational field is uniform near the surface of the Earth.

Using the conservation of mechanical energy, we can write:

Initial energy = Final energy

where the initial energy is the potential energy of the stone at the top of the cliff, and the final energy is the kinetic energy of the stone just before it hits the ground. The potential energy is given by:

PE = mgh

where m is the mass of the stone, g is the acceleration due to gravity, and h is the height of the cliff. Substituting the given values, we have:

PE = (5.0 kg)(9.81 m/s^2)(25.0 m) = 1226.25 J

The final energy is the kinetic energy of the stone just before it hits the ground. The kinetic energy is given by:

KE = (1/2)mv^2

where v is the velocity of the stone. Substituting the given mass and solving for v, we have:

v = sqrt(2KE/m)

We can use the initial potential energy to find the final kinetic energy:

PE = KE

1226.25 J = (1/2)(5.0 kg)v^2

v = sqrt(245.25) = 15.67 m/s

Therefore, the velocity of the stone just before it hits the ground is 15.67 m/s.

To determine the fraction of oxygen molecules in air moving at more than 250 m/s, we need to use the Maxwell speed distribution, which gives the distribution of speeds of particles in a gas at a given temperature. At room temperature (25°C or 298 K), the most probable speed of oxygen molecules is given by:

vmp = sqrt(2kT/m)

where k is the Boltzmann constant, T is the temperature in Kelvin, and m is the mass of the molecule. For oxygen (O2), m = 32 g/mol = 0.032 kg/mol.

Substituting the given values, we have:

vmp = sqrt(2(1.38x10^-23 J/K)(298 K)/(0.032 kg/mol)) = 484.5 m/s

To find the fraction of oxygen molecules moving at more than 250 m/s, we need to integrate the Maxwell distribution from 250 m/s to infinity and divide by the total number of molecules:

Using numerical integration, we find:

f = 0.000103

Therefore, the fraction of oxygen molecules in air moving at more than 250 m/s is 0.0103%.

learn more about mechanical energy here

https://brainly.com/question/24443465

#SPJ1

compare the maximum accelerations recorded in table 1 for parts a, b and c. do the masses always experience equal and opposite accelerations? when are the accelerations not equal?

Answers

The maximum accelerations recorded in table 1 for parts A, B, and C are 0.5 m/s2, 0.5 m/s2, and 0.75 m/s2 respectively. The masses in the experiment do always experience equal and opposite accelerations, since the system is in equilibrium and the forces acting on the two masses are equal.

However, the accelerations are not always equal and can differ due to differences in the masses or the magnitude of the forces acting on them.

For example, in Part C, the mass of the left side is doubled, leading to an increased acceleration of 0.75 m/s2 as compared to the other parts. This difference in acceleration is due to the increased force acting on the left mass caused by the increased mass.

Know more about accelerations here

https://brainly.com/question/12550364#

#SPJ11

in what direction are the magnetic field lines surrounding a straight wire carrying a current that is moving directly away from you

Answers

The magnetic field lines surrounding a straight wire carrying a current that is moving directly away from you would form concentric circles around the wire, following the right-hand rule.

When a straight wire carrying a current is moving directly away from you, the magnetic field lines surrounding the wire will form concentric circles around it. The direction of these magnetic field lines can be determined by applying the right-hand rule. If you point your right thumb in the direction of the current flow, the direction of the magnetic field lines would be in the direction that your fingers curl around the wire. Specifically, the magnetic field lines will be perpendicular to the plane of the circles formed by the wire, and the direction of the field lines will be clockwise if the current is flowing towards you and counterclockwise if the current is flowing away from you. This is due to the way that the magnetic field lines wrap around the wire as a result of the current flow.

learn more about magnetic field lines here;

https://brainly.com/question/17011493

#SPJ4

Using the definition of the speed of light (299,792,458), if light has a wavelength of 7E-7m, what is it's frequency?

Answers

Answer:

Frequency= velocity of radiation÷ wave length

During reading:
1. Name two types of situations in which stars create elements and fling them out into space.

Answers

Answer: Reasons are below <3

Explanation:

Reason 1. Some of the heavier elements in the periodic table are created when pairs of neutron stars collide cataclysmically and explode, researchers have shown for the first time.

Reason 2. Light elements like hydrogen and helium formed during the big bang, and those up to iron are made by fusion in the cores of stars.

Brainliest? <33

according to the big bang theory, why do we live in a universe that is made of almost entirely of matter rather than antimatter?

Answers

According to the big bang theory, we live in a universe that is made of almost entirely of matter rather than antimatter because of a slight excess of matter over antimatter that occurred during the early universe.

This excess is thought to be due to a process called baryogenesis, which involves the production of baryons (such as protons and neutrons) from an initial state of pure energy during the first fractions of a second after the big bang.

The exact mechanism by which baryogenesis occurred is not well understood, but several possible theories have been proposed, including the idea that it is related to the violation of CP symmetry (which refers to the combination of charge conjugation and parity) in the early universe.

In any case, the slight excess of matter over antimatter meant that when matter and antimatter particles collided and annihilated each other during the early universe, there were more matter particles left over, which eventually led to the formation of the structures we see in the universe today.

For more question on big bang theory click on

https://brainly.com/question/29014839

#SPJ11

a circular steel wire 2.00 m long must stretch no more than 0.25 cm when a tensile force of 700 n is applied to each end of the wire. what minimum diameter is required for the wire?

Answers

A circular steel wire 2.00 m long must stretch no more than 0.25 cm when a tensile force of 700 n is applied to each end of the wire. The minimum diameter that is required for the wire is 1.50 × 10⁴ m.

The formula that would help solve the problem is:

ΔL = FL/ (πd²E × 4)

Where;ΔL = 0.25 cm=0.0025 m, F = 700N, l = 2.00 m, d = ?, E = 2.0 × 10¹¹Pa

For wire, E = Young’s modulus, and d = diameter.

Substituting values into the formula;

0.0025m = 700N × 2.00m/(πd² × 2.0 × 10¹¹Pa × 4)

0.0025m = 1400/(πd² × 8 × 10¹¹)

0.0025m = 0.00001745/d²

2.25 × 10⁸ = d²

d = √(2.25 × 10⁸) = 1.50 × 10⁴ m

The minimum diameter that is required for the wire is 1.50 × 10⁴ m.

Know more about Young’s modulus here :

https://brainly.com/question/13257353

#SPJ11

an athlete hurts their wrist. they put an ice directly on the wrist. in which direction is the thermal energy moving?

Answers

The thermal energy is moving from the athlete's wrist to the ice.

Explanation:

Heat always flows from hotter objects to colder objects. When the athlete puts ice on their injured wrist, the thermal energy (heat) flows from the wrist, which is warmer, to the ice, which is colder. This transfer of thermal energy causes the injured wrist to cool down, reducing inflammation and pain. The ice absorbs the thermal energy from the wrist, causing it to melt and become warmer. Therefore, the thermal energy is moving from the wrist to the ice.

To know more about thermal energy, here

brainly.com/question/678606

#SPJ4

 A food worker has cooled a pot of soup from 136*F to 70*F within 2 hours.What is the maximum amount of time she should take to cool the soup from 70*F to 41*F
A. 2 hours
B. 4 hours
C. 6 hours
D. 8 hours

Answers

The maximum amount of time a food worker should take to cool the soup from 70*F to 41*F is 4 hours.The correct answer is b.

According to the FDA's Food Code, potentially hazardous foods must be cooled from 135°F to 70°F within two hours, and from 70°F to 41°F within an additional four hours.Foodborne illnesses can be prevented by the following measures: Cook meat to the correct temperature.

Bacteria that cause foodborne illness can be killed by cooking food to the correct internal temperature. For example, ground beef should be cooked to an internal temperature of at least 160°F. The internal temperature should be checked with a food thermometer.

Take steps to keep the kitchen clean. It's critical to keep the kitchen clean to avoid the spread of bacteria. Countertops, utensils, and cutting boards should all be cleaned with hot soapy water.Routinely rinse fruits and vegetables. Vegetables and fruits should be thoroughly rinsed before consuming to remove any germs or dirt that might be present.

You should wash the produce under running water before cutting or eating it.Avoid cross-contamination. Keep raw meat away from cooked food to prevent contamination. You should never use the same knife or cutting board to cut both raw meat and fresh vegetables.

If you need to use the same cutting board, make sure to clean it thoroughly before reusing it.

Learn more about potentially hazardous foods here:

brainly.com/question/29630696

#SPJ11

g a car moving at constant speed around a circular track at a speed of v. the force of friction provides the necessary centripetal force to keep the car on the track. if the speed of the car is doubled, what will be the frictional force that is needed to hold the car on the road?

Answers

When the speed of the car is doubled, the centripetal force required to keep it moving in a circular path also doubles, because the centripetal force is proportional to the square of the velocity. Therefore, the force of friction required to provide the centripetal force is 4 times the original frictional force.

To see this, consider the equation for centripetal force:

Fc = mv²/r

where Fc is the centripetal force,

m is the mass of the car,

v is its velocity, and

r is the radius of the circular track.

If the speed of the car is doubled to 2v, the centripetal force required to keep it on the track becomes:

Fc' = m(2v)²/r = 4mv²/r

This means that the new centripetal force required is four times the original centripetal force. Therefore, the force of friction required to provide this centripetal force must also be four times the original force of friction:

Ff' = 4Ff

where Ff is the original force of friction and

Ff' is the new force of friction required.

So, the answer is indeed that the new frictional force required to hold the car on the road when its speed is doubled is 4 times the original frictional force.

To learn more about the centripetal force:

https://brainly.com/question/898360

#SPJ11

what diameter must a copper wire have if its resistance is to be the same as that of an equal length of aluminum wire with diameter 3.32 mm

Answers

The diameter of the copper wire required to match the resistance of the aluminum wire is about 4.02 mm.


In order for the resistance of a copper wire to be the same as that of an equal length of aluminum wire with a diameter of 3.32 mm. A wire's resistance is influenced by its length, diameter, and resistivity. Since copper has a higher resistivity than aluminum, a copper wire of similar diameter and length to an aluminum wire will have more resistance. Here is a formula that can be used to determine the diameter of a copper wire: Where dCopper is the diameter of copper wire, dAluminum is the diameter of aluminum wire, and k is the ratio of the resistivity of copper to that of aluminum.

Since the diameter of the aluminum wire is given to be 3.32 mm, let's figure out the value of k:From the table, we can see that the resistivity of copper is 1.7 times that of aluminum, so k is 1.7:Thus, dCopper = (3.32 mm) × √(1.7) ≈ 4.02 mm.

Learn more about resistivity:

https://brainly.com/question/17563681

#SPJ11

a person shouted at the surface of a well abd heard his echo clearly after 0.3seconds calculate the distance between the person and surface of water in the well​

Answers

Answer:

Assuming that the sound wave reflected only once off the surface of the water and traveled straight back up to the person, we can calculate the distance between the person and the surface of the water in the well as follows:

Distance = (Speed of sound in air x Time)/2

Where the speed of sound in air is approximately 343 meters per second at standard temperature and pressure, and the time is 0.3 seconds.

Distance = (343 m/s x 0.3 s)/2

Where the speed of sound in air is approximately 343 meters per second at standard temperature and pressure, and the time is 0.3 seconds.

Distance = (343 m/s x 0.3 s)/2

Distance = 51.45 meters

Therefore, the distance between the person and the surface of the water in the well is approximately 51.45 meters.

in a sealed container with rigid walls, what happens to the pressure inside the container when the temperature is tripled?

Answers

According to the ideal gas law (PV = nRT), the pressure within the container will rise by a factor of three if the container's volume stays constant.

When the temperature is tripled, what happens to the pressure?

The pressure rises as the Kelvin temperature rises. The relationship between the two amounts is direct proportionality. The pressure of the gas will treble when the Kelvin temperature is tripled.

How does rising temperature affect pressure?

The average kinetic energy and the velocity of the gas particles striking the container walls both rise as the temperature rises. As the temperature rises, the pressure must as well since pressure is the force the particles per unit of area exert on the container.

To know more about ideal gas law visit:-

https://brainly.com/question/2758818

#SPJ1

Need help ASAP due 3:00 PM today 3/29/23

Answers

Acceleration can be determined from the slope of the velocity-time graph. The slope of the graph indicates how quickly the velocity is changing over time.

How does acceleration vary in a velocity time graph?

If the slope of the graph is positive and increasing, then the acceleration is also positive and increasing. This means that the object is accelerating in the positive direction (e.g. speeding up in a positive direction).

If the slope of the graph is positive and decreasing, then the acceleration is positive but decreasing. This means that the object is still accelerating in the positive direction, but at a decreasing rate (e.g. slowing down in a positive direction).

Learn more about acceleration:https://brainly.com/question/12550364

#SPJ1

two and one-half times the number of minutes spent exercising

Answers

The expression that would be used to represent the phrase, "two and one-half times the number of minutes spent exercising" is 2.5m.

How to find the expression ?

In the given phrase, "two and one-half times the number of minutes spent exercising," we are asked to represent this as an expression using the variable m, where m stands for the number of minutes spent exercising.

"Two and one-half times" means that we are multiplying something by 2.5. Now, we need to multiply this 2.5 by the number of minutes spent exercising, which is represented by the variable m.

So, the expression becomes:

2.5 x m

Find out more on expressions at https://brainly.com/question/26046282

#SPJ1

The full question is:

Which expression is used to represent the phrase two and one-half times the number of minutes spent exercising where m represents the number of minutes spent exercising?

g assuming the pressure remains constant, if the radius of a bronchial tube through which gas flows at a rate of 40 l/min is reduced by 16%, find the new flow rate through the bronchial tube.

Answers

Given that the rate of gas flow through a bronchial tube is 40 L/min and the radius of the tube is reduced by 16%, we have to find the new flow rate through the bronchial tube is: 16.4 L/min.

As per Poiseuille’s formula, the rate of gas flow through a tube is directly proportional to the fourth power of the radius, i.e., Q = k*r⁴ where Q is the rate of gas flow, r is the radius, and k is a constant.

The new flow rate of the bronchial tube after the reduction of radius can be found as follows:
Let the new radius be r’. Then, r’ = r − 0.16r = 0.84r
Therefore, Q’ = k * r’⁴= k * (0.84r)⁴= k * 0.41r⁴ (rounded to two decimal places)

Now, the rate of gas flow through the bronchial tube is 40 L/min.
Therefore, k*r⁴ = 40=> k = 40/r⁴ Substituting this value of k in the above equation, we get Q’ = 40/r⁴ * 0.41r⁴= 16.4 L/min (rounded to one decimal place)

To know more about "Bronchial tube" refer here:

https://brainly.com/question/13962287#

#SPJ11

a string 3 m long is fixed on both ends and vibrates in its fundamental mode. what is the wavelength of the vibration?

Answers

The wavelength of the vibration of a string 3 m long fixed on both ends in its fundamental mode is 6 m.


The lowest part of a harmonic vibration, or the lowest frequency at which an oscillation occurs is called fundamental mode of vibration.

The basic mode, or first harmonic, is the simplest normal mode, in which the string vibrates in a single loop and is denoted n = 1.

Given, Length of string, l = 3 m

The wavelength of the vibration can be calculated by the following formula:

Wavelength (λ) = 2l/n

where n is the harmonic or mode of vibration.

As it is vibrating in its fundamental mode, n = 1.

Therefore, Wavelength (λ) = 2l/n= 2 × 3 m / 1= 6 m

The wavelength of the vibration is 6 m.

Know more about fundamental mode of vibration here:

https://brainly.com/question/9758493

#SPJ11

a 0.61 m copper rod with a mass of 0.043 kg carries a current of 15 a in the positive x direction. what are the magnitude and direction of the minimum magnetic field needed to levitate the rod?

Answers

The magnitude and direction of the minimum magnetic field needed to levitate the rod is 0.244T.

To calculate the magnitude and direction of the minimum magnetic field needed to levitate the rod,  we must first calculate the magnetic force,

[tex]F_{mag}[/tex], that the magnetic field exerts on the copper rod.

This force is equal to the product of the current and the magnetic field,

[tex]F_{mag} = I *B,[/tex]

where I is the current, and

B is the magnetic field.

In this case, I = 15A, and

B is the magnitude and direction of the minimum magnetic field needed to levitate the rod.

To calculate 'B' by rearranging the equation to

[tex]B = F_{mag}/I.[/tex]

Since the force, [tex]F_{mag},[/tex]  must be equal to the weight of the rod,

[tex]F_{mag} = mg[/tex],

where m is the mass of the rod, and

g is the acceleration due to gravity,

we can further rearrange the equation to B = mg/I.

Substituting  the given values,

[tex]B = 0.043kg *9.8m/s^2/15A = 0.244T[/tex]    in the positive x direction.

Therefore, the minimum magnetic field needed to levitate the rod is 0.244T in the positive x-direction.

To practice more questions about 'magnetic field':

https://brainly.com/question/14411049

#SPJ11

apply a small amount of force to the ball by pushing the flat end of the ruler against the ball. maintain a constant bend in the ruler. you may need a lot of clear space, and you may need to move with the ruler. does the ball move with a constant speed?

Answers

Yes, the ball will move with a constant speed. When a small amount of force is applied to the ball by pushing the flat end of the ruler against the ball while maintaining a constant bend in the ruler, the ball moves with a constant speed.

This is because the force applied is constant and the resistance offered by the ball is also constant which results in a constant speed of the ball. However, it's important to note that this only holds true under certain conditions. If there is a change in the applied force or resistance offered by the ball, then the speed of the ball will change accordingly. Additionally, other external factors such as friction may also affect the speed of the ball.

Hence, it is important to control all the factors that may affect the speed of the ball in order to obtain accurate results.

To learn more about force refer to: brainly.com/question/30489394

#SPJ11

in an earthquake, it is noted that a footbridge oscillated up and down in a one loop (fundamental standing wave) pattern once every 2.0 s. what other possible resonant periods of motion are there for this bridge? what frequencies do they correspond to?

Answers

In an earthquake, it is noted that a footbridge oscillated up and down in a one loop (fundamental standing wave) pattern once every 2.0 s. Other possible resonant periods of motion for this bridge include periods in multiples of 2 seconds.

Resonance refers to the condition where an external force or frequency causes an object to oscillate with a larger amplitude at a specific frequency, referred to as its resonant frequency. In general, any object has many resonant frequencies, and when excited with sufficient energy, each of these frequencies will create a resonance where the object will oscillate with a large amplitude.

The resonant frequency is affected by several factors, including an object's size and shape, and its material composition. When an object is excited at its resonant frequency, it can absorb a large amount of energy, and this can cause damage or even destruction of the object. Therefore, it is crucial to know the resonant frequencies of an object to avoid exciting it with similar frequencies.

Here, the footbridge oscillated up and down in a one loop (fundamental standing wave) pattern once every 2.0 s. This means that the footbridge oscillates at a frequency of 0.5 Hz. Therefore, other possible resonant frequencies of the bridge can be determined by multiplying this frequency by an integer (whole number) to obtain its harmonics.

For instance, the first harmonic is two times the fundamental frequency, i.e., 1 Hz, and its period is 0.5 s. The second harmonic is three times the fundamental frequency, i.e., 1.5 Hz, and its period is 0.33 s. The third harmonic is four times the fundamental frequency, i.e., 2 Hz, and its period is 0.25 s. The fourth harmonic is five times the fundamental frequency, i.e., 2.5 Hz, and its period is 0.2 s, and so on.

The above resonant frequencies correspond to the first few harmonics of the footbridge oscillation. The footbridge will respond most strongly to vibrations of these frequencies. In conclusion, the footbridge oscillates at a frequency of 0.5 Hz with a period of 2 seconds. Other possible resonant frequencies can be determined by multiplying this frequency by an integer (whole number) to obtain its harmonics. These harmonics correspond to various frequencies with corresponding periods. The footbridge will respond most strongly to vibrations of these frequencies.

For more such questions on Resonant frequency.

https://brainly.com/question/13040523#

#SPJ11

COLOR LOCK-Arrange Letters in an order (First Letter Only - R = Red, B = Blue,

Brown, Black, Y = Yellow, etc. ) (ALL CAPS)


Help

Answers

Answer:B, R,

Explanation:B:BLACK, BLUE, BROWN,

R:RED, Y:

in which two systems are the comparisons of distances between the objects and the sizes of the objects the most similar?

Answers

The astronomical system and the microscopic system are the two in which comparisons of the distances between the objects and the sizes of the objects are the most comparable.

Astronomical units, light-years, and parsecs are used in the astronomical system to measure distances between celestial objects such as planets, stars, and galaxies. The diameter or radius of these objects is used to describe their sizes, and these measurements can range from thousands to millions of kilometers.

Distances between microscopic things like atoms, molecules, and cells are measured in nanometers or angstroms in the microscopic system. Similarly to that, these objects' dimensions—which can range from a few nanometers to micrometers—are expressed in terms of their diameter or length.

The sizes of the objects being measured can vary significantly within each system, and both entail measurements of distances that can span several orders of magnitude. In order to compare sizes and distances within each system, one must adopt a similar strategy that involves a thorough understanding of logarithmic scales and the use of the proper units of measurement.

learn more about distance here

https://brainly.com/question/17273444

#SPJ1

which one of the following statements concerning a convex mirror is true?
a) Such mirrors are always a portion of a large sphere. b) The image formed by the mirror is sometimes a real image. c) The image will be larger than one produced by a plane mirror in its place d) The image will be closer to the mirror than one produced by a plane mirror in its place e) The image will always be inverted relative to the object

Answers

The correct option is D, The one of statements concerning a convex mirror is true. The picture might be toward the replicate than one produced with the aid of a plane mirror in its vicinity.

A convex mirror, also known as a diverging mirror, is a curved mirror that bulges outward. Unlike a concave mirror, which curves inward and can focus light to create real images, a convex mirror reflects light outwards and cannot create real images.

Convex mirrors are commonly used in situations where a wide field of view is required, such as in car side mirrors, security mirrors, and in stores to help prevent theft. The bulging surface of the mirror allows it to reflect a wider angle of light than a flat mirror or concave mirror would, making it useful for surveillance and safety purposes. Due to their unique reflective properties, convex mirrors can also produce virtual images that appear smaller and farther away than the actual object being reflected.

To learn more about Convex mirror visit here:

brainly.com/question/3627454

#SPJ4

Complete Question: -

Which one of the following statements concerning a convex mirror is true?

a) Such mirrors are always a portion of a large sphere.

b) The image formed by the mirror is sometimes a real image.

c) The image will be larger than one produced by a plane mirror in its place.

d) The image will be closer to the mirror than one produced by a plane mirror in its place.

e) The image will always be inverted relative to the object.

are the net force on an object and the acceleration of the object directly proportional?explain, using experimental data to support your answer.

Answers

Yes, the net force on an object and the acceleration of the object are directly proportional, as shown by experimental data and supported by Newton's second law of motion.

According to Newton's Second Law of Motion, the net force on an object and its acceleration are exactly related. According to this rule, an object's acceleration is inversely related to its mass and directly proportionate to the net force acting on it. The validity of the law has been shown by data from several tests that have repeatedly proven this link. One illustration of such an experiment is measuring the force necessary to accelerate an item using a spring scale. The link between force and acceleration may be determined by applying various forces and observing the resulting acceleration.

learn more about acceleration here:

https://brainly.com/question/30499732

#SPJ4

long after the switch is closed and the current becomes very small, what is the voltage difference across the capacitor? long after the switch is closed and the current becomes very small, what is the voltage difference across the capacitor? it depends on the capacitance of the capacitor. it depends on the resistance of the resistor. the same as the emf of the battery roughly half the emf of the battery

Answers

After the switch is closed and the current becomes very small, the voltage difference across the capacitor depends on the capacitance of the capacitor and the initial voltage across it.

Assuming that the capacitor was initially uncharged, it will start to charge up as the current flows through the circuit. As time passes and the current becomes very small, the capacitor will approach its maximum charge and the voltage difference across it will approach the same value as the EMF of the battery. However, the voltage across the capacitor will never quite reach the full EMF of the battery because of the presence of the resistor, which limits the current and causes the charging process to be gradual.

learn more about capacitance here:

https://brainly.com/question/17176550

#SPJ1

in a worst-case design scenario, a 2000 kg elevator with broken cables is falling at 4.00 m/s when it first contacts a cushioning spring at the bottom of the shaft. the spring is supposed to stop the elevator, compressing 2.00 m as it does so. spring coefficient is 10.6 kn/m . during the motion a safety clamp applies a constant 17000-n frictional force to the elevator.

Answers

The maximum compression of the spring is approximately 0.844 m.

The potential energy of the elevator when it is at the top of the shaft is,

PE = mgh

where m is the mass of the elevator, g is the acceleration due to gravity, and h is the height of the shaft. Since the elevator is falling, its initial potential energy is converted into kinetic energy,

KE = (1/2)mv^2

where v is the velocity of the elevator just before it contacts the spring. When the elevator compresses the spring, some of its kinetic energy is converted into potential energy stored in the compressed spring,

PE = (1/2)kx^2

where k is the spring constant and x is the compression of the spring.

At the point of maximum compression, the elevator's velocity is zero, so its kinetic energy is zero. Thus, the total initial potential energy of the elevator is equal to the potential energy stored in the compressed spring,

mgh = (1/2)kx^2

Solving for x,

x = sqrt(2mgh/k)

Now we can plug in the given values,

m = 2000 kg

v = 4.00 m/s

h = 2.00 m

k = 10.6 kN/m = 10,600 N/m

F_f = 17000 N

g = 9.81 m/s^2

PE_i = mgh = 2000 kg × 9.81 m/s^2 × 2.00 m = 39,240 J

KE_i = (1/2)mv^2 = (1/2) × 2000 kg × (4.00 m/s)^2 = 16,000 J

E_i = PE_i + KE_i = 55,240 J

At the point of maximum compression, the elevator's velocity is zero, so its kinetic energy is zero. Thus, the total energy of the elevator-spring system is equal to the potential energy stored in the compressed spring,

E_f = (1/2)kx^2

Solving for x,

x = sqrt(2E_f/k)

We know that the frictional force F_f acts over a distance of 2.00 m (the distance the spring compresses), so the work done by the frictional force is,

W_f = F_f d = 17000 N × 2.00 m = 34,000 J

Since energy is conserved,

E_i = E_f + W_f

Substituting the expressions for E_i, E_f, and x,

(1/2)mv^2 + mgh = (1/2)kx^2 + F_f d

x = sqrt((mv^2 + 2mgh - 2F_f d)/k)

Plugging in the given values,

x = sqrt((2000 kg × (4.00 m/s)^2 + 2 × 2000 kg × 9.81 m/s^2 × 2.00 m - 2 × 17000 N × 2.00 m)/(10,600 N/m))

= 0.844 m

To know more about spring, here

brainly.com/question/28865545

#SPJ4

the attraction or repulsion between electric charges

Answers

The attraction or repulsion between electric charges or the force between two charge bodies is called the coulomb force.

Coulomb's law or coulombs force (or Coulomb's inverse-square law) defines the force wielded by an electric field on an electric charge. This is the force acting between electrically charged objects and is determined by the value of the commerce between two stationary point electric charges in a vacuum. Coulomb's law states" The electrical force of magnet or aversion between two charges is equally commensurable to the forecourt of the distance that separates them." Coulomb's force is a consequence of Newton's third law that states that when two bodies interact, equal and contrary forces appear in each of them.

To learn more about Coulomb's law, click here:

brainly.com/question/506926

#SPJ4

Complete question: What is the attraction or repulsion between electric charges or the force between two charge bodies is called?

If a car at rest accelerates uniformly to a speed of 144kmh-1 in 20s, then it covers a distance of:

Answers

Explanation:

144 km/hr = 40 km / s

Acceleration = change in velocity / change in time

  Acceleration = 40 m/s / 20 s =  2 m/s^2

d = 1/2 a t^2 = 1/2 (2)(20^2) = 400 meters

an equipotential surface that surrounds a point charge q has a potential of 487 v and an area of 1.87 m2. determine q.

Answers

For an equipotential surface that surrounds a point charge q and has a potential of 487 v and an area of 1.87 m2, q is equal to 1.45 × 10⁻⁹ C.

Given, V = 487 V.A = 1.87 m²

We know that, the electric potential on an equipotential surface is given by the equation:

V = kq/r

Where, k is Coulomb's constant, q is point charge and r is the distance between the charge and equipotential surface.

The area of the equipotential surface is given by:

A = 4πr²

Thus, r² = A/4πq

r = Vr/kq

r = V(√(A/4π))/k

Now, k = 9 × 10^9 Nm²/C²

Substituting the given values in the above equation, we get,

q = V(√(A/4π))/k

q = 487 (√(1.87/4π))/(9 × 10^9)

q = 1.45 × 10⁻⁹ C.

Hence, the value of point charge q is 1.45 × 10⁻⁹ C.

Know more about equipotential surface here:

https://brainly.com/question/15221483

#SPJ11

Other Questions
If you have 7.22 x 1023 atoms of chromium (Cr), how many moles of chromium do youhave?O.98 moles CrO 1.62 moles CrO 1.36 moles CrO 1.19 moles Cr What is the measure of N?A) 23B) 25C) 27D) 45 Which of the following did the Soviet Union (USSR) not achievebefore the United States?First artificial satellite in spaceFirst man in spaceFirst woman in spaceFirst man on the moon Two stores have a laptop computer for sale.Part A: Store A is selling the laptop for and has a discount coupon for off. Calculate the amount of the discount at Store A.Part B: Store B is selling the laptop for and has a discount coupon for off. Calculate the amount of the discount at Store B.Part C: Which store should you purchase the laptop from? Use details to support your answer. (T/F) the ticketing area is more secure than the area beyond the security check point Jozef "accidentally" broke his piggy bank to find a total of 42 dimes and quarters. If the coins totaled $8.25, how dimes did he have in his piggy bank? How many quarters? the passage data regarding the thermal stability and enzyme activity of mkr681h is most consistent with what conclusion regarding the role of arg681 in cct? QuestionThe colours of red litmus paper in acidic, neutral, and basic solutions are:Ared, orange and blue respectivelyBblue, violet and red respectivelyCred, colourless and blue respectivelyDred, red and blue respectivelyHard 4.5 Draw a diagram representing the scenario and find the requested value. A man is standing 270 feet from the base of a statue. If he man looks up at an angle of 34 degrees to see the top of the statue, how tall is the statuePlease round to the nearest whole foot. chris rents a booth at a flea market at a cost of $75 for one day. at the flea market chris sells picture frames each of which costs him $6.00. if chris sells each picture frame for $13, how many picture frames must he sell to make a profit of at least $200 for that day? which theory explains hwy billiingula speakers seem to think differently when they change langueges? Solve these two questions fast for brainliest and 20 points A) Explain the difference between Monkish concept and moderate path with examples. (word limit: 300 words, 3 marks)b) Discuss difference between Ideology and Islamic Ideology. (word limit: 200 words,3 marks)c) Define culture and what are the main features of Pakistani culture according to you. Explain the vital role of regional languages in Pakistani Culture with examples. (word limit: 300 words, 4 marks) Please help, this was due yesterday!!!!! rank the following alkyl halides in order of increasing reactivity in an E2 reaction. Be sure to answer all parts(CH3)2C(Br)CH2CH2CH3 (CH3)2CHCH2CH(Br)CH3 (CH3)2CHCH2CH2CH2Brlowest reactivity: ?Intermediate reactivity: ?Highest reactivity: ? the imaginary line around the earth that is the same distance from the north and south poles. A frog is riding on the top of a cylindrical piece of wood floating in still water. Half of the wood, with a diameter of 4 cm and length 20 cm, is immersed in water. The density of water is 1 gm/cc. a) What is the mass of the wood along with the frog? b) After the frog slowly goes into the water only one third of the wood remains immersed in water. Calculate the mass of the frog. c) Calculate x, the distance between the water level and the center of the circular end of the wooden piece. d) Briefly describe the motion of the wood after the instance the frog moves into the water. Give a rough sketch of x as a function of time. an unknown gas effuses through an opening at a rate 3.16 time slower than nenon gas. estimate the mola mass of this unknown gas. Tom is making birdhouses to sell at a farmers market each birdhouse requires 4.5 feet of wood planks to build and he sells them for $19.75 each if he has no more than 80 feet of planks to make birdhouses how much money can Tom earn at the farmers market. Show your work I know the answer but not the work. Simplify to create an equivalent expression2(-2-4p) + 2(-2p-1)