Answer:
3.97 M
Explanation:
Given data:
Initial volume V₁ = 318 mL
Initial molarity M₁ = 5.75 M
New volume V₂= 461 mL
New concentration M₂= ?
Solution:
New volume V₂= 143 mL+ 318 mL
New volume V₂= 461 mL
Formula:
M₁V₁ = M₂V₂
M₂ = M₁V₁ / V₂
M₂ = 5.75 M × 318 mL / 461 mL
M₂ = 1828.5 M. mL/ 461 mL
M₂ = 3.97 M
Is copper sulphate malleable?
Answer:
Yes, Copper (Cu) in its pure form is a reddish-brown metallic element with high ductility and malleability that is an excellent conductor of heat and electricity: atomic weight 63.54; atomic number 29; density 8.94 g/cm3; melting point 1083°C; and boiling point 2595°C.
Answer:
no ,its not malleable
Explanation:
copper II sulphate is a blue compound , which is brittle solid , crystalline .
copper metal is malleable and ductile
In a solution, what term is given to the liquid?
Answer: solvent
solvent is A solvent is usually a liquid
Answer: Solvent
Explanation: Everything that dissolves in water and the things which dissolve are called solutes and the liquid in which they dissolve in is called a solvent to form a solution.
400 liters of a certain gas is collected at STP. What will the volume be at 273 C and 190 torr pressure?
Answer:
2.00 L of a gas is collected at 25.0°C and 745.0 mmHg. What is the volume at STP? STP is a common abbreviation for "standard temperature and pressure." You have to recognize that five values are given in the problem and the sixth is an x. Also ... 273 1. A gas has a volume of 800.0 mL at minus 23.00 °C and 300.0 torr.
Explanation:
formal units are formed by?
Answer:
However, when formal units are used to measure length, the measurement can usually be read from a scale on a ruler or tape, which shows units of a particular size. Unit iteration involves knowledge of repeatedly placing identical tightly packing units so that there are no overlaps or gaps.
Explanation:
Which formula equation shows a reversible reaction? 2 Upper N a + Upper F Subscript 2 Baseline right arrow 2 Upper N a Upper F. Upper C a Upper C Upper O Subscript 3 Baseline right arrow Upper C a Upper O + Upper C Upper O Subscript 2. Upper N Upper H Subscript 4 Baseline Upper C l (s) double-pointed arrow Upper N Upper H Subscript 3 Baseline (g) + Upper H Upper C l (g). 2 Upper H Subscript 2 Baseline Upper O Subscript 2 Baseline (a q) right arrow with n above it 2 Upper H Subscript 2 Baseline Upper O (l) + Upper O Subscript 2 Baseline (g).
Answer:
NH₄Cl ⇄ NH₃ + HCl
Explanation:
The formula equation shows a reversible reaction is:
NH₄Cl(s) ⇄ NH₃(g) + HCl(g)
Classification of reactions according to their reversibilityReversible reactions: They occur in both senses, as denoted by a double arrow.Irreversible reactions: They occur in one sense, as denoted by a single arrow.Let's consider which formula equation shows a reversible reaction.
2 Na + F₂ ⇒ 2 NaFThe single arrow indicates that this is an irreversible reaction.
CaCO₃ ⇒ CaO + CO₂The single arrow indicates that this is an irreversible reaction.
NH₄Cl(s) ⇄ NH₃(g) + HCl(g)The double arrow indicates that this is a reversible reaction.
2 H₂O₂(aq) ⇒ 2 H₂O(l) + O₂(g)The single arrow indicates that this is an irreversible reaction.
The formula equation shows a reversible reaction is:
NH₄Cl(s) ⇄ NH₃(g) + HCl(g)
Learn more about reversible reactions here: https://brainly.com/question/11114490
John is performing an experiment in which a solution alternates between a clear color and a bluish-purple color at a regular time interval. He observes that the time interval between color changes is 30 seconds (s). Sally replicates the experiment with the same solution, but at a temperature that is 10 degrees Celsius (°C) higher. What is the most likely time interval between color changes at this higher temperature? *
Answer:
15 sec
Explanation:
3. How many moles are in 1.49 x 1023 molecules of iodine?
Answer:
The answer is 0.25 molesExplanation:
To find the number of moles in a substance given it's number of entities we use the formula
[tex]n = \frac{N}{L} \\ [/tex]
where n is the number of moles
N is the number of entities
L is the Avogadro's constant which is
6.02 × 10²³ entities
From the question we have
[tex]n = \frac{1.49 \times {10}^{23} }{6.02 \times {10}^{23} } = \frac{1.49}{6.02} \\ = 0.247508305...[/tex]
We have the final answer as
0.25 molesHope this helps you
What is 13.48cm+7.6cm rounded to the correct number of significant figures?
Helpppppp!!!!! It’s due today
URGENT!!!!!
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
For an object to remain at rest which of the following statements must be true
Answer:
An object that is at rest will stay at rest unless a force acts upon it. An object that is in motion will not change its velocity unless a force acts upon it. This is known as uniform motion. An object continues to do whatever it happens to be doing unless a force is exerted upon it.
Explanation: NEWTONS laws of motion
please answer willl give brainlist !!! Name the noble gases. What are the common properties between them?
Answer: Other characteristics of the noble gases are that they all conduct electricity, fluoresce, are odorless and colorless, and are used in many conditions when a stable element is needed to maintain a safe and constant environment. This chemical series contains helium, neon, argon, krypton, xenon, and radon.
when a substance melts the kinetic energy
A Decreases then increase
B Decrease
C Stays the same
D Increase
Answer:
C stays The same.
Is the answer.
Help please !
A
B
C
D
Answer:
the answer is letter B. the entropy
How does nano frabic work
Answer:
Nano silver is woven into fabric to give it anti-bacterial properties.
Explanation:
Helps by fending off the bacteria that make those clothes smell after you sweat. Nano-titanium dioxide adds sun protection to clothing just as it does in sunscreen. The use of nanoparticles to achieve fresh-smelling clothes and UV protection may not be safe.
Can someone help me please will give BRAINIEST
Complete the conversions for the following temperature measurements:
55.3C=_____K
255K=_____C
447K=_____C
-14C=_____K
Answer:
55.3 = 328.45k
255 = 18.15°c
447 = 173.85°c
-14 = 14k
A sealed can of soda contain a pressure of 1.15 atm at 23°C. What is the new pressure at 79 °C? Report your answer to the hundredths place (two decimal places) You do NOT need units in your answer
Answer:
P₂ = 1.37
Explanation:
Given data:
Initial pressure = 1.15 atm
Initial temperature = 23°C (23+273= 296 K)
Final pressure = ?
Final temperature = 79°C (79+273=352 K)
Solution:
According to Gay-Lussac Law,
The pressure of given amount of a gas is directly proportional to its temperature at constant volume and number of moles.
Mathematical relationship:
P₁/T₁ = P₂/T₂
Now we will put the values in formula:
1.15 atm / 296 K = P₂/352 K
P₂ = 1.15 atm × 352 K / 296 K
P₂ = 404.8 atm. K /296 K
P₂ = 1.37 atm
Sodium metal reacts violently with water and chlorine is a toxic gas, yet we eat sodium chloride. Why is this possible? Select one: a. The properties of compounds are different from the properties of the elements that form the compounds.
b. The properties of compounds are identical to the properties of the elements that form the compounds, and we should not eat sodium chloride because it is toxic.
c. The physical properties of compounds are different from the physical properties of the elements that form the compounds, but the chemical properties of the elements and compound are the same.
d. The chemical properties of compounds are different from the chemical properties of the elements that form the compounds, but the physical properties of the elements and compound are the same.
Answer:
The properties of compounds are different from the properties of the elements that form the compounds.
Explanation:
When elements form compounds, their properties are significantly modified. The physical and chemical properties of compounds and that of the elements that compose them are significantly different.
The introduction of chemical bonds between different atoms in compounds make the compounds to differ from elements where the atoms are bonded to atoms of the same element.
An oxide named CrO. So the salt of chromium has the corresponding valence
Answer:
this question doesnt make any sene
Explanation:
What determines the appearance of the moon from earth?
To solve this we must be knowing each and every concept related to satellite. Therefore, moon phases and moon placements have a role the appearance of the moon from earth.
What is satellite?Any object that circles a planet in a curved route is considered a satellite. There are several man-made (manufactured) satellites, most of which are closer to Earth than the moon, which is Earth's original natural satellite.
We must revisit our buddy Newton in order to comprehend why satellites move in this manner. Gravity, according to Newton, is a force that unites all of the universe's objects. Moon phases and moon placements have a role in determining this. The only major factor affecting the Moon's phase is where it is in relation to Earth and the Sun.
Therefore, moon phases and moon placements have a role the appearance of the moon from earth.
To learn more about satellite, here:
https://brainly.com/question/21034894
#SPJ2
Which bond is a very strong dipole-dipole force?
A. A covalent bond
B. An ionic bond
C. A hydrogen bond
D. A metallic bond
Answer : C. A hydrogen bond
Explanation:
Answer:
A. covalent bond
Explanation:
dipole-dipole interaction results from difference in electronegativity , eg H-F where Fluorine has strong electronegativity but Hydrogen has less electronegativity. hence the bond has dipole moment towards F atom.
Darwin told us that science:
saves lives
Answer:yup!!
Explanation:
A student observes that a popcorn kernel has a hard coat. He places the kernel in a moist paper towel and observes it for several days. He notices that the coat splits and a small root emerges. He concludes that
Answer: Water inside the seed coat creating a pushing force, breaking the seed coat.
Explanation:
Seed germination can be defined as the process by which a new plant emerge out from a seed. The radicle is the first emerging part from a seed and it develops into a root and the plumule is the second emerging part and it develops into a shoot. The light, water, adequate temperature, and soil are the factors that are necessary for seed germination.
According to a given situation, the popcorn kernel will receive the moisture necessary for the germination process, the water will imbibe into the seed coat creating pressure inside the seed and which will cause the seed coat to break and the new plant parts or seedling will emerge out of the seed coat.
Which compound is
ionic?
Answer:
chemistry
Explanation:
Does Rubidium (Rb) have high or low electronegativity?
Answer:
high
Explanation:
During free fall which object would have a greater acceleration, an object with a mass of 240 kg or an object with a mass of 10 kg? Explain your answer.
Answer:
Leroy Jeakins
Explanation:
Catus jack f me in the asss
True or False;
aa is faster moving lava than pahoehoe?
Answer:
It is false :l
Explanation:
Pahoehoe is a smooth and continuous lava crust. Pahoehoe forms when the effusion rate is low and consequently the velocity of lava flow is slow. Pahoehoe lava flow is usually at least 10 times slower than typical aa lava flow.
:/
If a neutral compound is composed of carbon and hydrogen and you know that it has exactly 2 carbons connected by a double bond, how many hydrogens will the compound have?
Answer: 4 hydrogens
Explanation:
This is what the structure will look like C=C. Remember that it's important that all structures have a complete octet. As it looks right now each carbon is sharing 4 valence electrons so each needs 2 more bonds to hydrogen complete its octet.
Answer: 4 hydrogens
Explanation:
The total amount of energy before and after a chemical reaction is the same. Therefore, energy is _____.
created
destroyed
converted
conserved
Answer:
Option (a) is the correct answer.
Explanation:
The law of conservation of energy states that energy can neither be created nor it can be destroyed. It can only be transformed from one form to another.
Therefore, the total amount of energy before and after a chemical reaction is the same. Thus, energy is conserved.
Therefore, we can conclude that option (a) is the correct answer.
Answer:
conserved
Explanation:
law of conservation of energy says that energy can neither be created or destroyed
What is the molarity of a hydrochloric acid solution, when 30.0 mL is neutralized by 48.0 mL of 0.100 mol/L
calcium hydroxide?
The molarity of a hydrochloric acid solution : 0.32 M
Further explanationTitration is a procedure for determining the concentration of a solution by reacting with another solution which is known to be concentrated (usually a standard solution).
Titrations can be distinguished including acid-base titration, depositional titration, and redox titration. An acid-base titration is the principle of neutralization of acids and bases is used.
Acid-base titration formula
Ma. Va. na = Mb. Vb. nb
Ma, Mb = acid base concentration
Va, Vb = acid base volume
na, nb = acid base valence
1 ⇒HCl (valence=1, HCl ⇒H⁺+Cl⁻, one H⁺)
2⇒Ca(OH)₂(valence=2, Ca(OH)₂⇒Ca²⁺+2OH⁻, two OH⁻)
M₂=0.1 M
V₂=48 ml=0.048 L
V₁=30 ml=0.03 L
[tex]\tt M_1.V_1.n_1=M_2.V_2.n_2\\\\M_1\times 0.03\times 1=0.1\times 0.048\times 2\\\\M_1=0.32[/tex]
is xenon a metal and is Beryllium a metal
Answer:
No and yes
Explanation:
Xenon is a noble gas and beryllium is a metal
Answer: no and yes i also agree
Xenon is a noble gas and Beryllium a metal
Explanation: